# Drug molecule screening agent

> [!NOTE]
> Code available [here](https://github.com/unionai/unionai-examples/tree/main/v2/tutorials/drug_molecule_screening).

This tutorial builds an **agentic** virtual drug-screening workflow on Flyte. A medicinal-chemistry agent interprets your therapeutic goal in plain language, derives screening criteria, and composes durable RDKit stage tasks — while the scientific core (property computation, Lipinski filters, Tanimoto similarity, ranking, and HTML reports) stays in trusted, deterministic tools.

The pattern follows how cheminformatics agents like ChemCrow and PharmAgents are built: **the LLM plans and reflects; RDKit computes.**

Flyte provides:

- **Flyte-native agent orchestration** via `flyte.ai.agents.Agent` — see [Flyte-native agents](https://www.union.ai/docs/v2/union/user-guide/build-agent/flyte-agents/page.md)
- **Typed agent tool I/O** — Flyte 2.5.4+ passes `flyte.io.Dir`, `File`, and `DataFrame` between agent tool calls so the LLM can compose multi-step pipelines directly
- **Cached molecule loading** so repeated runs skip re-parsing SMILES
- **Report-enabled stage tasks** that stream property charts, similarity matrices, and candidate spotlights as each step completes
- **Hybrid iteration** — the agent re-runs `screen_candidates` and `generate_report` with adjusted criteria when the funnel is too narrow, reusing cached `molecule_dir` and `properties_json`

> [!NOTE] Prerequisites
> Create an Anthropic API key secret (the key name must match the `TaskEnvironment`):
>
> ```
> flyte create secret internal-anthropic-api-key <YOUR_ANTHROPIC_API_KEY>
> ```
>
> See [Secrets](https://www.union.ai/docs/v2/union/user-guide/task-configuration/secrets/page.md) for scoping and file-based secrets.

## Define the task environment

The pipeline runs on CPU with RDKit, LiteLLM, and system libraries for 2D structure rendering.

```
# /// script
# requires-python = ">=3.12"
# dependencies = [
#    "flyte>=2.5.4",
#    "litellm",
#    "rdkit",
#    "numpy",
#    "scikit-learn",
#    "pillow",
# ]
# main = "pipeline"
# params = ""
# ///
"""Virtual drug molecule screening — compute properties, apply Lipinski filters, rank candidates."""

import base64
import io
import json
import logging
import math
import os
import tempfile

import flyte
import flyte.io
import flyte.report
from flyte.ai.agents import Agent, tool

MODEL = os.getenv("DRUG_SCREENING_MODEL", "claude-haiku-4-5")

# {{docs-fragment env}}
main_img = flyte.Image.from_uv_script(__file__, name="drug-molecule-screening", pre=True).with_apt_packages(
    "libxrender1", "libxext6", "libexpat1",
)

env = flyte.TaskEnvironment(
    name="drug-molecule-screening",
    image=main_img,
    resources=flyte.Resources(cpu=2, memory="6Gi"),
    secrets=[
        flyte.Secret(key="internal-anthropic-api-key", as_env_var="ANTHROPIC_API_KEY"),
    ],
)
# {{/docs-fragment env}}

logging.basicConfig(level=logging.WARNING, format="%(message)s", force=True)
log = logging.getLogger(__name__)
log.setLevel(logging.INFO)

# ------------------------------------------------------------------
# Default molecule library — real SMILES for well-known drugs
# ------------------------------------------------------------------

DEFAULT_MOLECULES = {
    "Aspirin": "CC(=O)OC1=CC=CC=C1C(=O)O",
    "Ibuprofen": "CC(C)CC1=CC=C(C=C1)C(C)C(=O)O",
    "Caffeine": "CN1C=NC2=C1C(=O)N(C(=O)N2C)C",
    "Penicillin G": "CC1(C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C",
    "Metformin": "CN(C)C(=N)NC(=N)N",
    "Paracetamol": "CC(=O)NC1=CC=C(C=C1)O",
    "Diazepam": "ClC1=CC2=C(C=C1)N(C(=O)CN=C2C3=CC=CC=C3)C",
    "Omeprazole": "CC1=CN=C(C(=C1OC)C)CS(=O)C2=NC3=CC=CC=C3N2",
    "Atorvastatin": "CC(C)C1=C(C(=C(N1CCC(CC(CC(=O)O)O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4",
    "Methotrexate": "CN(CC1=CN=C2N=C(N=C(N)C2=N1)N)C3=CC=C(C=C3)C(=O)NC(CCC(=O)O)C(=O)O",
    "Doxorubicin": "CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)CO)O)N)O",
    "Tamoxifen": "CCC(=C(C1=CC=CC=C1)C2=CC=C(C=C2)OCCN(C)C)C3=CC=CC=C3",
    "Lopinavir": "CC1=C(C(=CC=C1)C)OCC(=O)NC(CC2=CC=CC=C2)C(CC(CC3=CC=CC=C3)NC(=O)C(C(C)C)N4CCCNC4=O)O",
    "Remdesivir": "CCC(CC)COC(=O)C(C)NP(=O)(OCC1C(C(C(O1)C2=CC=C3N2N=CN=C3N)O)O)OC4=CC=CC=C4",
    "Erlotinib": "COCCOC1=CC2=C(C=C1OCCOC)C(=NC=N2)NC3=CC=CC(=C3)C#C",
}

# ------------------------------------------------------------------
# Report styling — pharma blue/cyan theme
# ------------------------------------------------------------------

REPORT_CSS = """
<style>
  .report { font-family: system-ui, -apple-system, sans-serif; max-width: 960px; margin: 0 auto; color: #1a1a2e; }
  .report h2 { color: #0e4f6e; border-bottom: 2px solid #0891b2; padding-bottom: 8px; margin-top: 24px; }
  .report h3 { color: #155e75; margin-top: 20px; }
  .report .card { background: #ecfeff; border: 1px solid #a5f3fc; border-radius: 8px; padding: 16px; margin: 12px 0; }
  .report .stat-grid { display: grid; grid-template-columns: repeat(auto-fit, minmax(160px, 1fr)); gap: 12px; margin: 12px 0; }
  .report .stat { background: #fff; border: 1px solid #cffafe; border-radius: 6px; padding: 12px; text-align: center; }
  .report .stat .value { font-size: 1.5em; font-weight: 700; color: #0e4f6e; }
  .report .stat .label { font-size: 0.85em; color: #6c757d; margin-top: 4px; }
  .report table { border-collapse: collapse; width: 100%; margin: 12px 0; }
  .report th { background: #0e4f6e; color: #fff; padding: 10px 14px; text-align: left; font-weight: 600; }
  .report td { padding: 8px 14px; border-bottom: 1px solid #cffafe; }
  .report tr:nth-child(even) { background: #ecfeff; }
  .report .badge { display: inline-block; padding: 2px 8px; border-radius: 12px; font-size: 0.8em; font-weight: 600; }
  .report .badge-success { background: #d1fae5; color: #065f46; }
  .report .badge-danger { background: #fee2e2; color: #991b1b; }
  .report .badge-info { background: #cffafe; color: #155e75; }
  .report .chart-container { background: #fff; border: 1px solid #cffafe; border-radius: 8px; padding: 16px; margin: 16px 0; }
  .report .note { background: #ecfeff; border-left: 4px solid #0891b2; padding: 10px 14px; border-radius: 4px; margin: 12px 0; font-size: 0.9em; }
  .report .molecule-card { background: #fff; border: 1px solid #cffafe; border-radius: 8px; padding: 16px; margin: 12px 0; }
  .report .molecule-grid { display: grid; grid-template-columns: repeat(auto-fill, minmax(200px, 1fr)); gap: 12px; margin: 16px 0; }
  .report .funnel { text-align: center; margin: 24px 0; }
</style>
"""

def _wrap_report(html: str) -> str:
    """Wrap HTML content with report styling."""
    return f'{REPORT_CSS}<div class="report">{html}</div>'

# ------------------------------------------------------------------
# SVG chart helpers
# ------------------------------------------------------------------

def _mol_to_data_uri(mol, size: tuple[int, int] = (300, 300)) -> str:
    """Convert an RDKit molecule to a PNG base64 data URI."""
    from rdkit.Chem import Draw

    img = Draw.MolToImage(mol, size=size)
    buf = io.BytesIO()
    img.save(buf, format="PNG")
    b64 = base64.b64encode(buf.getvalue()).decode()
    return f"data:image/png;base64,{b64}"

def _make_bar_chart(
    labels: list[str],
    series: dict[str, list[float]],
    title: str = "",
    colors: list[str] | None = None,
    width: int = 700,
    height: int = 340,
    y_max_cap: float | None = None,
    horizontal: bool = False,
    value_fmt: str = ".1f",
) -> str:
    """Generate an SVG grouped bar chart.

    Args:
        labels: Category labels.
        series: Dict mapping series name to list of values.
        title: Chart title.
        colors: Colors for each series.
        width/height: SVG dimensions.
        y_max_cap: Cap the y-axis at this value.
        horizontal: If True, draw horizontal bars.
        value_fmt: Format string for value labels.

    Returns:
        SVG string.
    """
    if not labels:
        return ""

    default_colors = ["#0891b2", "#0e4f6e", "#06d6a0", "#a5f3fc", "#155e75"]
    colors = colors or default_colors

    if horizontal:
        return _make_horizontal_bar_chart(labels, series, title, colors, width, height, value_fmt)

    ml, mr, mt, mb = 60, 20, 40, 60
    cw = width - ml - mr
    ch = height - mt - mb

    all_vals = [v for vals in series.values() for v in vals]
    y_max = max(all_vals) if all_vals else 1
    y_max_plot = y_max * 1.15 or 1
    if y_max_cap is not None:
        y_max_plot = min(y_max_plot, y_max_cap) or y_max_cap

    n_groups = len(labels)
    n_series = len(series)
    group_width = cw / n_groups
    bar_width = group_width * 0.7 / max(n_series, 1)
    gap = group_width * 0.15

    def sy(v):
        return mt + ch - (v / y_max_plot) * ch

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    # Grid lines
    for i in range(6):
        y_tick = y_max_plot * i / 5
        py = sy(y_tick)
        svg.append(
            f'<line x1="{ml}" y1="{py:.1f}" x2="{ml + cw}" y2="{py:.1f}" '
            f'stroke="#e0f2fe" stroke-width="1"/>'
        )
        svg.append(
            f'<text x="{ml - 8}" y="{py + 4:.1f}" text-anchor="end" '
            f'font-size="11" fill="#6c757d">{y_tick:{value_fmt}}</text>'
        )

    # Axes
    svg.append(
        f'<line x1="{ml}" y1="{mt}" x2="{ml}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )
    svg.append(
        f'<line x1="{ml}" y1="{mt + ch}" x2="{ml + cw}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )

    # Bars
    for gi, label in enumerate(labels):
        gx = ml + gi * group_width + gap
        for si, (name, vals) in enumerate(series.items()):
            color = colors[si % len(colors)]
            bx = gx + si * bar_width
            val = vals[gi]
            by = sy(val)
            bh = mt + ch - by
            svg.append(
                f'<rect x="{bx:.1f}" y="{by:.1f}" width="{bar_width - 1:.1f}" '
                f'height="{bh:.1f}" fill="{color}" rx="2"/>'
            )
            svg.append(
                f'<text x="{bx + bar_width / 2:.1f}" y="{by - 4:.1f}" '
                f'text-anchor="middle" font-size="9" fill="#1a1a2e">'
                f'{val:{value_fmt}}</text>'
            )
        # Truncate long labels
        disp_label = label if len(label) <= 12 else label[:10] + ".."
        svg.append(
            f'<text x="{gx + n_series * bar_width / 2:.1f}" y="{mt + ch + 16}" '
            f'text-anchor="middle" font-size="10" fill="#6c757d" '
            f'transform="rotate(-35, {gx + n_series * bar_width / 2:.1f}, {mt + ch + 16})">'
            f'{disp_label}</text>'
        )

    # Title
    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    # Legend
    if n_series > 1:
        lx = ml + cw - len(series) * 100
        for si, name in enumerate(series):
            color = colors[si % len(colors)]
            svg.append(
                f'<rect x="{lx + si * 100}" y="{mt + ch + 40}" width="12" '
                f'height="12" rx="2" fill="{color}"/>'
            )
            svg.append(
                f'<text x="{lx + si * 100 + 16}" y="{mt + ch + 51}" font-size="11" '
                f'fill="#1a1a2e">{name}</text>'
            )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_horizontal_bar_chart(
    labels: list[str],
    series: dict[str, list[float]],
    title: str = "",
    colors: list[str] | None = None,
    width: int = 700,
    height: int = 400,
    value_fmt: str = ".1f",
) -> str:
    """Generate an SVG horizontal bar chart (sorted)."""
    default_colors = ["#0891b2", "#0e4f6e", "#06d6a0"]
    colors = colors or default_colors

    n = len(labels)
    row_height = max(22, min(35, (height - 80) // max(n, 1)))
    actual_height = max(height, 80 + n * row_height)
    ml, mr, mt, mb = 120, 60, 40, 20
    cw = width - ml - mr
    ch = actual_height - mt - mb

    # Use first series
    first_key = list(series.keys())[0]
    vals = series[first_key]
    x_max = max(vals) * 1.15 if vals else 1

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {actual_height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{actual_height}" fill="#fff" rx="6"/>',
    ]

    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    bar_h = row_height * 0.65
    for i, (label, val) in enumerate(zip(labels, vals)):
        y = mt + i * row_height
        bw = (val / x_max) * cw if x_max else 0
        color = colors[i % len(colors)]
        # Label
        disp = label if len(label) <= 14 else label[:12] + ".."
        svg.append(
            f'<text x="{ml - 8}" y="{y + bar_h / 2 + 4:.1f}" text-anchor="end" '
            f'font-size="11" fill="#1a1a2e">{disp}</text>'
        )
        # Bar
        svg.append(
            f'<rect x="{ml}" y="{y:.1f}" width="{bw:.1f}" height="{bar_h:.1f}" '
            f'fill="{color}" rx="3"/>'
        )
        # Value
        svg.append(
            f'<text x="{ml + bw + 6:.1f}" y="{y + bar_h / 2 + 4:.1f}" '
            f'font-size="11" fill="#0e4f6e" font-weight="600">{val:{value_fmt}}</text>'
        )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_heatmap(
    matrix: list[list[float]],
    row_labels: list[str],
    col_labels: list[str],
    title: str = "",
    color_scale: str = "cyan",
    width: int = 700,
    height: int = 500,
    value_fmt: str = ".2f",
) -> str:
    """Generate an SVG heatmap.

    Args:
        matrix: 2D list of values (rows x cols).
        row_labels: Labels for rows.
        col_labels: Labels for columns.
        title: Chart title.
        color_scale: Color scheme ("cyan", "red", "green").
        width/height: SVG dimensions.
        value_fmt: Format string for cell values.

    Returns:
        SVG string.
    """
    if not matrix or not matrix[0]:
        return ""

    n_rows = len(matrix)
    n_cols = len(matrix[0])

    ml, mr, mt, mb = 110, 20, 70, 20
    cw = width - ml - mr
    ch = height - mt - mb
    cell_w = cw / n_cols
    cell_h = ch / n_rows

    # Flatten to find range
    flat = [v for row in matrix for v in row]
    v_min = min(flat)
    v_max = max(flat)
    v_range = v_max - v_min or 1

    def color_for(v):
        t = (v - v_min) / v_range
        if color_scale == "cyan":
            # White to deep teal
            r = int(255 - t * (255 - 14))
            g = int(255 - t * (255 - 79))
            b = int(255 - t * (255 - 110))
        elif color_scale == "red":
            r = int(255 - t * 50)
            g = int(255 - t * 200)
            b = int(255 - t * 200)
        else:  # green
            r = int(255 - t * 200)
            g = int(255 - t * 50)
            b = int(255 - t * 200)
        return f"rgb({r},{g},{b})"

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    # Column labels (rotated)
    for ci, label in enumerate(col_labels):
        x = ml + ci * cell_w + cell_w / 2
        disp = label if len(label) <= 12 else label[:10] + ".."
        svg.append(
            f'<text x="{x:.1f}" y="{mt - 8}" text-anchor="end" font-size="10" '
            f'fill="#1a1a2e" transform="rotate(-45, {x:.1f}, {mt - 8})">{disp}</text>'
        )

    # Row labels + cells
    for ri, (row_label, row_vals) in enumerate(zip(row_labels, matrix)):
        y = mt + ri * cell_h
        disp = row_label if len(row_label) <= 14 else row_label[:12] + ".."
        svg.append(
            f'<text x="{ml - 8}" y="{y + cell_h / 2 + 4:.1f}" text-anchor="end" '
            f'font-size="10" fill="#1a1a2e">{disp}</text>'
        )
        for ci, val in enumerate(row_vals):
            x = ml + ci * cell_w
            fill = color_for(val)
            svg.append(
                f'<rect x="{x:.1f}" y="{y:.1f}" width="{cell_w:.1f}" '
                f'height="{cell_h:.1f}" fill="{fill}" stroke="#fff" stroke-width="1"/>'
            )
            # Text color: dark on light, light on dark
            t = (val - v_min) / v_range
            txt_color = "#fff" if t > 0.55 else "#1a1a2e"
            # Only show text if cells are large enough
            if cell_w > 30 and cell_h > 18:
                svg.append(
                    f'<text x="{x + cell_w / 2:.1f}" y="{y + cell_h / 2 + 4:.1f}" '
                    f'text-anchor="middle" font-size="9" fill="{txt_color}">'
                    f'{val:{value_fmt}}</text>'
                )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_scatter_plot(
    points: list[dict],
    x_label: str = "MW",
    y_label: str = "LogP",
    title: str = "",
    reference_lines: list[dict] | None = None,
    width: int = 700,
    height: int = 400,
) -> str:
    """Generate an SVG scatter plot.

    Args:
        points: List of dicts with "x", "y", "label" keys.
        x_label/y_label: Axis labels.
        title: Chart title.
        reference_lines: List of dicts with "axis" ("x"/"y"), "value", "label".
        width/height: SVG dimensions.

    Returns:
        SVG string.
    """
    if not points:
        return ""

    ml, mr, mt, mb = 60, 30, 40, 50
    cw = width - ml - mr
    ch = height - mt - mb

    x_vals = [p["x"] for p in points]
    y_vals = [p["y"] for p in points]
    x_min, x_max = min(x_vals) * 0.9, max(x_vals) * 1.1
    y_min, y_max = min(y_vals) - 1, max(y_vals) + 1

    # Extend ranges to include reference lines
    if reference_lines:
        for rl in reference_lines:
            if rl["axis"] == "x":
                x_max = max(x_max, rl["value"] * 1.1)
            else:
                y_max = max(y_max, rl["value"] * 1.1)

    x_range = x_max - x_min or 1
    y_range = y_max - y_min or 1

    def sx(v):
        return ml + (v - x_min) / x_range * cw

    def sy(v):
        return mt + ch - (v - y_min) / y_range * ch

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    # Grid
    for i in range(6):
        y_tick = y_min + y_range * i / 5
        py = sy(y_tick)
        svg.append(
            f'<line x1="{ml}" y1="{py:.1f}" x2="{ml + cw}" y2="{py:.1f}" '
            f'stroke="#e0f2fe" stroke-width="1"/>'
        )
        svg.append(
            f'<text x="{ml - 8}" y="{py + 4:.1f}" text-anchor="end" '
            f'font-size="11" fill="#6c757d">{y_tick:.1f}</text>'
        )

    for i in range(6):
        x_tick = x_min + x_range * i / 5
        px = sx(x_tick)
        svg.append(
            f'<text x="{px:.1f}" y="{mt + ch + 20}" text-anchor="middle" '
            f'font-size="11" fill="#6c757d">{x_tick:.0f}</text>'
        )

    # Axes
    svg.append(
        f'<line x1="{ml}" y1="{mt}" x2="{ml}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )
    svg.append(
        f'<line x1="{ml}" y1="{mt + ch}" x2="{ml + cw}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )

    # Reference lines (Lipinski boundaries)
    if reference_lines:
        for rl in reference_lines:
            if rl["axis"] == "x":
                px = sx(rl["value"])
                svg.append(
                    f'<line x1="{px:.1f}" y1="{mt}" x2="{px:.1f}" y2="{mt + ch}" '
                    f'stroke="#ef4444" stroke-width="1.5" stroke-dasharray="6,4"/>'
                )
                svg.append(
                    f'<text x="{px + 4:.1f}" y="{mt + 14}" font-size="10" '
                    f'fill="#ef4444" font-weight="600">{rl["label"]}</text>'
                )
            else:
                py = sy(rl["value"])
                svg.append(
                    f'<line x1="{ml}" y1="{py:.1f}" x2="{ml + cw}" y2="{py:.1f}" '
                    f'stroke="#ef4444" stroke-width="1.5" stroke-dasharray="6,4"/>'
                )
                svg.append(
                    f'<text x="{ml + cw - 4:.1f}" y="{py - 6:.1f}" text-anchor="end" '
                    f'font-size="10" fill="#ef4444" font-weight="600">{rl["label"]}</text>'
                )

    # Drug-like zone shading (MW<=500 and LogP<=5 quadrant)
    if reference_lines:
        mw_line = next((rl for rl in reference_lines if rl["axis"] == "x"), None)
        logp_line = next((rl for rl in reference_lines if rl["axis"] == "y"), None)
        if mw_line and logp_line:
            zx1 = sx(x_min)
            zx2 = sx(min(mw_line["value"], x_max))
            zy1 = sy(min(logp_line["value"], y_max))
            zy2 = sy(y_min)
            svg.append(
                f'<rect x="{zx1:.1f}" y="{zy1:.1f}" '
                f'width="{zx2 - zx1:.1f}" height="{zy2 - zy1:.1f}" '
                f'fill="#0891b2" opacity="0.06" rx="4"/>'
            )
            svg.append(
                f'<text x="{zx1 + 8:.1f}" y="{zy2 - 8:.1f}" font-size="11" '
                f'fill="#0891b2" font-weight="600" opacity="0.6">Drug-like Zone</text>'
            )

    # Points
    point_colors = ["#0891b2", "#0e4f6e", "#06d6a0", "#155e75", "#0284c7",
                    "#059669", "#0d9488", "#0369a1", "#047857", "#115e59",
                    "#0c4a6e", "#064e3b", "#1e3a5f", "#134e4a", "#075985"]
    for i, pt in enumerate(points):
        px, py = sx(pt["x"]), sy(pt["y"])
        color = point_colors[i % len(point_colors)]
        svg.append(
            f'<circle cx="{px:.1f}" cy="{py:.1f}" r="5" fill="{color}" '
            f'stroke="#fff" stroke-width="1.5" opacity="0.85"/>'
        )
        # Label offset to avoid overlap
        offset_x = 8
        offset_y = -8 if i % 2 == 0 else 14
        label = pt["label"] if len(pt["label"]) <= 12 else pt["label"][:10] + ".."
        svg.append(
            f'<text x="{px + offset_x:.1f}" y="{py + offset_y:.1f}" '
            f'font-size="9" fill="#1a1a2e">{label}</text>'
        )

    # Title
    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    # Axis labels
    if x_label:
        svg.append(
            f'<text x="{ml + cw / 2}" y="{height - 6}" text-anchor="middle" '
            f'font-size="12" fill="#6c757d">{x_label}</text>'
        )
    if y_label:
        svg.append(
            f'<text x="14" y="{mt + ch / 2}" text-anchor="middle" '
            f'font-size="12" fill="#6c757d" '
            f'transform="rotate(-90, 14, {mt + ch / 2})">{y_label}</text>'
        )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_funnel(
    stages: list[dict],
    title: str = "",
    width: int = 600,
    height: int = 400,
) -> str:
    """Generate an SVG funnel visualization.

    Args:
        stages: List of dicts with "label", "count", "total" keys.
        title: Chart title.
        width/height: SVG dimensions.

    Returns:
        SVG string.
    """
    if not stages:
        return ""

    n = len(stages)
    mt = 50
    mb = 20
    available_h = height - mt - mb
    stage_h = available_h / n
    cx = width / 2

    # Color gradient from light cyan to deep teal
    colors = []
    for i in range(n):
        t = i / max(n - 1, 1)
        r = int(207 - t * (207 - 14))
        g = int(250 - t * (250 - 79))
        b = int(254 - t * (254 - 110))
        colors.append(f"rgb({r},{g},{b})")

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    if title:
        svg.append(
            f'<text x="{cx}" y="28" text-anchor="middle" '
            f'font-size="16" font-weight="700" fill="#0e4f6e">{title}</text>'
        )

    max_count = stages[0]["count"] if stages else 1
    max_width = width * 0.75

    for i, stage in enumerate(stages):
        y_top = mt + i * stage_h
        y_bot = y_top + stage_h

        # Width proportional to count
        w_top = max_width * (stage["count"] / max_count) if i == 0 else prev_w_bot
        if i < n - 1:
            w_bot = max_width * (stages[i + 1]["count"] / max_count)
        else:
            w_bot = max_width * (stage["count"] / max_count) * 0.7

        prev_w_bot = w_bot

        # Trapezoid
        x1_top = cx - w_top / 2
        x2_top = cx + w_top / 2
        x1_bot = cx - w_bot / 2
        x2_bot = cx + w_bot / 2

        svg.append(
            f'<polygon points="{x1_top:.1f},{y_top:.1f} {x2_top:.1f},{y_top:.1f} '
            f'{x2_bot:.1f},{y_bot:.1f} {x1_bot:.1f},{y_bot:.1f}" '
            f'fill="{colors[i]}" stroke="#fff" stroke-width="2"/>'
        )

        # Text: dark on light, white on dark
        t = i / max(n - 1, 1)
        txt_color = "#0e4f6e" if t < 0.5 else "#fff"
        y_mid = (y_top + y_bot) / 2

        svg.append(
            f'<text x="{cx}" y="{y_mid - 4:.1f}" text-anchor="middle" '
            f'font-size="13" font-weight="600" fill="{txt_color}">{stage["label"]}</text>'
        )
        svg.append(
            f'<text x="{cx}" y="{y_mid + 14:.1f}" text-anchor="middle" '
            f'font-size="12" fill="{txt_color}" opacity="0.85">'
            f'{stage["count"]} / {stage["total"]}</text>'
        )

    svg.append("</svg>")
    return "\n".join(svg)

# ------------------------------------------------------------------
# Task 1: Load and validate molecules
# ------------------------------------------------------------------

@tool
@env.task(cache="auto")
async def load_molecules(
    molecules_json: str = "",
) -> flyte.io.Dir:
    """Parse SMILES strings, validate with RDKit, generate 2D depictions.

    Args:
        molecules_json: JSON string mapping molecule names to SMILES.
            Defaults to a curated library of ~15 well-known drugs.

    Returns:
        flyte.io.Dir containing molecule data (JSON + PNG depictions).
        Pass this directory to compute_properties and generate_report.
    """
    from rdkit import Chem
    from rdkit.Chem import Draw

    if molecules_json.strip():
        molecules = json.loads(molecules_json)
    else:
        molecules = DEFAULT_MOLECULES

    out_dir = tempfile.mkdtemp(prefix="mol_library_")
    results = []
    valid_count = 0
    invalid_count = 0

    log.info(f"Parsing {len(molecules)} molecules...")

    for name, smiles in molecules.items():
        mol = Chem.MolFromSmiles(smiles)
        if mol is None:
            log.warning(f"  [INVALID] {name}: {smiles}")
            invalid_count += 1
            continue

        valid_count += 1

        # Generate 2D depiction as PNG
        img = Draw.MolToImage(mol, size=(300, 300))
        img_path = os.path.join(out_dir, f"{name.replace(' ', '_')}.png")
        img.save(img_path)

        results.append({
            "name": name,
            "smiles": smiles,
            "valid": True,
            "image_file": os.path.basename(img_path),
        })

    # Save molecule manifest
    manifest = {
        "total": len(molecules),
        "valid": valid_count,
        "invalid": invalid_count,
        "molecules": results,
    }
    manifest_path = os.path.join(out_dir, "manifest.json")
    with open(manifest_path, "w") as f:
        json.dump(manifest, f, indent=2)

    log.info(f"Loaded {valid_count} valid molecules ({invalid_count} invalid)")

    return await flyte.io.Dir.from_local(out_dir)

# ------------------------------------------------------------------
# Task 2: Compute physicochemical properties
# ------------------------------------------------------------------

@tool
@env.task(report=True)
async def compute_properties(
    molecule_dir: flyte.io.Dir,
) -> str:
    """Compute drug-likeness properties for all molecules.

    Computes MW, LogP, HBD, HBA, TPSA, rotatable bonds, formal charge,
    ring count, QED, and Lipinski Rule of Five compliance.

    Args:
        molecule_dir: Directory from load_molecules.

    Returns:
        JSON string with all computed properties. Pass to screen_candidates
        and generate_report.
    """
    from rdkit import Chem
    from rdkit.Chem import Descriptors, Lipinski
    from rdkit.Chem.QED import qed

    # --- Loading report ---
    await flyte.report.replace.aio(
        _wrap_report("<h2>Computing Molecular Properties...</h2>"
                      "<p>Analyzing physicochemical descriptors for all molecules.</p>"),
        do_flush=True,
    )

    mol_dir = await molecule_dir.download()
    with open(os.path.join(mol_dir, "manifest.json")) as f:
        manifest = json.load(f)

    molecules_data = []
    lipinski_pass = 0

    for mol_info in manifest["molecules"]:
        mol = Chem.MolFromSmiles(mol_info["smiles"])
        if mol is None:
            continue

        mw = Descriptors.MolWt(mol)
        logp = Descriptors.MolLogP(mol)
        hbd = Lipinski.NumHDonors(mol)
        hba = Lipinski.NumHAcceptors(mol)
        tpsa = Descriptors.TPSA(mol)
        rotatable = Lipinski.NumRotatableBonds(mol)
        formal_charge = Chem.GetFormalCharge(mol)
        num_rings = Lipinski.RingCount(mol)
        qed_score = qed(mol)

        # Lipinski Rule of Five
        lipinski = {
            "mw_ok": mw <= 500,
            "logp_ok": logp <= 5,
            "hbd_ok": hbd <= 5,
            "hba_ok": hba <= 10,
        }
        lipinski_all = all(lipinski.values())
        if lipinski_all:
            lipinski_pass += 1

        # Read image for data URI
        img_path = os.path.join(mol_dir, mol_info["image_file"])
        data_uri = ""
        if os.path.exists(img_path):
            with open(img_path, "rb") as img_f:
                b64 = base64.b64encode(img_f.read()).decode()
                data_uri = f"data:image/png;base64,{b64}"

        molecules_data.append({
            "name": mol_info["name"],
            "smiles": mol_info["smiles"],
            "mw": round(mw, 2),
            "logp": round(logp, 2),
            "hbd": hbd,
            "hba": hba,
            "tpsa": round(tpsa, 2),
            "rotatable_bonds": rotatable,
            "formal_charge": formal_charge,
            "num_rings": num_rings,
            "qed": round(qed_score, 4),
            "lipinski": lipinski,
            "lipinski_pass": lipinski_all,
            "image_data_uri": data_uri,
        })

    total = len(molecules_data)
    avg_mw = sum(m["mw"] for m in molecules_data) / total if total else 0
    avg_logp = sum(m["logp"] for m in molecules_data) / total if total else 0
    lipinski_rate = lipinski_pass / total * 100 if total else 0

    # ---- Build report ----
    html_parts = []

    # Header
    html_parts.append("<h2>Molecular Properties Analysis</h2>")

    # Stat grid
    html_parts.append('<div class="stat-grid">')
    for val, label in [
        (str(total), "Total Molecules"),
        (f"{lipinski_rate:.0f}%", "Lipinski Pass Rate"),
        (f"{avg_mw:.1f}", "Avg. MW (Da)"),
        (f"{avg_logp:.2f}", "Avg. LogP"),
    ]:
        html_parts.append(
            f'<div class="stat"><div class="value">{val}</div>'
            f'<div class="label">{label}</div></div>'
        )
    html_parts.append("</div>")

    # Molecule gallery
    html_parts.append("<h3>Molecule Library</h3>")
    html_parts.append('<div class="molecule-grid">')
    for m in molecules_data:
        if m["image_data_uri"]:
            badge_class = "badge-success" if m["lipinski_pass"] else "badge-danger"
            badge_text = "Lipinski Pass" if m["lipinski_pass"] else "Lipinski Fail"
            html_parts.append(
                f'<div class="molecule-card" style="text-align:center;">'
                f'<img src="{m["image_data_uri"]}" style="width:160px;height:160px;object-fit:contain;"/>'
                f'<div style="font-weight:600;margin-top:6px;color:#0e4f6e;">{m["name"]}</div>'
                f'<div style="font-size:0.8em;color:#6c757d;">MW: {m["mw"]:.1f} | LogP: {m["logp"]:.2f}</div>'
                f'<div><span class="badge {badge_class}">{badge_text}</span></div>'
                f'</div>'
            )
    html_parts.append("</div>")

    # MW bar chart (horizontal, sorted)
    sorted_by_mw = sorted(molecules_data, key=lambda m: m["mw"], reverse=True)
    mw_labels = [m["name"] for m in sorted_by_mw]
    mw_vals = [m["mw"] for m in sorted_by_mw]
    mw_chart = _make_bar_chart(
        mw_labels, {"MW (Da)": mw_vals},
        title="Molecular Weight Distribution",
        horizontal=True,
        width=700, height=max(300, len(mw_labels) * 30 + 80),
        value_fmt=".1f",
    )
    html_parts.append("<h3>Molecular Weight</h3>")
    html_parts.append(f'<div class="chart-container">{mw_chart}</div>')

    # LogP vs MW scatter plot
    scatter_points = [
        {"x": m["mw"], "y": m["logp"], "label": m["name"]}
        for m in molecules_data
    ]
    scatter_chart = _make_scatter_plot(
        scatter_points,
        x_label="Molecular Weight (Da)",
        y_label="LogP",
        title="LogP vs. Molecular Weight (Lipinski Boundaries)",
        reference_lines=[
            {"axis": "x", "value": 500, "label": "MW = 500"},
            {"axis": "y", "value": 5, "label": "LogP = 5"},
        ],
        width=700,
        height=420,
    )
    html_parts.append("<h3>Lipinski Space</h3>")
    html_parts.append(f'<div class="chart-container">{scatter_chart}</div>')

    # Property heatmap (molecules x properties)
    prop_names = ["MW", "LogP", "HBD", "HBA", "TPSA", "Rot. Bonds"]
    # Normalize each property to 0-1 for heatmap
    raw_matrix = []
    for m in molecules_data:
        raw_matrix.append([m["mw"], m["logp"], m["hbd"], m["hba"], m["tpsa"], m["rotatable_bonds"]])

    # Normalize per column
    n_props = len(prop_names)
    col_min = [min(row[c] for row in raw_matrix) for c in range(n_props)]
    col_max = [max(row[c] for row in raw_matrix) for c in range(n_props)]
    norm_matrix = []
    for row in raw_matrix:
        norm_row = []
        for c in range(n_props):
            rng = col_max[c] - col_min[c]
            norm_row.append((row[c] - col_min[c]) / rng if rng else 0.5)
        norm_matrix.append(norm_row)

    heatmap_labels = [m["name"] for m in molecules_data]
    heatmap = _make_heatmap(
        norm_matrix, heatmap_labels, prop_names,
        title="Normalized Property Heatmap",
        color_scale="cyan",
        width=700,
        height=max(400, len(heatmap_labels) * 28 + 100),
    )
    html_parts.append("<h3>Property Heatmap</h3>")
    html_parts.append(f'<div class="chart-container">{heatmap}</div>')

    # Lipinski compliance table
    html_parts.append("<h3>Lipinski Rule of Five Compliance</h3>")
    html_parts.append("<table><tr><th>Molecule</th><th>MW &le; 500</th>"
                      "<th>LogP &le; 5</th><th>HBD &le; 5</th>"
                      "<th>HBA &le; 10</th><th>Overall</th></tr>")
    for m in molecules_data:
        lip = m["lipinski"]

        def _badge(ok):
            if ok:
                return '<span class="badge badge-success">Pass</span>'
            return '<span class="badge badge-danger">Fail</span>'

        overall_badge = _badge(m["lipinski_pass"])
        html_parts.append(
            f'<tr><td><strong>{m["name"]}</strong></td>'
            f'<td>{_badge(lip["mw_ok"])}</td>'
            f'<td>{_badge(lip["logp_ok"])}</td>'
            f'<td>{_badge(lip["hbd_ok"])}</td>'
            f'<td>{_badge(lip["hba_ok"])}</td>'
            f'<td>{overall_badge}</td></tr>'
        )
    html_parts.append("</table>")

    # QED bar chart
    sorted_by_qed = sorted(molecules_data, key=lambda m: m["qed"], reverse=True)
    qed_labels = [m["name"] for m in sorted_by_qed]
    qed_vals = [m["qed"] for m in sorted_by_qed]
    qed_chart = _make_bar_chart(
        qed_labels, {"QED Score": qed_vals},
        title="Drug-likeness (QED Score)",
        horizontal=True,
        width=700, height=max(300, len(qed_labels) * 30 + 80),
        value_fmt=".3f",
        colors=["#06d6a0"],
    )
    html_parts.append("<h3>Drug-likeness (QED)</h3>")
    html_parts.append(f'<div class="chart-container">{qed_chart}</div>')

    # Flush full report
    await flyte.report.replace.aio(
        _wrap_report("\n".join(html_parts)),
        do_flush=True,
    )

    # Return properties as JSON (strip image data URIs to reduce size)
    output = {
        "total": total,
        "lipinski_pass_count": lipinski_pass,
        "lipinski_pass_rate": round(lipinski_rate, 2),
        "avg_mw": round(avg_mw, 2),
        "avg_logp": round(avg_logp, 2),
        "molecules": [
            {k: v for k, v in m.items() if k != "image_data_uri"}
            for m in molecules_data
        ],
    }
    return json.dumps(output)

# ------------------------------------------------------------------
# Task 3: Screen candidates against target profile
# ------------------------------------------------------------------

@tool
@env.task(report=True)
async def screen_candidates(
    properties_json: str,
    target_profile: str = "",
) -> str:
    """Screen molecules against a target drug profile and rank candidates.

    Scores each molecule on how well it matches the target profile, computes
    pairwise Tanimoto similarity, and produces a ranked list.

    Args:
        properties_json: JSON from compute_properties.
        target_profile: JSON string with desired property ranges
            (e.g. {"mw": [150, 500], "logp": [-0.5, 5.0]}).

    Returns:
        JSON string with ranked_molecules, similarity_matrix, similarity_labels,
        funnel, and target_profile. Pass the full return value verbatim to
        generate_report along with molecule_dir and properties_json.
    """
    from rdkit import Chem, DataStructs
    from rdkit.Chem import AllChem

    await flyte.report.replace.aio(
        _wrap_report("<h2>Screening Candidates...</h2>"
                      "<p>Evaluating molecules against the target drug profile.</p>"),
        do_flush=True,
    )

    props = json.loads(properties_json)
    molecules = props["molecules"]

    # Default target profile
    if target_profile.strip():
        profile = json.loads(target_profile)
    else:
        profile = {
            "mw": [150, 500],
            "logp": [-0.5, 5.0],
            "hbd": [0, 5],
            "hba": [0, 10],
            "tpsa": [20, 140],
        }

    # --- Screening ---
    funnel_total = len(molecules)
    pass_mw = 0
    pass_logp = 0
    pass_lipinski = 0
    final_candidates = 0

    scored = []
    for m in molecules:
        score = 0
        max_score = 0
        criteria = {}

        # Check each profile criterion
        checks = [
            ("mw", m["mw"]),
            ("logp", m["logp"]),
            ("hbd", m["hbd"]),
            ("hba", m["hba"]),
            ("tpsa", m["tpsa"]),
        ]

        for key, val in checks:
            if key in profile:
                lo, hi = profile[key]
                max_score += 1
                in_range = lo <= val <= hi
                criteria[key] = in_range
                if in_range:
                    score += 1
                    # Bonus: closer to midpoint = higher score
                    mid = (lo + hi) / 2
                    rng = (hi - lo) / 2
                    dist = abs(val - mid) / rng if rng else 0
                    score += max(0, 0.5 * (1 - dist))

        # QED bonus
        score += m["qed"] * 2
        max_score += 2

        # Lipinski bonus
        if m["lipinski_pass"]:
            score += 1
        max_score += 1

        normalized_score = score / max_score if max_score else 0

        # Funnel tracking — cascading filter (each stage requires passing the previous)
        mw_ok = criteria.get("mw", True)
        logp_ok = criteria.get("logp", True)
        if mw_ok:
            pass_mw += 1
            if logp_ok:
                pass_logp += 1
                if m["lipinski_pass"]:
                    pass_lipinski += 1
                    if all(criteria.values()):
                        final_candidates += 1

        scored.append({
            **m,
            "screening_score": round(normalized_score, 4),
            "criteria_met": criteria,
            "all_criteria_met": all(criteria.values()),
        })

    # Sort by score descending
    scored.sort(key=lambda m: m["screening_score"], reverse=True)

    # --- Tanimoto similarity matrix ---
    fps = []
    valid_names = []
    for m in scored:
        mol = Chem.MolFromSmiles(m["smiles"])
        if mol:
            fp = AllChem.GetMorganFingerprintAsBitVect(mol, 2, nBits=2048)
            fps.append(fp)
            valid_names.append(m["name"])

    similarity_matrix = []
    for i in range(len(fps)):
        row = []
        for j in range(len(fps)):
            sim = DataStructs.TanimotoSimilarity(fps[i], fps[j])
            row.append(round(sim, 3))
        similarity_matrix.append(row)

    # ---- Build report ----
    html_parts = []
    html_parts.append("<h2>Candidate Screening Results</h2>")

    # Stat grid
    html_parts.append('<div class="stat-grid">')
    for val, label in [
        (str(funnel_total), "Total Screened"),
        (str(pass_lipinski), "Lipinski Passes"),
        (str(final_candidates), "All Criteria Met"),
        (f"{scored[0]['screening_score']:.3f}" if scored else "N/A", "Top Score"),
    ]:
        html_parts.append(
            f'<div class="stat"><div class="value">{val}</div>'
            f'<div class="label">{label}</div></div>'
        )
    html_parts.append("</div>")

    # Screening funnel
    funnel_stages = [
        {"label": "Total Molecules", "count": funnel_total, "total": funnel_total},
        {"label": "Pass MW Filter", "count": pass_mw, "total": funnel_total},
        {"label": "Pass LogP Filter", "count": pass_logp, "total": funnel_total},
        {"label": "Lipinski Compliant", "count": pass_lipinski, "total": funnel_total},
        {"label": "All Criteria Met", "count": final_candidates, "total": funnel_total},
    ]
    funnel_svg = _make_funnel(
        funnel_stages,
        title="Screening Funnel",
        width=600,
        height=380,
    )
    html_parts.append("<h3>Screening Funnel</h3>")
    html_parts.append(f'<div class="chart-container" style="text-align:center;">{funnel_svg}</div>')

    # Ranked candidates table
    html_parts.append("<h3>Ranked Candidates</h3>")
    html_parts.append(
        "<table><tr><th>Rank</th><th>Molecule</th><th>Score</th>"
        "<th>MW</th><th>LogP</th><th>QED</th><th>Lipinski</th><th>All Criteria</th></tr>"
    )
    for rank, m in enumerate(scored, 1):
        lip_badge = ('<span class="badge badge-success">Pass</span>'
                     if m["lipinski_pass"]
                     else '<span class="badge badge-danger">Fail</span>')
        crit_badge = ('<span class="badge badge-success">Pass</span>'
                      if m["all_criteria_met"]
                      else '<span class="badge badge-danger">Fail</span>')
        # Highlight top 3
        row_style = ' style="background:#ecfeff;font-weight:600;"' if rank <= 3 else ""
        html_parts.append(
            f"<tr{row_style}><td>{rank}</td><td>{m['name']}</td>"
            f"<td>{m['screening_score']:.3f}</td>"
            f"<td>{m['mw']:.1f}</td><td>{m['logp']:.2f}</td>"
            f"<td>{m['qed']:.3f}</td><td>{lip_badge}</td><td>{crit_badge}</td></tr>"
        )
    html_parts.append("</table>")

    # Top 5 candidate cards with structures
    html_parts.append("<h3>Top 5 Candidates</h3>")
    html_parts.append('<div class="molecule-grid">')
    for m in scored[:5]:
        mol = Chem.MolFromSmiles(m["smiles"])
        img_uri = _mol_to_data_uri(mol, size=(250, 250)) if mol else ""
        badge_class = "badge-success" if m["all_criteria_met"] else "badge-info"
        badge_text = "All Criteria Met" if m["all_criteria_met"] else "Partial Match"
        html_parts.append(
            f'<div class="molecule-card" style="text-align:center;">'
            f'<img src="{img_uri}" style="width:140px;height:140px;object-fit:contain;"/>'
            f'<div style="font-weight:700;margin-top:6px;color:#0e4f6e;font-size:1.05em;">{m["name"]}</div>'
            f'<div style="font-size:0.85em;color:#155e75;margin:4px 0;">Score: {m["screening_score"]:.3f}</div>'
            f'<div style="font-size:0.8em;color:#6c757d;">MW: {m["mw"]:.1f} | LogP: {m["logp"]:.2f} | QED: {m["qed"]:.3f}</div>'
            f'<div style="margin-top:4px;"><span class="badge {badge_class}">{badge_text}</span></div>'
            f'</div>'
        )
    html_parts.append("</div>")

    # Tanimoto similarity heatmap
    if similarity_matrix:
        sim_heatmap = _make_heatmap(
            similarity_matrix, valid_names, valid_names,
            title="Pairwise Tanimoto Similarity (Morgan Fingerprints)",
            color_scale="cyan",
            width=700,
            height=max(500, len(valid_names) * 32 + 100),
        )
        html_parts.append("<h3>Chemical Similarity</h3>")
        html_parts.append(f'<div class="chart-container">{sim_heatmap}</div>')

    await flyte.report.replace.aio(
        _wrap_report("\n".join(html_parts)),
        do_flush=True,
    )

    output = {
        "ranked_molecules": scored,
        "similarity_matrix": similarity_matrix,
        "similarity_labels": valid_names,
        "funnel": funnel_stages,
        "target_profile": profile,
    }
    return json.dumps(output)

def _parse_screening_json(screening_json: str) -> dict:
    """Parse screening JSON from screen_candidates, with safe defaults.

    The agent must pass the exact tool return value. Partial or hand-built JSON
    is tolerated for optional similarity fields only.
    """
    screening = json.loads(screening_json)
    if "ranked_molecules" not in screening:
        raise ValueError(
            "screening_json must be the exact JSON string returned by "
            "screen_candidates (missing 'ranked_molecules'). Do not construct, "
            "truncate, or summarize tool output."
        )
    screening.setdefault("similarity_matrix", [])
    screening.setdefault("similarity_labels", [])
    return screening

# ------------------------------------------------------------------
# Task 4: Generate final comprehensive report
# ------------------------------------------------------------------

@tool
@env.task(report=True)
async def generate_report(
    molecule_dir: flyte.io.Dir,
    properties_json: str,
    screening_json: str,
) -> str:
    """Generate a comprehensive drug screening report.

    Produces an executive summary, top candidate spotlight cards, property
    distributions, chemical diversity analysis, and final recommendation.

    Args:
        molecule_dir: Directory from load_molecules.
        properties_json: JSON from compute_properties.
        screening_json: Exact verbatim JSON string returned by screen_candidates
            (must include ranked_molecules, similarity_matrix, similarity_labels).
            Do not construct or summarize this payload yourself.

    Returns:
        JSON summary with total_screened, lipinski_passes, all_criteria_met,
        top_candidate, top_score, and top_3 ranked molecules.
    """
    from rdkit import Chem

    await flyte.report.replace.aio(
        _wrap_report("<h2>Generating Final Report...</h2>"),
        do_flush=True,
    )

    props = json.loads(properties_json)
    screening = _parse_screening_json(screening_json)
    ranked = screening["ranked_molecules"]
    sim_matrix = screening["similarity_matrix"]
    sim_labels = screening["similarity_labels"]

    total = props["total"]
    lipinski_pass = props["lipinski_pass_count"]
    all_criteria = sum(1 for m in ranked if m["all_criteria_met"])
    top = ranked[0] if ranked else None

    html_parts = []

    # --- Executive Summary ---
    html_parts.append("<h2>Drug Molecule Screening Report</h2>")
    top_name = top["name"] if top else "N/A"
    top_score = f'{top["screening_score"]:.3f}' if top else "N/A"
    html_parts.append(
        f'<div class="card">'
        f'<h3 style="margin-top:0;color:#0e4f6e;">Executive Summary</h3>'
        f'<p style="font-size:1.05em;">'
        f'<strong>{total}</strong> molecules were screened against the target drug profile. '
        f'<strong>{lipinski_pass}</strong> passed Lipinski\'s Rule of Five, and '
        f'<strong>{all_criteria}</strong> met all screening criteria. '
        f'The top candidate is <strong style="color:#0891b2;">{top_name}</strong> '
        f'with a screening score of <strong>{top_score}</strong>.</p>'
        f'</div>'
    )

    # Stat grid
    html_parts.append('<div class="stat-grid">')
    for val, label in [
        (str(total), "Molecules Screened"),
        (str(lipinski_pass), "Lipinski Passes"),
        (str(all_criteria), "All Criteria Met"),
        (top_score, "Top Score"),
        (f'{props["avg_mw"]:.0f} Da', "Avg. Molecular Weight"),
        (f'{props["avg_logp"]:.2f}', "Avg. LogP"),
    ]:
        html_parts.append(
            f'<div class="stat"><div class="value">{val}</div>'
            f'<div class="label">{label}</div></div>'
        )
    html_parts.append("</div>")

    # --- Top 3 Candidate Spotlights ---
    html_parts.append("<h2>Top Candidate Spotlights</h2>")

    for rank, m in enumerate(ranked[:3], 1):
        mol = Chem.MolFromSmiles(m["smiles"])
        img_uri = _mol_to_data_uri(mol, size=(300, 300)) if mol else ""

        medal = ["gold", "silver", "#cd7f32"][rank - 1]
        medal_emoji = ["1st", "2nd", "3rd"][rank - 1]

        lip_badges = ""
        for rule, key in [("MW", "mw_ok"), ("LogP", "logp_ok"),
                          ("HBD", "hbd_ok"), ("HBA", "hba_ok")]:
            ok = m["lipinski"].get(key, False)
            cls = "badge-success" if ok else "badge-danger"
            lip_badges += f'<span class="badge {cls}" style="margin:2px;">{rule}</span> '

        html_parts.append(
            f'<div class="molecule-card" style="display:flex;gap:20px;align-items:flex-start;flex-wrap:wrap;">'
            f'<div style="text-align:center;min-width:180px;">'
            f'<div style="font-size:1.6em;font-weight:800;color:{medal};">{medal_emoji}</div>'
            f'<img src="{img_uri}" style="width:200px;height:200px;object-fit:contain;border-radius:8px;'
            f'border:2px solid #a5f3fc;"/>'
            f'<div style="font-weight:700;font-size:1.1em;color:#0e4f6e;margin-top:8px;">{m["name"]}</div>'
            f'</div>'
            f'<div style="flex:1;min-width:280px;">'
            f'<table style="margin:0;">'
            f'<tr><td><strong>SMILES</strong></td><td style="font-family:monospace;font-size:0.8em;word-break:break-all;">{m["smiles"]}</td></tr>'
            f'<tr><td><strong>Screening Score</strong></td><td style="font-weight:700;color:#0891b2;font-size:1.1em;">{m["screening_score"]:.3f}</td></tr>'
            f'<tr><td><strong>Molecular Weight</strong></td><td>{m["mw"]:.1f} Da</td></tr>'
            f'<tr><td><strong>LogP</strong></td><td>{m["logp"]:.2f}</td></tr>'
            f'<tr><td><strong>H-Bond Donors</strong></td><td>{m["hbd"]}</td></tr>'
            f'<tr><td><strong>H-Bond Acceptors</strong></td><td>{m["hba"]}</td></tr>'
            f'<tr><td><strong>TPSA</strong></td><td>{m["tpsa"]:.1f} A&sup2;</td></tr>'
            f'<tr><td><strong>Rotatable Bonds</strong></td><td>{m["rotatable_bonds"]}</td></tr>'
            f'<tr><td><strong>QED</strong></td><td>{m["qed"]:.4f}</td></tr>'
            f'<tr><td><strong>Lipinski Compliance</strong></td><td>{lip_badges}</td></tr>'
            f'</table>'
            f'</div>'
            f'</div>'
        )

    # --- Property Distribution (box-plot style as bars with min/max/median) ---
    html_parts.append("<h2>Property Distributions</h2>")

    prop_keys = [("mw", "Molecular Weight (Da)"), ("logp", "LogP"),
                 ("tpsa", "TPSA"), ("qed", "QED Score")]
    for key, label in prop_keys:
        vals = sorted([m[key] for m in ranked])
        n = len(vals)
        if n == 0:
            continue
        v_min = vals[0]
        v_max = vals[-1]
        median = vals[n // 2] if n % 2 == 1 else (vals[n // 2 - 1] + vals[n // 2]) / 2
        q1 = vals[n // 4] if n >= 4 else v_min
        q3 = vals[3 * n // 4] if n >= 4 else v_max

        # Simple horizontal box-plot as SVG
        box_w = 500
        box_h = 50
        margin_l = 10
        v_range = v_max - v_min or 1

        def sx(v):
            return margin_l + ((v - v_min) / v_range) * (box_w - 2 * margin_l)

        box_svg = (
            f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {box_w} {box_h}" '
            f'style="width:100%;max-width:{box_w}px;height:auto;">'
            f'<rect width="{box_w}" height="{box_h}" fill="#fff" rx="4"/>'
            # Whisker line
            f'<line x1="{sx(v_min):.1f}" y1="25" x2="{sx(v_max):.1f}" y2="25" '
            f'stroke="#94a3b8" stroke-width="1.5"/>'
            # Min whisker
            f'<line x1="{sx(v_min):.1f}" y1="18" x2="{sx(v_min):.1f}" y2="32" '
            f'stroke="#94a3b8" stroke-width="1.5"/>'
            # Max whisker
            f'<line x1="{sx(v_max):.1f}" y1="18" x2="{sx(v_max):.1f}" y2="32" '
            f'stroke="#94a3b8" stroke-width="1.5"/>'
            # IQR box
            f'<rect x="{sx(q1):.1f}" y="14" width="{sx(q3) - sx(q1):.1f}" height="22" '
            f'fill="#a5f3fc" stroke="#0891b2" stroke-width="1.5" rx="3"/>'
            # Median line
            f'<line x1="{sx(median):.1f}" y1="12" x2="{sx(median):.1f}" y2="38" '
            f'stroke="#0e4f6e" stroke-width="2"/>'
            # Labels
            f'<text x="{sx(v_min):.1f}" y="46" text-anchor="middle" font-size="9" fill="#6c757d">{v_min:.1f}</text>'
            f'<text x="{sx(median):.1f}" y="10" text-anchor="middle" font-size="9" fill="#0e4f6e" font-weight="600">{median:.1f}</text>'
            f'<text x="{sx(v_max):.1f}" y="46" text-anchor="middle" font-size="9" fill="#6c757d">{v_max:.1f}</text>'
            f'</svg>'
        )
        html_parts.append(
            f'<div style="margin:8px 0;"><strong style="color:#155e75;">{label}</strong>'
            f'<div class="chart-container" style="padding:8px;">{box_svg}</div></div>'
        )

    # --- Chemical Diversity ---
    html_parts.append("<h2>Chemical Diversity Analysis</h2>")

    if sim_matrix and len(sim_matrix) > 1:
        # Compute average pairwise similarity (off-diagonal)
        n_mols = len(sim_matrix)
        off_diag = []
        for i in range(n_mols):
            for j in range(i + 1, n_mols):
                off_diag.append(sim_matrix[i][j])

        avg_sim = sum(off_diag) / len(off_diag) if off_diag else 0
        max_sim = max(off_diag) if off_diag else 0
        min_sim = min(off_diag) if off_diag else 0

        # Find most similar pair
        best_i, best_j = 0, 1
        best_val = 0
        for i in range(n_mols):
            for j in range(i + 1, n_mols):
                if sim_matrix[i][j] > best_val:
                    best_val = sim_matrix[i][j]
                    best_i, best_j = i, j

        html_parts.append('<div class="stat-grid">')
        html_parts.append(
            f'<div class="stat"><div class="value">{avg_sim:.3f}</div>'
            f'<div class="label">Avg. Pairwise Similarity</div></div>'
        )
        html_parts.append(
            f'<div class="stat"><div class="value">{min_sim:.3f}</div>'
            f'<div class="label">Min Similarity</div></div>'
        )
        html_parts.append(
            f'<div class="stat"><div class="value">{max_sim:.3f}</div>'
            f'<div class="label">Max Similarity</div></div>'
        )
        html_parts.append("</div>")

        diversity_text = "highly diverse" if avg_sim < 0.3 else "moderately diverse" if avg_sim < 0.5 else "relatively similar"
        html_parts.append(
            f'<div class="note">'
            f'The library is <strong>{diversity_text}</strong> (avg. Tanimoto = {avg_sim:.3f}). '
            f'The most similar pair is <strong>{sim_labels[best_i]}</strong> and '
            f'<strong>{sim_labels[best_j]}</strong> (similarity = {best_val:.3f}).</div>'
        )

    # --- Recommendation ---
    html_parts.append("<h2>Recommendation</h2>")
    if top:
        html_parts.append(
            f'<div class="card">'
            f'<h3 style="margin-top:0;color:#0891b2;">Top Candidate: {top["name"]}</h3>'
            f'<p>Based on the virtual screening analysis, <strong>{top["name"]}</strong> '
            f'achieved the highest composite screening score of <strong>{top["screening_score"]:.3f}</strong>. '
        )

        reasons = []
        if top["lipinski_pass"]:
            reasons.append("full Lipinski Rule of Five compliance")
        if top["qed"] > 0.5:
            reasons.append(f"high drug-likeness (QED = {top['qed']:.3f})")
        if top.get("all_criteria_met"):
            reasons.append("all target profile criteria met")
        if top["mw"] <= 500:
            reasons.append(f"favorable molecular weight ({top['mw']:.1f} Da)")

        if reasons:
            html_parts.append(
                f'This candidate stands out due to: {", ".join(reasons)}.</p>'
            )
        else:
            html_parts.append("</p>")

        # Runner-up mentions
        if len(ranked) >= 2:
            html_parts.append(
                f'<p style="font-size:0.9em;color:#6c757d;">Runner-up candidates: '
            )
            runners = []
            for m in ranked[1:4]:
                runners.append(f'{m["name"]} (score: {m["screening_score"]:.3f})')
            html_parts.append(", ".join(runners) + ".</p>")

        html_parts.append("</div>")

    # Final note
    html_parts.append(
        '<div class="note">'
        "This is a virtual screening analysis. All candidates should undergo "
        "further computational validation (molecular dynamics, docking) and "
        "experimental testing before advancing to clinical trials.</div>"
    )

    await flyte.report.replace.aio(
        _wrap_report("\n".join(html_parts)),
        do_flush=True,
    )

    # JSON summary
    summary = {
        "total_screened": total,
        "lipinski_passes": lipinski_pass,
        "all_criteria_met": all_criteria,
        "top_candidate": top["name"] if top else None,
        "top_score": top["screening_score"] if top else None,
        "top_3": [
            {"name": m["name"], "score": m["screening_score"]}
            for m in ranked[:3]
        ],
    }
    return json.dumps(summary)

# ------------------------------------------------------------------
# Agent
# ------------------------------------------------------------------

# {{docs-fragment agent}}
SCREENING_AGENT_INSTRUCTIONS = """\
You are a medicinal chemistry screening strategist. You orchestrate a virtual \
screening pipeline using durable Flyte tools. You NEVER invent molecular \
properties — only RDKit tools compute them.

Workflow:
1. If target_profile is not provided in the user message, derive a JSON \
target_profile from the therapeutic brief. Valid keys: mw, logp, hbd, hba, tpsa \
(each [min, max]). Ground choices in oral bioavailability / kinase / CNS rules \
as appropriate to the brief.
2. First pass (always): load_molecules → compute_properties → \
screen_candidates → generate_report. Pass tool outputs between steps exactly \
(molecule_dir from load_molecules into compute_properties and generate_report; \
properties_json from compute_properties into screen_candidates and \
generate_report; screening_json must be the complete, unmodified string \
returned by screen_candidates — never rebuild or summarize JSON yourself).
3. Read the JSON summary returned by generate_report. Reflect:
   - If all_criteria_met == 0: relax exactly ONE profile bound by ~10–20% \
and re-run screen_candidates then generate_report only, reusing the same \
molecule_dir and properties_json from the first pass.
   - If all molecules pass but diversity is a stated goal: note high similarity \
in your summary; do not re-run unless brief asks for stricter filters.
   - Maximum ONE rescreen iteration.
4. Finish with plain text: top candidate, rationale tied to computed metrics \
from the tool JSON, funnel interpretation, and suggested next steps (docking, \
ADMET lab tests).

If the user supplies an explicit target_profile JSON, use it as-is.

Do NOT ask the user for SMILES or molecule lists when molecules_json is empty — \
the default library is loaded automatically.
"""

screening_agent = Agent(
    name="drug-screening-agent",
    instructions=SCREENING_AGENT_INSTRUCTIONS,
    model=MODEL,
    tools=[
        load_molecules,
        compute_properties,
        screen_candidates,
        generate_report,
    ],
    max_turns=12,
)
# {{/docs-fragment agent}}

# ------------------------------------------------------------------
# Pipeline
# ------------------------------------------------------------------

# {{docs-fragment pipeline}}
@env.task(report=True)
async def pipeline(
    brief: str = "Screen the default drug library for orally bioavailable small molecules.",
    molecules_json: str = "",
    target_profile: str = "",
) -> str:
    """Agentic virtual drug molecule screening pipeline.

    A medicinal-chemistry agent interprets the screening brief, derives or
    applies a target profile, orchestrates the RDKit screening stages, and
    optionally re-screens when funnel results are too narrow.

    Args:
        brief: Natural-language therapeutic goal (e.g. oral kinase inhibitors,
            CNS-penetrant small molecules).
        molecules_json: JSON mapping molecule names to SMILES strings.
            Defaults to a curated library of ~15 well-known drugs.
        target_profile: Optional JSON with desired property ranges that
            overrides agent-derived criteria
            (e.g. {"mw": [150, 500], "logp": [-0.5, 5]}).

    Returns:
        Agent summary with screening rationale and key results.
    """
    prompt_parts = [
        f"Screening brief: {brief}",
        'Use molecules_json="" for the built-in default library unless provided below.',
        "Compose the four stage tools in order: load_molecules → compute_properties "
        "→ screen_candidates → generate_report. Pass each tool's full return value "
        "verbatim to the next step (especially screening_json). Re-run "
        "screen_candidates and generate_report at most once if the funnel is too narrow.",
    ]
    if molecules_json.strip():
        prompt_parts.append(f"molecules_json: {molecules_json}")
    if target_profile.strip():
        prompt_parts.append(f"Use this target_profile exactly: {target_profile}")

    result = await screening_agent.run.aio("\n".join(prompt_parts))
    return result.summary or result.error or ""

# {{/docs-fragment pipeline}}

# ------------------------------------------------------------------
# Rescreen demo — tight profile + explicit rescreen instructions
# ------------------------------------------------------------------

# Initial profile is deliberately strict (narrow MW + low LogP cap) so
# all_criteria_met is typically 0 on the default library; the brief then
# forces a single rescreen with a widened LogP window.
RESCREEN_DEMO_TARGET_PROFILE = (
    '{"mw": [150, 200], "logp": [-0.5, 1.0], "hbd": [0, 1], '
    '"hba": [0, 3], "tpsa": [20, 45]}'
)
RESCREEN_DEMO_TARGET_PROFILE_RESCREEN = (
    '{"mw": [150, 200], "logp": [-0.5, 3.5], "hbd": [0, 1], '
    '"hba": [0, 3], "tpsa": [20, 45]}'
)
RESCREEN_DEMO_BRIEF = f"""\
Two-round agentic screening demo on the default library.

**Round 1 (strict profile):** load_molecules → compute_properties → \
screen_candidates → generate_report using the initial target_profile exactly.

**Round 2 (required — do not skip):** call screen_candidates then generate_report \
again, reusing the same molecule_dir and properties_json from round 1, with this \
relaxed target_profile (wider LogP window only): \
{RESCREEN_DEMO_TARGET_PROFILE_RESCREEN}

Pass every tool return value verbatim to the next step. After both rounds, \
summarize how the funnel and top candidates changed between round 1 and round 2."""

# {{docs-fragment rescreen_demo}}
@env.task(report=True)
async def rescreen_demo() -> str:
    """Example run with a two-round execution graph (rescreen).

    Round 1 uses a strict CNS-like profile; round 2 always re-runs
    screen_candidates and generate_report with a widened LogP window,
    reusing cached molecule_dir and properties_json.
    """
    return await pipeline(
        brief=RESCREEN_DEMO_BRIEF,
        target_profile=RESCREEN_DEMO_TARGET_PROFILE,
    )

# {{/docs-fragment rescreen_demo}}

# {{docs-fragment main}}
if __name__ == "__main__":
    flyte.init_from_config()
    run = flyte.run(pipeline)
    print(run.url)
    run.wait()
# {{/docs-fragment main}}
```

*Source: https://github.com/unionai/unionai-examples/blob/main/v2/tutorials/drug_molecule_screening/drug_molecule_screening.py*

```
# /// script
# requires-python = ">=3.12"
# dependencies = [
#    "flyte>=2.5.4",
#    "litellm",
#    "rdkit",
#    "numpy",
#    "scikit-learn",
#    "pillow",
# ]
# ///
```

## Define the screening agent

The agent receives a natural-language brief and composes four stage tools in order. Each tool is a durable Flyte task with its own `report=True` surface in the Flyte UI.

```
# /// script
# requires-python = ">=3.12"
# dependencies = [
#    "flyte>=2.5.4",
#    "litellm",
#    "rdkit",
#    "numpy",
#    "scikit-learn",
#    "pillow",
# ]
# main = "pipeline"
# params = ""
# ///
"""Virtual drug molecule screening — compute properties, apply Lipinski filters, rank candidates."""

import base64
import io
import json
import logging
import math
import os
import tempfile

import flyte
import flyte.io
import flyte.report
from flyte.ai.agents import Agent, tool

MODEL = os.getenv("DRUG_SCREENING_MODEL", "claude-haiku-4-5")

# {{docs-fragment env}}
main_img = flyte.Image.from_uv_script(__file__, name="drug-molecule-screening", pre=True).with_apt_packages(
    "libxrender1", "libxext6", "libexpat1",
)

env = flyte.TaskEnvironment(
    name="drug-molecule-screening",
    image=main_img,
    resources=flyte.Resources(cpu=2, memory="6Gi"),
    secrets=[
        flyte.Secret(key="internal-anthropic-api-key", as_env_var="ANTHROPIC_API_KEY"),
    ],
)
# {{/docs-fragment env}}

logging.basicConfig(level=logging.WARNING, format="%(message)s", force=True)
log = logging.getLogger(__name__)
log.setLevel(logging.INFO)

# ------------------------------------------------------------------
# Default molecule library — real SMILES for well-known drugs
# ------------------------------------------------------------------

DEFAULT_MOLECULES = {
    "Aspirin": "CC(=O)OC1=CC=CC=C1C(=O)O",
    "Ibuprofen": "CC(C)CC1=CC=C(C=C1)C(C)C(=O)O",
    "Caffeine": "CN1C=NC2=C1C(=O)N(C(=O)N2C)C",
    "Penicillin G": "CC1(C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C",
    "Metformin": "CN(C)C(=N)NC(=N)N",
    "Paracetamol": "CC(=O)NC1=CC=C(C=C1)O",
    "Diazepam": "ClC1=CC2=C(C=C1)N(C(=O)CN=C2C3=CC=CC=C3)C",
    "Omeprazole": "CC1=CN=C(C(=C1OC)C)CS(=O)C2=NC3=CC=CC=C3N2",
    "Atorvastatin": "CC(C)C1=C(C(=C(N1CCC(CC(CC(=O)O)O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4",
    "Methotrexate": "CN(CC1=CN=C2N=C(N=C(N)C2=N1)N)C3=CC=C(C=C3)C(=O)NC(CCC(=O)O)C(=O)O",
    "Doxorubicin": "CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)CO)O)N)O",
    "Tamoxifen": "CCC(=C(C1=CC=CC=C1)C2=CC=C(C=C2)OCCN(C)C)C3=CC=CC=C3",
    "Lopinavir": "CC1=C(C(=CC=C1)C)OCC(=O)NC(CC2=CC=CC=C2)C(CC(CC3=CC=CC=C3)NC(=O)C(C(C)C)N4CCCNC4=O)O",
    "Remdesivir": "CCC(CC)COC(=O)C(C)NP(=O)(OCC1C(C(C(O1)C2=CC=C3N2N=CN=C3N)O)O)OC4=CC=CC=C4",
    "Erlotinib": "COCCOC1=CC2=C(C=C1OCCOC)C(=NC=N2)NC3=CC=CC(=C3)C#C",
}

# ------------------------------------------------------------------
# Report styling — pharma blue/cyan theme
# ------------------------------------------------------------------

REPORT_CSS = """
<style>
  .report { font-family: system-ui, -apple-system, sans-serif; max-width: 960px; margin: 0 auto; color: #1a1a2e; }
  .report h2 { color: #0e4f6e; border-bottom: 2px solid #0891b2; padding-bottom: 8px; margin-top: 24px; }
  .report h3 { color: #155e75; margin-top: 20px; }
  .report .card { background: #ecfeff; border: 1px solid #a5f3fc; border-radius: 8px; padding: 16px; margin: 12px 0; }
  .report .stat-grid { display: grid; grid-template-columns: repeat(auto-fit, minmax(160px, 1fr)); gap: 12px; margin: 12px 0; }
  .report .stat { background: #fff; border: 1px solid #cffafe; border-radius: 6px; padding: 12px; text-align: center; }
  .report .stat .value { font-size: 1.5em; font-weight: 700; color: #0e4f6e; }
  .report .stat .label { font-size: 0.85em; color: #6c757d; margin-top: 4px; }
  .report table { border-collapse: collapse; width: 100%; margin: 12px 0; }
  .report th { background: #0e4f6e; color: #fff; padding: 10px 14px; text-align: left; font-weight: 600; }
  .report td { padding: 8px 14px; border-bottom: 1px solid #cffafe; }
  .report tr:nth-child(even) { background: #ecfeff; }
  .report .badge { display: inline-block; padding: 2px 8px; border-radius: 12px; font-size: 0.8em; font-weight: 600; }
  .report .badge-success { background: #d1fae5; color: #065f46; }
  .report .badge-danger { background: #fee2e2; color: #991b1b; }
  .report .badge-info { background: #cffafe; color: #155e75; }
  .report .chart-container { background: #fff; border: 1px solid #cffafe; border-radius: 8px; padding: 16px; margin: 16px 0; }
  .report .note { background: #ecfeff; border-left: 4px solid #0891b2; padding: 10px 14px; border-radius: 4px; margin: 12px 0; font-size: 0.9em; }
  .report .molecule-card { background: #fff; border: 1px solid #cffafe; border-radius: 8px; padding: 16px; margin: 12px 0; }
  .report .molecule-grid { display: grid; grid-template-columns: repeat(auto-fill, minmax(200px, 1fr)); gap: 12px; margin: 16px 0; }
  .report .funnel { text-align: center; margin: 24px 0; }
</style>
"""

def _wrap_report(html: str) -> str:
    """Wrap HTML content with report styling."""
    return f'{REPORT_CSS}<div class="report">{html}</div>'

# ------------------------------------------------------------------
# SVG chart helpers
# ------------------------------------------------------------------

def _mol_to_data_uri(mol, size: tuple[int, int] = (300, 300)) -> str:
    """Convert an RDKit molecule to a PNG base64 data URI."""
    from rdkit.Chem import Draw

    img = Draw.MolToImage(mol, size=size)
    buf = io.BytesIO()
    img.save(buf, format="PNG")
    b64 = base64.b64encode(buf.getvalue()).decode()
    return f"data:image/png;base64,{b64}"

def _make_bar_chart(
    labels: list[str],
    series: dict[str, list[float]],
    title: str = "",
    colors: list[str] | None = None,
    width: int = 700,
    height: int = 340,
    y_max_cap: float | None = None,
    horizontal: bool = False,
    value_fmt: str = ".1f",
) -> str:
    """Generate an SVG grouped bar chart.

    Args:
        labels: Category labels.
        series: Dict mapping series name to list of values.
        title: Chart title.
        colors: Colors for each series.
        width/height: SVG dimensions.
        y_max_cap: Cap the y-axis at this value.
        horizontal: If True, draw horizontal bars.
        value_fmt: Format string for value labels.

    Returns:
        SVG string.
    """
    if not labels:
        return ""

    default_colors = ["#0891b2", "#0e4f6e", "#06d6a0", "#a5f3fc", "#155e75"]
    colors = colors or default_colors

    if horizontal:
        return _make_horizontal_bar_chart(labels, series, title, colors, width, height, value_fmt)

    ml, mr, mt, mb = 60, 20, 40, 60
    cw = width - ml - mr
    ch = height - mt - mb

    all_vals = [v for vals in series.values() for v in vals]
    y_max = max(all_vals) if all_vals else 1
    y_max_plot = y_max * 1.15 or 1
    if y_max_cap is not None:
        y_max_plot = min(y_max_plot, y_max_cap) or y_max_cap

    n_groups = len(labels)
    n_series = len(series)
    group_width = cw / n_groups
    bar_width = group_width * 0.7 / max(n_series, 1)
    gap = group_width * 0.15

    def sy(v):
        return mt + ch - (v / y_max_plot) * ch

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    # Grid lines
    for i in range(6):
        y_tick = y_max_plot * i / 5
        py = sy(y_tick)
        svg.append(
            f'<line x1="{ml}" y1="{py:.1f}" x2="{ml + cw}" y2="{py:.1f}" '
            f'stroke="#e0f2fe" stroke-width="1"/>'
        )
        svg.append(
            f'<text x="{ml - 8}" y="{py + 4:.1f}" text-anchor="end" '
            f'font-size="11" fill="#6c757d">{y_tick:{value_fmt}}</text>'
        )

    # Axes
    svg.append(
        f'<line x1="{ml}" y1="{mt}" x2="{ml}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )
    svg.append(
        f'<line x1="{ml}" y1="{mt + ch}" x2="{ml + cw}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )

    # Bars
    for gi, label in enumerate(labels):
        gx = ml + gi * group_width + gap
        for si, (name, vals) in enumerate(series.items()):
            color = colors[si % len(colors)]
            bx = gx + si * bar_width
            val = vals[gi]
            by = sy(val)
            bh = mt + ch - by
            svg.append(
                f'<rect x="{bx:.1f}" y="{by:.1f}" width="{bar_width - 1:.1f}" '
                f'height="{bh:.1f}" fill="{color}" rx="2"/>'
            )
            svg.append(
                f'<text x="{bx + bar_width / 2:.1f}" y="{by - 4:.1f}" '
                f'text-anchor="middle" font-size="9" fill="#1a1a2e">'
                f'{val:{value_fmt}}</text>'
            )
        # Truncate long labels
        disp_label = label if len(label) <= 12 else label[:10] + ".."
        svg.append(
            f'<text x="{gx + n_series * bar_width / 2:.1f}" y="{mt + ch + 16}" '
            f'text-anchor="middle" font-size="10" fill="#6c757d" '
            f'transform="rotate(-35, {gx + n_series * bar_width / 2:.1f}, {mt + ch + 16})">'
            f'{disp_label}</text>'
        )

    # Title
    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    # Legend
    if n_series > 1:
        lx = ml + cw - len(series) * 100
        for si, name in enumerate(series):
            color = colors[si % len(colors)]
            svg.append(
                f'<rect x="{lx + si * 100}" y="{mt + ch + 40}" width="12" '
                f'height="12" rx="2" fill="{color}"/>'
            )
            svg.append(
                f'<text x="{lx + si * 100 + 16}" y="{mt + ch + 51}" font-size="11" '
                f'fill="#1a1a2e">{name}</text>'
            )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_horizontal_bar_chart(
    labels: list[str],
    series: dict[str, list[float]],
    title: str = "",
    colors: list[str] | None = None,
    width: int = 700,
    height: int = 400,
    value_fmt: str = ".1f",
) -> str:
    """Generate an SVG horizontal bar chart (sorted)."""
    default_colors = ["#0891b2", "#0e4f6e", "#06d6a0"]
    colors = colors or default_colors

    n = len(labels)
    row_height = max(22, min(35, (height - 80) // max(n, 1)))
    actual_height = max(height, 80 + n * row_height)
    ml, mr, mt, mb = 120, 60, 40, 20
    cw = width - ml - mr
    ch = actual_height - mt - mb

    # Use first series
    first_key = list(series.keys())[0]
    vals = series[first_key]
    x_max = max(vals) * 1.15 if vals else 1

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {actual_height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{actual_height}" fill="#fff" rx="6"/>',
    ]

    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    bar_h = row_height * 0.65
    for i, (label, val) in enumerate(zip(labels, vals)):
        y = mt + i * row_height
        bw = (val / x_max) * cw if x_max else 0
        color = colors[i % len(colors)]
        # Label
        disp = label if len(label) <= 14 else label[:12] + ".."
        svg.append(
            f'<text x="{ml - 8}" y="{y + bar_h / 2 + 4:.1f}" text-anchor="end" '
            f'font-size="11" fill="#1a1a2e">{disp}</text>'
        )
        # Bar
        svg.append(
            f'<rect x="{ml}" y="{y:.1f}" width="{bw:.1f}" height="{bar_h:.1f}" '
            f'fill="{color}" rx="3"/>'
        )
        # Value
        svg.append(
            f'<text x="{ml + bw + 6:.1f}" y="{y + bar_h / 2 + 4:.1f}" '
            f'font-size="11" fill="#0e4f6e" font-weight="600">{val:{value_fmt}}</text>'
        )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_heatmap(
    matrix: list[list[float]],
    row_labels: list[str],
    col_labels: list[str],
    title: str = "",
    color_scale: str = "cyan",
    width: int = 700,
    height: int = 500,
    value_fmt: str = ".2f",
) -> str:
    """Generate an SVG heatmap.

    Args:
        matrix: 2D list of values (rows x cols).
        row_labels: Labels for rows.
        col_labels: Labels for columns.
        title: Chart title.
        color_scale: Color scheme ("cyan", "red", "green").
        width/height: SVG dimensions.
        value_fmt: Format string for cell values.

    Returns:
        SVG string.
    """
    if not matrix or not matrix[0]:
        return ""

    n_rows = len(matrix)
    n_cols = len(matrix[0])

    ml, mr, mt, mb = 110, 20, 70, 20
    cw = width - ml - mr
    ch = height - mt - mb
    cell_w = cw / n_cols
    cell_h = ch / n_rows

    # Flatten to find range
    flat = [v for row in matrix for v in row]
    v_min = min(flat)
    v_max = max(flat)
    v_range = v_max - v_min or 1

    def color_for(v):
        t = (v - v_min) / v_range
        if color_scale == "cyan":
            # White to deep teal
            r = int(255 - t * (255 - 14))
            g = int(255 - t * (255 - 79))
            b = int(255 - t * (255 - 110))
        elif color_scale == "red":
            r = int(255 - t * 50)
            g = int(255 - t * 200)
            b = int(255 - t * 200)
        else:  # green
            r = int(255 - t * 200)
            g = int(255 - t * 50)
            b = int(255 - t * 200)
        return f"rgb({r},{g},{b})"

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    # Column labels (rotated)
    for ci, label in enumerate(col_labels):
        x = ml + ci * cell_w + cell_w / 2
        disp = label if len(label) <= 12 else label[:10] + ".."
        svg.append(
            f'<text x="{x:.1f}" y="{mt - 8}" text-anchor="end" font-size="10" '
            f'fill="#1a1a2e" transform="rotate(-45, {x:.1f}, {mt - 8})">{disp}</text>'
        )

    # Row labels + cells
    for ri, (row_label, row_vals) in enumerate(zip(row_labels, matrix)):
        y = mt + ri * cell_h
        disp = row_label if len(row_label) <= 14 else row_label[:12] + ".."
        svg.append(
            f'<text x="{ml - 8}" y="{y + cell_h / 2 + 4:.1f}" text-anchor="end" '
            f'font-size="10" fill="#1a1a2e">{disp}</text>'
        )
        for ci, val in enumerate(row_vals):
            x = ml + ci * cell_w
            fill = color_for(val)
            svg.append(
                f'<rect x="{x:.1f}" y="{y:.1f}" width="{cell_w:.1f}" '
                f'height="{cell_h:.1f}" fill="{fill}" stroke="#fff" stroke-width="1"/>'
            )
            # Text color: dark on light, light on dark
            t = (val - v_min) / v_range
            txt_color = "#fff" if t > 0.55 else "#1a1a2e"
            # Only show text if cells are large enough
            if cell_w > 30 and cell_h > 18:
                svg.append(
                    f'<text x="{x + cell_w / 2:.1f}" y="{y + cell_h / 2 + 4:.1f}" '
                    f'text-anchor="middle" font-size="9" fill="{txt_color}">'
                    f'{val:{value_fmt}}</text>'
                )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_scatter_plot(
    points: list[dict],
    x_label: str = "MW",
    y_label: str = "LogP",
    title: str = "",
    reference_lines: list[dict] | None = None,
    width: int = 700,
    height: int = 400,
) -> str:
    """Generate an SVG scatter plot.

    Args:
        points: List of dicts with "x", "y", "label" keys.
        x_label/y_label: Axis labels.
        title: Chart title.
        reference_lines: List of dicts with "axis" ("x"/"y"), "value", "label".
        width/height: SVG dimensions.

    Returns:
        SVG string.
    """
    if not points:
        return ""

    ml, mr, mt, mb = 60, 30, 40, 50
    cw = width - ml - mr
    ch = height - mt - mb

    x_vals = [p["x"] for p in points]
    y_vals = [p["y"] for p in points]
    x_min, x_max = min(x_vals) * 0.9, max(x_vals) * 1.1
    y_min, y_max = min(y_vals) - 1, max(y_vals) + 1

    # Extend ranges to include reference lines
    if reference_lines:
        for rl in reference_lines:
            if rl["axis"] == "x":
                x_max = max(x_max, rl["value"] * 1.1)
            else:
                y_max = max(y_max, rl["value"] * 1.1)

    x_range = x_max - x_min or 1
    y_range = y_max - y_min or 1

    def sx(v):
        return ml + (v - x_min) / x_range * cw

    def sy(v):
        return mt + ch - (v - y_min) / y_range * ch

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    # Grid
    for i in range(6):
        y_tick = y_min + y_range * i / 5
        py = sy(y_tick)
        svg.append(
            f'<line x1="{ml}" y1="{py:.1f}" x2="{ml + cw}" y2="{py:.1f}" '
            f'stroke="#e0f2fe" stroke-width="1"/>'
        )
        svg.append(
            f'<text x="{ml - 8}" y="{py + 4:.1f}" text-anchor="end" '
            f'font-size="11" fill="#6c757d">{y_tick:.1f}</text>'
        )

    for i in range(6):
        x_tick = x_min + x_range * i / 5
        px = sx(x_tick)
        svg.append(
            f'<text x="{px:.1f}" y="{mt + ch + 20}" text-anchor="middle" '
            f'font-size="11" fill="#6c757d">{x_tick:.0f}</text>'
        )

    # Axes
    svg.append(
        f'<line x1="{ml}" y1="{mt}" x2="{ml}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )
    svg.append(
        f'<line x1="{ml}" y1="{mt + ch}" x2="{ml + cw}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )

    # Reference lines (Lipinski boundaries)
    if reference_lines:
        for rl in reference_lines:
            if rl["axis"] == "x":
                px = sx(rl["value"])
                svg.append(
                    f'<line x1="{px:.1f}" y1="{mt}" x2="{px:.1f}" y2="{mt + ch}" '
                    f'stroke="#ef4444" stroke-width="1.5" stroke-dasharray="6,4"/>'
                )
                svg.append(
                    f'<text x="{px + 4:.1f}" y="{mt + 14}" font-size="10" '
                    f'fill="#ef4444" font-weight="600">{rl["label"]}</text>'
                )
            else:
                py = sy(rl["value"])
                svg.append(
                    f'<line x1="{ml}" y1="{py:.1f}" x2="{ml + cw}" y2="{py:.1f}" '
                    f'stroke="#ef4444" stroke-width="1.5" stroke-dasharray="6,4"/>'
                )
                svg.append(
                    f'<text x="{ml + cw - 4:.1f}" y="{py - 6:.1f}" text-anchor="end" '
                    f'font-size="10" fill="#ef4444" font-weight="600">{rl["label"]}</text>'
                )

    # Drug-like zone shading (MW<=500 and LogP<=5 quadrant)
    if reference_lines:
        mw_line = next((rl for rl in reference_lines if rl["axis"] == "x"), None)
        logp_line = next((rl for rl in reference_lines if rl["axis"] == "y"), None)
        if mw_line and logp_line:
            zx1 = sx(x_min)
            zx2 = sx(min(mw_line["value"], x_max))
            zy1 = sy(min(logp_line["value"], y_max))
            zy2 = sy(y_min)
            svg.append(
                f'<rect x="{zx1:.1f}" y="{zy1:.1f}" '
                f'width="{zx2 - zx1:.1f}" height="{zy2 - zy1:.1f}" '
                f'fill="#0891b2" opacity="0.06" rx="4"/>'
            )
            svg.append(
                f'<text x="{zx1 + 8:.1f}" y="{zy2 - 8:.1f}" font-size="11" '
                f'fill="#0891b2" font-weight="600" opacity="0.6">Drug-like Zone</text>'
            )

    # Points
    point_colors = ["#0891b2", "#0e4f6e", "#06d6a0", "#155e75", "#0284c7",
                    "#059669", "#0d9488", "#0369a1", "#047857", "#115e59",
                    "#0c4a6e", "#064e3b", "#1e3a5f", "#134e4a", "#075985"]
    for i, pt in enumerate(points):
        px, py = sx(pt["x"]), sy(pt["y"])
        color = point_colors[i % len(point_colors)]
        svg.append(
            f'<circle cx="{px:.1f}" cy="{py:.1f}" r="5" fill="{color}" '
            f'stroke="#fff" stroke-width="1.5" opacity="0.85"/>'
        )
        # Label offset to avoid overlap
        offset_x = 8
        offset_y = -8 if i % 2 == 0 else 14
        label = pt["label"] if len(pt["label"]) <= 12 else pt["label"][:10] + ".."
        svg.append(
            f'<text x="{px + offset_x:.1f}" y="{py + offset_y:.1f}" '
            f'font-size="9" fill="#1a1a2e">{label}</text>'
        )

    # Title
    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    # Axis labels
    if x_label:
        svg.append(
            f'<text x="{ml + cw / 2}" y="{height - 6}" text-anchor="middle" '
            f'font-size="12" fill="#6c757d">{x_label}</text>'
        )
    if y_label:
        svg.append(
            f'<text x="14" y="{mt + ch / 2}" text-anchor="middle" '
            f'font-size="12" fill="#6c757d" '
            f'transform="rotate(-90, 14, {mt + ch / 2})">{y_label}</text>'
        )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_funnel(
    stages: list[dict],
    title: str = "",
    width: int = 600,
    height: int = 400,
) -> str:
    """Generate an SVG funnel visualization.

    Args:
        stages: List of dicts with "label", "count", "total" keys.
        title: Chart title.
        width/height: SVG dimensions.

    Returns:
        SVG string.
    """
    if not stages:
        return ""

    n = len(stages)
    mt = 50
    mb = 20
    available_h = height - mt - mb
    stage_h = available_h / n
    cx = width / 2

    # Color gradient from light cyan to deep teal
    colors = []
    for i in range(n):
        t = i / max(n - 1, 1)
        r = int(207 - t * (207 - 14))
        g = int(250 - t * (250 - 79))
        b = int(254 - t * (254 - 110))
        colors.append(f"rgb({r},{g},{b})")

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    if title:
        svg.append(
            f'<text x="{cx}" y="28" text-anchor="middle" '
            f'font-size="16" font-weight="700" fill="#0e4f6e">{title}</text>'
        )

    max_count = stages[0]["count"] if stages else 1
    max_width = width * 0.75

    for i, stage in enumerate(stages):
        y_top = mt + i * stage_h
        y_bot = y_top + stage_h

        # Width proportional to count
        w_top = max_width * (stage["count"] / max_count) if i == 0 else prev_w_bot
        if i < n - 1:
            w_bot = max_width * (stages[i + 1]["count"] / max_count)
        else:
            w_bot = max_width * (stage["count"] / max_count) * 0.7

        prev_w_bot = w_bot

        # Trapezoid
        x1_top = cx - w_top / 2
        x2_top = cx + w_top / 2
        x1_bot = cx - w_bot / 2
        x2_bot = cx + w_bot / 2

        svg.append(
            f'<polygon points="{x1_top:.1f},{y_top:.1f} {x2_top:.1f},{y_top:.1f} '
            f'{x2_bot:.1f},{y_bot:.1f} {x1_bot:.1f},{y_bot:.1f}" '
            f'fill="{colors[i]}" stroke="#fff" stroke-width="2"/>'
        )

        # Text: dark on light, white on dark
        t = i / max(n - 1, 1)
        txt_color = "#0e4f6e" if t < 0.5 else "#fff"
        y_mid = (y_top + y_bot) / 2

        svg.append(
            f'<text x="{cx}" y="{y_mid - 4:.1f}" text-anchor="middle" '
            f'font-size="13" font-weight="600" fill="{txt_color}">{stage["label"]}</text>'
        )
        svg.append(
            f'<text x="{cx}" y="{y_mid + 14:.1f}" text-anchor="middle" '
            f'font-size="12" fill="{txt_color}" opacity="0.85">'
            f'{stage["count"]} / {stage["total"]}</text>'
        )

    svg.append("</svg>")
    return "\n".join(svg)

# ------------------------------------------------------------------
# Task 1: Load and validate molecules
# ------------------------------------------------------------------

@tool
@env.task(cache="auto")
async def load_molecules(
    molecules_json: str = "",
) -> flyte.io.Dir:
    """Parse SMILES strings, validate with RDKit, generate 2D depictions.

    Args:
        molecules_json: JSON string mapping molecule names to SMILES.
            Defaults to a curated library of ~15 well-known drugs.

    Returns:
        flyte.io.Dir containing molecule data (JSON + PNG depictions).
        Pass this directory to compute_properties and generate_report.
    """
    from rdkit import Chem
    from rdkit.Chem import Draw

    if molecules_json.strip():
        molecules = json.loads(molecules_json)
    else:
        molecules = DEFAULT_MOLECULES

    out_dir = tempfile.mkdtemp(prefix="mol_library_")
    results = []
    valid_count = 0
    invalid_count = 0

    log.info(f"Parsing {len(molecules)} molecules...")

    for name, smiles in molecules.items():
        mol = Chem.MolFromSmiles(smiles)
        if mol is None:
            log.warning(f"  [INVALID] {name}: {smiles}")
            invalid_count += 1
            continue

        valid_count += 1

        # Generate 2D depiction as PNG
        img = Draw.MolToImage(mol, size=(300, 300))
        img_path = os.path.join(out_dir, f"{name.replace(' ', '_')}.png")
        img.save(img_path)

        results.append({
            "name": name,
            "smiles": smiles,
            "valid": True,
            "image_file": os.path.basename(img_path),
        })

    # Save molecule manifest
    manifest = {
        "total": len(molecules),
        "valid": valid_count,
        "invalid": invalid_count,
        "molecules": results,
    }
    manifest_path = os.path.join(out_dir, "manifest.json")
    with open(manifest_path, "w") as f:
        json.dump(manifest, f, indent=2)

    log.info(f"Loaded {valid_count} valid molecules ({invalid_count} invalid)")

    return await flyte.io.Dir.from_local(out_dir)

# ------------------------------------------------------------------
# Task 2: Compute physicochemical properties
# ------------------------------------------------------------------

@tool
@env.task(report=True)
async def compute_properties(
    molecule_dir: flyte.io.Dir,
) -> str:
    """Compute drug-likeness properties for all molecules.

    Computes MW, LogP, HBD, HBA, TPSA, rotatable bonds, formal charge,
    ring count, QED, and Lipinski Rule of Five compliance.

    Args:
        molecule_dir: Directory from load_molecules.

    Returns:
        JSON string with all computed properties. Pass to screen_candidates
        and generate_report.
    """
    from rdkit import Chem
    from rdkit.Chem import Descriptors, Lipinski
    from rdkit.Chem.QED import qed

    # --- Loading report ---
    await flyte.report.replace.aio(
        _wrap_report("<h2>Computing Molecular Properties...</h2>"
                      "<p>Analyzing physicochemical descriptors for all molecules.</p>"),
        do_flush=True,
    )

    mol_dir = await molecule_dir.download()
    with open(os.path.join(mol_dir, "manifest.json")) as f:
        manifest = json.load(f)

    molecules_data = []
    lipinski_pass = 0

    for mol_info in manifest["molecules"]:
        mol = Chem.MolFromSmiles(mol_info["smiles"])
        if mol is None:
            continue

        mw = Descriptors.MolWt(mol)
        logp = Descriptors.MolLogP(mol)
        hbd = Lipinski.NumHDonors(mol)
        hba = Lipinski.NumHAcceptors(mol)
        tpsa = Descriptors.TPSA(mol)
        rotatable = Lipinski.NumRotatableBonds(mol)
        formal_charge = Chem.GetFormalCharge(mol)
        num_rings = Lipinski.RingCount(mol)
        qed_score = qed(mol)

        # Lipinski Rule of Five
        lipinski = {
            "mw_ok": mw <= 500,
            "logp_ok": logp <= 5,
            "hbd_ok": hbd <= 5,
            "hba_ok": hba <= 10,
        }
        lipinski_all = all(lipinski.values())
        if lipinski_all:
            lipinski_pass += 1

        # Read image for data URI
        img_path = os.path.join(mol_dir, mol_info["image_file"])
        data_uri = ""
        if os.path.exists(img_path):
            with open(img_path, "rb") as img_f:
                b64 = base64.b64encode(img_f.read()).decode()
                data_uri = f"data:image/png;base64,{b64}"

        molecules_data.append({
            "name": mol_info["name"],
            "smiles": mol_info["smiles"],
            "mw": round(mw, 2),
            "logp": round(logp, 2),
            "hbd": hbd,
            "hba": hba,
            "tpsa": round(tpsa, 2),
            "rotatable_bonds": rotatable,
            "formal_charge": formal_charge,
            "num_rings": num_rings,
            "qed": round(qed_score, 4),
            "lipinski": lipinski,
            "lipinski_pass": lipinski_all,
            "image_data_uri": data_uri,
        })

    total = len(molecules_data)
    avg_mw = sum(m["mw"] for m in molecules_data) / total if total else 0
    avg_logp = sum(m["logp"] for m in molecules_data) / total if total else 0
    lipinski_rate = lipinski_pass / total * 100 if total else 0

    # ---- Build report ----
    html_parts = []

    # Header
    html_parts.append("<h2>Molecular Properties Analysis</h2>")

    # Stat grid
    html_parts.append('<div class="stat-grid">')
    for val, label in [
        (str(total), "Total Molecules"),
        (f"{lipinski_rate:.0f}%", "Lipinski Pass Rate"),
        (f"{avg_mw:.1f}", "Avg. MW (Da)"),
        (f"{avg_logp:.2f}", "Avg. LogP"),
    ]:
        html_parts.append(
            f'<div class="stat"><div class="value">{val}</div>'
            f'<div class="label">{label}</div></div>'
        )
    html_parts.append("</div>")

    # Molecule gallery
    html_parts.append("<h3>Molecule Library</h3>")
    html_parts.append('<div class="molecule-grid">')
    for m in molecules_data:
        if m["image_data_uri"]:
            badge_class = "badge-success" if m["lipinski_pass"] else "badge-danger"
            badge_text = "Lipinski Pass" if m["lipinski_pass"] else "Lipinski Fail"
            html_parts.append(
                f'<div class="molecule-card" style="text-align:center;">'
                f'<img src="{m["image_data_uri"]}" style="width:160px;height:160px;object-fit:contain;"/>'
                f'<div style="font-weight:600;margin-top:6px;color:#0e4f6e;">{m["name"]}</div>'
                f'<div style="font-size:0.8em;color:#6c757d;">MW: {m["mw"]:.1f} | LogP: {m["logp"]:.2f}</div>'
                f'<div><span class="badge {badge_class}">{badge_text}</span></div>'
                f'</div>'
            )
    html_parts.append("</div>")

    # MW bar chart (horizontal, sorted)
    sorted_by_mw = sorted(molecules_data, key=lambda m: m["mw"], reverse=True)
    mw_labels = [m["name"] for m in sorted_by_mw]
    mw_vals = [m["mw"] for m in sorted_by_mw]
    mw_chart = _make_bar_chart(
        mw_labels, {"MW (Da)": mw_vals},
        title="Molecular Weight Distribution",
        horizontal=True,
        width=700, height=max(300, len(mw_labels) * 30 + 80),
        value_fmt=".1f",
    )
    html_parts.append("<h3>Molecular Weight</h3>")
    html_parts.append(f'<div class="chart-container">{mw_chart}</div>')

    # LogP vs MW scatter plot
    scatter_points = [
        {"x": m["mw"], "y": m["logp"], "label": m["name"]}
        for m in molecules_data
    ]
    scatter_chart = _make_scatter_plot(
        scatter_points,
        x_label="Molecular Weight (Da)",
        y_label="LogP",
        title="LogP vs. Molecular Weight (Lipinski Boundaries)",
        reference_lines=[
            {"axis": "x", "value": 500, "label": "MW = 500"},
            {"axis": "y", "value": 5, "label": "LogP = 5"},
        ],
        width=700,
        height=420,
    )
    html_parts.append("<h3>Lipinski Space</h3>")
    html_parts.append(f'<div class="chart-container">{scatter_chart}</div>')

    # Property heatmap (molecules x properties)
    prop_names = ["MW", "LogP", "HBD", "HBA", "TPSA", "Rot. Bonds"]
    # Normalize each property to 0-1 for heatmap
    raw_matrix = []
    for m in molecules_data:
        raw_matrix.append([m["mw"], m["logp"], m["hbd"], m["hba"], m["tpsa"], m["rotatable_bonds"]])

    # Normalize per column
    n_props = len(prop_names)
    col_min = [min(row[c] for row in raw_matrix) for c in range(n_props)]
    col_max = [max(row[c] for row in raw_matrix) for c in range(n_props)]
    norm_matrix = []
    for row in raw_matrix:
        norm_row = []
        for c in range(n_props):
            rng = col_max[c] - col_min[c]
            norm_row.append((row[c] - col_min[c]) / rng if rng else 0.5)
        norm_matrix.append(norm_row)

    heatmap_labels = [m["name"] for m in molecules_data]
    heatmap = _make_heatmap(
        norm_matrix, heatmap_labels, prop_names,
        title="Normalized Property Heatmap",
        color_scale="cyan",
        width=700,
        height=max(400, len(heatmap_labels) * 28 + 100),
    )
    html_parts.append("<h3>Property Heatmap</h3>")
    html_parts.append(f'<div class="chart-container">{heatmap}</div>')

    # Lipinski compliance table
    html_parts.append("<h3>Lipinski Rule of Five Compliance</h3>")
    html_parts.append("<table><tr><th>Molecule</th><th>MW &le; 500</th>"
                      "<th>LogP &le; 5</th><th>HBD &le; 5</th>"
                      "<th>HBA &le; 10</th><th>Overall</th></tr>")
    for m in molecules_data:
        lip = m["lipinski"]

        def _badge(ok):
            if ok:
                return '<span class="badge badge-success">Pass</span>'
            return '<span class="badge badge-danger">Fail</span>'

        overall_badge = _badge(m["lipinski_pass"])
        html_parts.append(
            f'<tr><td><strong>{m["name"]}</strong></td>'
            f'<td>{_badge(lip["mw_ok"])}</td>'
            f'<td>{_badge(lip["logp_ok"])}</td>'
            f'<td>{_badge(lip["hbd_ok"])}</td>'
            f'<td>{_badge(lip["hba_ok"])}</td>'
            f'<td>{overall_badge}</td></tr>'
        )
    html_parts.append("</table>")

    # QED bar chart
    sorted_by_qed = sorted(molecules_data, key=lambda m: m["qed"], reverse=True)
    qed_labels = [m["name"] for m in sorted_by_qed]
    qed_vals = [m["qed"] for m in sorted_by_qed]
    qed_chart = _make_bar_chart(
        qed_labels, {"QED Score": qed_vals},
        title="Drug-likeness (QED Score)",
        horizontal=True,
        width=700, height=max(300, len(qed_labels) * 30 + 80),
        value_fmt=".3f",
        colors=["#06d6a0"],
    )
    html_parts.append("<h3>Drug-likeness (QED)</h3>")
    html_parts.append(f'<div class="chart-container">{qed_chart}</div>')

    # Flush full report
    await flyte.report.replace.aio(
        _wrap_report("\n".join(html_parts)),
        do_flush=True,
    )

    # Return properties as JSON (strip image data URIs to reduce size)
    output = {
        "total": total,
        "lipinski_pass_count": lipinski_pass,
        "lipinski_pass_rate": round(lipinski_rate, 2),
        "avg_mw": round(avg_mw, 2),
        "avg_logp": round(avg_logp, 2),
        "molecules": [
            {k: v for k, v in m.items() if k != "image_data_uri"}
            for m in molecules_data
        ],
    }
    return json.dumps(output)

# ------------------------------------------------------------------
# Task 3: Screen candidates against target profile
# ------------------------------------------------------------------

@tool
@env.task(report=True)
async def screen_candidates(
    properties_json: str,
    target_profile: str = "",
) -> str:
    """Screen molecules against a target drug profile and rank candidates.

    Scores each molecule on how well it matches the target profile, computes
    pairwise Tanimoto similarity, and produces a ranked list.

    Args:
        properties_json: JSON from compute_properties.
        target_profile: JSON string with desired property ranges
            (e.g. {"mw": [150, 500], "logp": [-0.5, 5.0]}).

    Returns:
        JSON string with ranked_molecules, similarity_matrix, similarity_labels,
        funnel, and target_profile. Pass the full return value verbatim to
        generate_report along with molecule_dir and properties_json.
    """
    from rdkit import Chem, DataStructs
    from rdkit.Chem import AllChem

    await flyte.report.replace.aio(
        _wrap_report("<h2>Screening Candidates...</h2>"
                      "<p>Evaluating molecules against the target drug profile.</p>"),
        do_flush=True,
    )

    props = json.loads(properties_json)
    molecules = props["molecules"]

    # Default target profile
    if target_profile.strip():
        profile = json.loads(target_profile)
    else:
        profile = {
            "mw": [150, 500],
            "logp": [-0.5, 5.0],
            "hbd": [0, 5],
            "hba": [0, 10],
            "tpsa": [20, 140],
        }

    # --- Screening ---
    funnel_total = len(molecules)
    pass_mw = 0
    pass_logp = 0
    pass_lipinski = 0
    final_candidates = 0

    scored = []
    for m in molecules:
        score = 0
        max_score = 0
        criteria = {}

        # Check each profile criterion
        checks = [
            ("mw", m["mw"]),
            ("logp", m["logp"]),
            ("hbd", m["hbd"]),
            ("hba", m["hba"]),
            ("tpsa", m["tpsa"]),
        ]

        for key, val in checks:
            if key in profile:
                lo, hi = profile[key]
                max_score += 1
                in_range = lo <= val <= hi
                criteria[key] = in_range
                if in_range:
                    score += 1
                    # Bonus: closer to midpoint = higher score
                    mid = (lo + hi) / 2
                    rng = (hi - lo) / 2
                    dist = abs(val - mid) / rng if rng else 0
                    score += max(0, 0.5 * (1 - dist))

        # QED bonus
        score += m["qed"] * 2
        max_score += 2

        # Lipinski bonus
        if m["lipinski_pass"]:
            score += 1
        max_score += 1

        normalized_score = score / max_score if max_score else 0

        # Funnel tracking — cascading filter (each stage requires passing the previous)
        mw_ok = criteria.get("mw", True)
        logp_ok = criteria.get("logp", True)
        if mw_ok:
            pass_mw += 1
            if logp_ok:
                pass_logp += 1
                if m["lipinski_pass"]:
                    pass_lipinski += 1
                    if all(criteria.values()):
                        final_candidates += 1

        scored.append({
            **m,
            "screening_score": round(normalized_score, 4),
            "criteria_met": criteria,
            "all_criteria_met": all(criteria.values()),
        })

    # Sort by score descending
    scored.sort(key=lambda m: m["screening_score"], reverse=True)

    # --- Tanimoto similarity matrix ---
    fps = []
    valid_names = []
    for m in scored:
        mol = Chem.MolFromSmiles(m["smiles"])
        if mol:
            fp = AllChem.GetMorganFingerprintAsBitVect(mol, 2, nBits=2048)
            fps.append(fp)
            valid_names.append(m["name"])

    similarity_matrix = []
    for i in range(len(fps)):
        row = []
        for j in range(len(fps)):
            sim = DataStructs.TanimotoSimilarity(fps[i], fps[j])
            row.append(round(sim, 3))
        similarity_matrix.append(row)

    # ---- Build report ----
    html_parts = []
    html_parts.append("<h2>Candidate Screening Results</h2>")

    # Stat grid
    html_parts.append('<div class="stat-grid">')
    for val, label in [
        (str(funnel_total), "Total Screened"),
        (str(pass_lipinski), "Lipinski Passes"),
        (str(final_candidates), "All Criteria Met"),
        (f"{scored[0]['screening_score']:.3f}" if scored else "N/A", "Top Score"),
    ]:
        html_parts.append(
            f'<div class="stat"><div class="value">{val}</div>'
            f'<div class="label">{label}</div></div>'
        )
    html_parts.append("</div>")

    # Screening funnel
    funnel_stages = [
        {"label": "Total Molecules", "count": funnel_total, "total": funnel_total},
        {"label": "Pass MW Filter", "count": pass_mw, "total": funnel_total},
        {"label": "Pass LogP Filter", "count": pass_logp, "total": funnel_total},
        {"label": "Lipinski Compliant", "count": pass_lipinski, "total": funnel_total},
        {"label": "All Criteria Met", "count": final_candidates, "total": funnel_total},
    ]
    funnel_svg = _make_funnel(
        funnel_stages,
        title="Screening Funnel",
        width=600,
        height=380,
    )
    html_parts.append("<h3>Screening Funnel</h3>")
    html_parts.append(f'<div class="chart-container" style="text-align:center;">{funnel_svg}</div>')

    # Ranked candidates table
    html_parts.append("<h3>Ranked Candidates</h3>")
    html_parts.append(
        "<table><tr><th>Rank</th><th>Molecule</th><th>Score</th>"
        "<th>MW</th><th>LogP</th><th>QED</th><th>Lipinski</th><th>All Criteria</th></tr>"
    )
    for rank, m in enumerate(scored, 1):
        lip_badge = ('<span class="badge badge-success">Pass</span>'
                     if m["lipinski_pass"]
                     else '<span class="badge badge-danger">Fail</span>')
        crit_badge = ('<span class="badge badge-success">Pass</span>'
                      if m["all_criteria_met"]
                      else '<span class="badge badge-danger">Fail</span>')
        # Highlight top 3
        row_style = ' style="background:#ecfeff;font-weight:600;"' if rank <= 3 else ""
        html_parts.append(
            f"<tr{row_style}><td>{rank}</td><td>{m['name']}</td>"
            f"<td>{m['screening_score']:.3f}</td>"
            f"<td>{m['mw']:.1f}</td><td>{m['logp']:.2f}</td>"
            f"<td>{m['qed']:.3f}</td><td>{lip_badge}</td><td>{crit_badge}</td></tr>"
        )
    html_parts.append("</table>")

    # Top 5 candidate cards with structures
    html_parts.append("<h3>Top 5 Candidates</h3>")
    html_parts.append('<div class="molecule-grid">')
    for m in scored[:5]:
        mol = Chem.MolFromSmiles(m["smiles"])
        img_uri = _mol_to_data_uri(mol, size=(250, 250)) if mol else ""
        badge_class = "badge-success" if m["all_criteria_met"] else "badge-info"
        badge_text = "All Criteria Met" if m["all_criteria_met"] else "Partial Match"
        html_parts.append(
            f'<div class="molecule-card" style="text-align:center;">'
            f'<img src="{img_uri}" style="width:140px;height:140px;object-fit:contain;"/>'
            f'<div style="font-weight:700;margin-top:6px;color:#0e4f6e;font-size:1.05em;">{m["name"]}</div>'
            f'<div style="font-size:0.85em;color:#155e75;margin:4px 0;">Score: {m["screening_score"]:.3f}</div>'
            f'<div style="font-size:0.8em;color:#6c757d;">MW: {m["mw"]:.1f} | LogP: {m["logp"]:.2f} | QED: {m["qed"]:.3f}</div>'
            f'<div style="margin-top:4px;"><span class="badge {badge_class}">{badge_text}</span></div>'
            f'</div>'
        )
    html_parts.append("</div>")

    # Tanimoto similarity heatmap
    if similarity_matrix:
        sim_heatmap = _make_heatmap(
            similarity_matrix, valid_names, valid_names,
            title="Pairwise Tanimoto Similarity (Morgan Fingerprints)",
            color_scale="cyan",
            width=700,
            height=max(500, len(valid_names) * 32 + 100),
        )
        html_parts.append("<h3>Chemical Similarity</h3>")
        html_parts.append(f'<div class="chart-container">{sim_heatmap}</div>')

    await flyte.report.replace.aio(
        _wrap_report("\n".join(html_parts)),
        do_flush=True,
    )

    output = {
        "ranked_molecules": scored,
        "similarity_matrix": similarity_matrix,
        "similarity_labels": valid_names,
        "funnel": funnel_stages,
        "target_profile": profile,
    }
    return json.dumps(output)

def _parse_screening_json(screening_json: str) -> dict:
    """Parse screening JSON from screen_candidates, with safe defaults.

    The agent must pass the exact tool return value. Partial or hand-built JSON
    is tolerated for optional similarity fields only.
    """
    screening = json.loads(screening_json)
    if "ranked_molecules" not in screening:
        raise ValueError(
            "screening_json must be the exact JSON string returned by "
            "screen_candidates (missing 'ranked_molecules'). Do not construct, "
            "truncate, or summarize tool output."
        )
    screening.setdefault("similarity_matrix", [])
    screening.setdefault("similarity_labels", [])
    return screening

# ------------------------------------------------------------------
# Task 4: Generate final comprehensive report
# ------------------------------------------------------------------

@tool
@env.task(report=True)
async def generate_report(
    molecule_dir: flyte.io.Dir,
    properties_json: str,
    screening_json: str,
) -> str:
    """Generate a comprehensive drug screening report.

    Produces an executive summary, top candidate spotlight cards, property
    distributions, chemical diversity analysis, and final recommendation.

    Args:
        molecule_dir: Directory from load_molecules.
        properties_json: JSON from compute_properties.
        screening_json: Exact verbatim JSON string returned by screen_candidates
            (must include ranked_molecules, similarity_matrix, similarity_labels).
            Do not construct or summarize this payload yourself.

    Returns:
        JSON summary with total_screened, lipinski_passes, all_criteria_met,
        top_candidate, top_score, and top_3 ranked molecules.
    """
    from rdkit import Chem

    await flyte.report.replace.aio(
        _wrap_report("<h2>Generating Final Report...</h2>"),
        do_flush=True,
    )

    props = json.loads(properties_json)
    screening = _parse_screening_json(screening_json)
    ranked = screening["ranked_molecules"]
    sim_matrix = screening["similarity_matrix"]
    sim_labels = screening["similarity_labels"]

    total = props["total"]
    lipinski_pass = props["lipinski_pass_count"]
    all_criteria = sum(1 for m in ranked if m["all_criteria_met"])
    top = ranked[0] if ranked else None

    html_parts = []

    # --- Executive Summary ---
    html_parts.append("<h2>Drug Molecule Screening Report</h2>")
    top_name = top["name"] if top else "N/A"
    top_score = f'{top["screening_score"]:.3f}' if top else "N/A"
    html_parts.append(
        f'<div class="card">'
        f'<h3 style="margin-top:0;color:#0e4f6e;">Executive Summary</h3>'
        f'<p style="font-size:1.05em;">'
        f'<strong>{total}</strong> molecules were screened against the target drug profile. '
        f'<strong>{lipinski_pass}</strong> passed Lipinski\'s Rule of Five, and '
        f'<strong>{all_criteria}</strong> met all screening criteria. '
        f'The top candidate is <strong style="color:#0891b2;">{top_name}</strong> '
        f'with a screening score of <strong>{top_score}</strong>.</p>'
        f'</div>'
    )

    # Stat grid
    html_parts.append('<div class="stat-grid">')
    for val, label in [
        (str(total), "Molecules Screened"),
        (str(lipinski_pass), "Lipinski Passes"),
        (str(all_criteria), "All Criteria Met"),
        (top_score, "Top Score"),
        (f'{props["avg_mw"]:.0f} Da', "Avg. Molecular Weight"),
        (f'{props["avg_logp"]:.2f}', "Avg. LogP"),
    ]:
        html_parts.append(
            f'<div class="stat"><div class="value">{val}</div>'
            f'<div class="label">{label}</div></div>'
        )
    html_parts.append("</div>")

    # --- Top 3 Candidate Spotlights ---
    html_parts.append("<h2>Top Candidate Spotlights</h2>")

    for rank, m in enumerate(ranked[:3], 1):
        mol = Chem.MolFromSmiles(m["smiles"])
        img_uri = _mol_to_data_uri(mol, size=(300, 300)) if mol else ""

        medal = ["gold", "silver", "#cd7f32"][rank - 1]
        medal_emoji = ["1st", "2nd", "3rd"][rank - 1]

        lip_badges = ""
        for rule, key in [("MW", "mw_ok"), ("LogP", "logp_ok"),
                          ("HBD", "hbd_ok"), ("HBA", "hba_ok")]:
            ok = m["lipinski"].get(key, False)
            cls = "badge-success" if ok else "badge-danger"
            lip_badges += f'<span class="badge {cls}" style="margin:2px;">{rule}</span> '

        html_parts.append(
            f'<div class="molecule-card" style="display:flex;gap:20px;align-items:flex-start;flex-wrap:wrap;">'
            f'<div style="text-align:center;min-width:180px;">'
            f'<div style="font-size:1.6em;font-weight:800;color:{medal};">{medal_emoji}</div>'
            f'<img src="{img_uri}" style="width:200px;height:200px;object-fit:contain;border-radius:8px;'
            f'border:2px solid #a5f3fc;"/>'
            f'<div style="font-weight:700;font-size:1.1em;color:#0e4f6e;margin-top:8px;">{m["name"]}</div>'
            f'</div>'
            f'<div style="flex:1;min-width:280px;">'
            f'<table style="margin:0;">'
            f'<tr><td><strong>SMILES</strong></td><td style="font-family:monospace;font-size:0.8em;word-break:break-all;">{m["smiles"]}</td></tr>'
            f'<tr><td><strong>Screening Score</strong></td><td style="font-weight:700;color:#0891b2;font-size:1.1em;">{m["screening_score"]:.3f}</td></tr>'
            f'<tr><td><strong>Molecular Weight</strong></td><td>{m["mw"]:.1f} Da</td></tr>'
            f'<tr><td><strong>LogP</strong></td><td>{m["logp"]:.2f}</td></tr>'
            f'<tr><td><strong>H-Bond Donors</strong></td><td>{m["hbd"]}</td></tr>'
            f'<tr><td><strong>H-Bond Acceptors</strong></td><td>{m["hba"]}</td></tr>'
            f'<tr><td><strong>TPSA</strong></td><td>{m["tpsa"]:.1f} A&sup2;</td></tr>'
            f'<tr><td><strong>Rotatable Bonds</strong></td><td>{m["rotatable_bonds"]}</td></tr>'
            f'<tr><td><strong>QED</strong></td><td>{m["qed"]:.4f}</td></tr>'
            f'<tr><td><strong>Lipinski Compliance</strong></td><td>{lip_badges}</td></tr>'
            f'</table>'
            f'</div>'
            f'</div>'
        )

    # --- Property Distribution (box-plot style as bars with min/max/median) ---
    html_parts.append("<h2>Property Distributions</h2>")

    prop_keys = [("mw", "Molecular Weight (Da)"), ("logp", "LogP"),
                 ("tpsa", "TPSA"), ("qed", "QED Score")]
    for key, label in prop_keys:
        vals = sorted([m[key] for m in ranked])
        n = len(vals)
        if n == 0:
            continue
        v_min = vals[0]
        v_max = vals[-1]
        median = vals[n // 2] if n % 2 == 1 else (vals[n // 2 - 1] + vals[n // 2]) / 2
        q1 = vals[n // 4] if n >= 4 else v_min
        q3 = vals[3 * n // 4] if n >= 4 else v_max

        # Simple horizontal box-plot as SVG
        box_w = 500
        box_h = 50
        margin_l = 10
        v_range = v_max - v_min or 1

        def sx(v):
            return margin_l + ((v - v_min) / v_range) * (box_w - 2 * margin_l)

        box_svg = (
            f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {box_w} {box_h}" '
            f'style="width:100%;max-width:{box_w}px;height:auto;">'
            f'<rect width="{box_w}" height="{box_h}" fill="#fff" rx="4"/>'
            # Whisker line
            f'<line x1="{sx(v_min):.1f}" y1="25" x2="{sx(v_max):.1f}" y2="25" '
            f'stroke="#94a3b8" stroke-width="1.5"/>'
            # Min whisker
            f'<line x1="{sx(v_min):.1f}" y1="18" x2="{sx(v_min):.1f}" y2="32" '
            f'stroke="#94a3b8" stroke-width="1.5"/>'
            # Max whisker
            f'<line x1="{sx(v_max):.1f}" y1="18" x2="{sx(v_max):.1f}" y2="32" '
            f'stroke="#94a3b8" stroke-width="1.5"/>'
            # IQR box
            f'<rect x="{sx(q1):.1f}" y="14" width="{sx(q3) - sx(q1):.1f}" height="22" '
            f'fill="#a5f3fc" stroke="#0891b2" stroke-width="1.5" rx="3"/>'
            # Median line
            f'<line x1="{sx(median):.1f}" y1="12" x2="{sx(median):.1f}" y2="38" '
            f'stroke="#0e4f6e" stroke-width="2"/>'
            # Labels
            f'<text x="{sx(v_min):.1f}" y="46" text-anchor="middle" font-size="9" fill="#6c757d">{v_min:.1f}</text>'
            f'<text x="{sx(median):.1f}" y="10" text-anchor="middle" font-size="9" fill="#0e4f6e" font-weight="600">{median:.1f}</text>'
            f'<text x="{sx(v_max):.1f}" y="46" text-anchor="middle" font-size="9" fill="#6c757d">{v_max:.1f}</text>'
            f'</svg>'
        )
        html_parts.append(
            f'<div style="margin:8px 0;"><strong style="color:#155e75;">{label}</strong>'
            f'<div class="chart-container" style="padding:8px;">{box_svg}</div></div>'
        )

    # --- Chemical Diversity ---
    html_parts.append("<h2>Chemical Diversity Analysis</h2>")

    if sim_matrix and len(sim_matrix) > 1:
        # Compute average pairwise similarity (off-diagonal)
        n_mols = len(sim_matrix)
        off_diag = []
        for i in range(n_mols):
            for j in range(i + 1, n_mols):
                off_diag.append(sim_matrix[i][j])

        avg_sim = sum(off_diag) / len(off_diag) if off_diag else 0
        max_sim = max(off_diag) if off_diag else 0
        min_sim = min(off_diag) if off_diag else 0

        # Find most similar pair
        best_i, best_j = 0, 1
        best_val = 0
        for i in range(n_mols):
            for j in range(i + 1, n_mols):
                if sim_matrix[i][j] > best_val:
                    best_val = sim_matrix[i][j]
                    best_i, best_j = i, j

        html_parts.append('<div class="stat-grid">')
        html_parts.append(
            f'<div class="stat"><div class="value">{avg_sim:.3f}</div>'
            f'<div class="label">Avg. Pairwise Similarity</div></div>'
        )
        html_parts.append(
            f'<div class="stat"><div class="value">{min_sim:.3f}</div>'
            f'<div class="label">Min Similarity</div></div>'
        )
        html_parts.append(
            f'<div class="stat"><div class="value">{max_sim:.3f}</div>'
            f'<div class="label">Max Similarity</div></div>'
        )
        html_parts.append("</div>")

        diversity_text = "highly diverse" if avg_sim < 0.3 else "moderately diverse" if avg_sim < 0.5 else "relatively similar"
        html_parts.append(
            f'<div class="note">'
            f'The library is <strong>{diversity_text}</strong> (avg. Tanimoto = {avg_sim:.3f}). '
            f'The most similar pair is <strong>{sim_labels[best_i]}</strong> and '
            f'<strong>{sim_labels[best_j]}</strong> (similarity = {best_val:.3f}).</div>'
        )

    # --- Recommendation ---
    html_parts.append("<h2>Recommendation</h2>")
    if top:
        html_parts.append(
            f'<div class="card">'
            f'<h3 style="margin-top:0;color:#0891b2;">Top Candidate: {top["name"]}</h3>'
            f'<p>Based on the virtual screening analysis, <strong>{top["name"]}</strong> '
            f'achieved the highest composite screening score of <strong>{top["screening_score"]:.3f}</strong>. '
        )

        reasons = []
        if top["lipinski_pass"]:
            reasons.append("full Lipinski Rule of Five compliance")
        if top["qed"] > 0.5:
            reasons.append(f"high drug-likeness (QED = {top['qed']:.3f})")
        if top.get("all_criteria_met"):
            reasons.append("all target profile criteria met")
        if top["mw"] <= 500:
            reasons.append(f"favorable molecular weight ({top['mw']:.1f} Da)")

        if reasons:
            html_parts.append(
                f'This candidate stands out due to: {", ".join(reasons)}.</p>'
            )
        else:
            html_parts.append("</p>")

        # Runner-up mentions
        if len(ranked) >= 2:
            html_parts.append(
                f'<p style="font-size:0.9em;color:#6c757d;">Runner-up candidates: '
            )
            runners = []
            for m in ranked[1:4]:
                runners.append(f'{m["name"]} (score: {m["screening_score"]:.3f})')
            html_parts.append(", ".join(runners) + ".</p>")

        html_parts.append("</div>")

    # Final note
    html_parts.append(
        '<div class="note">'
        "This is a virtual screening analysis. All candidates should undergo "
        "further computational validation (molecular dynamics, docking) and "
        "experimental testing before advancing to clinical trials.</div>"
    )

    await flyte.report.replace.aio(
        _wrap_report("\n".join(html_parts)),
        do_flush=True,
    )

    # JSON summary
    summary = {
        "total_screened": total,
        "lipinski_passes": lipinski_pass,
        "all_criteria_met": all_criteria,
        "top_candidate": top["name"] if top else None,
        "top_score": top["screening_score"] if top else None,
        "top_3": [
            {"name": m["name"], "score": m["screening_score"]}
            for m in ranked[:3]
        ],
    }
    return json.dumps(summary)

# ------------------------------------------------------------------
# Agent
# ------------------------------------------------------------------

# {{docs-fragment agent}}
SCREENING_AGENT_INSTRUCTIONS = """\
You are a medicinal chemistry screening strategist. You orchestrate a virtual \
screening pipeline using durable Flyte tools. You NEVER invent molecular \
properties — only RDKit tools compute them.

Workflow:
1. If target_profile is not provided in the user message, derive a JSON \
target_profile from the therapeutic brief. Valid keys: mw, logp, hbd, hba, tpsa \
(each [min, max]). Ground choices in oral bioavailability / kinase / CNS rules \
as appropriate to the brief.
2. First pass (always): load_molecules → compute_properties → \
screen_candidates → generate_report. Pass tool outputs between steps exactly \
(molecule_dir from load_molecules into compute_properties and generate_report; \
properties_json from compute_properties into screen_candidates and \
generate_report; screening_json must be the complete, unmodified string \
returned by screen_candidates — never rebuild or summarize JSON yourself).
3. Read the JSON summary returned by generate_report. Reflect:
   - If all_criteria_met == 0: relax exactly ONE profile bound by ~10–20% \
and re-run screen_candidates then generate_report only, reusing the same \
molecule_dir and properties_json from the first pass.
   - If all molecules pass but diversity is a stated goal: note high similarity \
in your summary; do not re-run unless brief asks for stricter filters.
   - Maximum ONE rescreen iteration.
4. Finish with plain text: top candidate, rationale tied to computed metrics \
from the tool JSON, funnel interpretation, and suggested next steps (docking, \
ADMET lab tests).

If the user supplies an explicit target_profile JSON, use it as-is.

Do NOT ask the user for SMILES or molecule lists when molecules_json is empty — \
the default library is loaded automatically.
"""

screening_agent = Agent(
    name="drug-screening-agent",
    instructions=SCREENING_AGENT_INSTRUCTIONS,
    model=MODEL,
    tools=[
        load_molecules,
        compute_properties,
        screen_candidates,
        generate_report,
    ],
    max_turns=12,
)
# {{/docs-fragment agent}}

# ------------------------------------------------------------------
# Pipeline
# ------------------------------------------------------------------

# {{docs-fragment pipeline}}
@env.task(report=True)
async def pipeline(
    brief: str = "Screen the default drug library for orally bioavailable small molecules.",
    molecules_json: str = "",
    target_profile: str = "",
) -> str:
    """Agentic virtual drug molecule screening pipeline.

    A medicinal-chemistry agent interprets the screening brief, derives or
    applies a target profile, orchestrates the RDKit screening stages, and
    optionally re-screens when funnel results are too narrow.

    Args:
        brief: Natural-language therapeutic goal (e.g. oral kinase inhibitors,
            CNS-penetrant small molecules).
        molecules_json: JSON mapping molecule names to SMILES strings.
            Defaults to a curated library of ~15 well-known drugs.
        target_profile: Optional JSON with desired property ranges that
            overrides agent-derived criteria
            (e.g. {"mw": [150, 500], "logp": [-0.5, 5]}).

    Returns:
        Agent summary with screening rationale and key results.
    """
    prompt_parts = [
        f"Screening brief: {brief}",
        'Use molecules_json="" for the built-in default library unless provided below.',
        "Compose the four stage tools in order: load_molecules → compute_properties "
        "→ screen_candidates → generate_report. Pass each tool's full return value "
        "verbatim to the next step (especially screening_json). Re-run "
        "screen_candidates and generate_report at most once if the funnel is too narrow.",
    ]
    if molecules_json.strip():
        prompt_parts.append(f"molecules_json: {molecules_json}")
    if target_profile.strip():
        prompt_parts.append(f"Use this target_profile exactly: {target_profile}")

    result = await screening_agent.run.aio("\n".join(prompt_parts))
    return result.summary or result.error or ""

# {{/docs-fragment pipeline}}

# ------------------------------------------------------------------
# Rescreen demo — tight profile + explicit rescreen instructions
# ------------------------------------------------------------------

# Initial profile is deliberately strict (narrow MW + low LogP cap) so
# all_criteria_met is typically 0 on the default library; the brief then
# forces a single rescreen with a widened LogP window.
RESCREEN_DEMO_TARGET_PROFILE = (
    '{"mw": [150, 200], "logp": [-0.5, 1.0], "hbd": [0, 1], '
    '"hba": [0, 3], "tpsa": [20, 45]}'
)
RESCREEN_DEMO_TARGET_PROFILE_RESCREEN = (
    '{"mw": [150, 200], "logp": [-0.5, 3.5], "hbd": [0, 1], '
    '"hba": [0, 3], "tpsa": [20, 45]}'
)
RESCREEN_DEMO_BRIEF = f"""\
Two-round agentic screening demo on the default library.

**Round 1 (strict profile):** load_molecules → compute_properties → \
screen_candidates → generate_report using the initial target_profile exactly.

**Round 2 (required — do not skip):** call screen_candidates then generate_report \
again, reusing the same molecule_dir and properties_json from round 1, with this \
relaxed target_profile (wider LogP window only): \
{RESCREEN_DEMO_TARGET_PROFILE_RESCREEN}

Pass every tool return value verbatim to the next step. After both rounds, \
summarize how the funnel and top candidates changed between round 1 and round 2."""

# {{docs-fragment rescreen_demo}}
@env.task(report=True)
async def rescreen_demo() -> str:
    """Example run with a two-round execution graph (rescreen).

    Round 1 uses a strict CNS-like profile; round 2 always re-runs
    screen_candidates and generate_report with a widened LogP window,
    reusing cached molecule_dir and properties_json.
    """
    return await pipeline(
        brief=RESCREEN_DEMO_BRIEF,
        target_profile=RESCREEN_DEMO_TARGET_PROFILE,
    )

# {{/docs-fragment rescreen_demo}}

# {{docs-fragment main}}
if __name__ == "__main__":
    flyte.init_from_config()
    run = flyte.run(pipeline)
    print(run.url)
    run.wait()
# {{/docs-fragment main}}
```

*Source: https://github.com/unionai/unionai-examples/blob/main/v2/tutorials/drug_molecule_screening/drug_molecule_screening.py*

## Run the agentic pipeline

The `pipeline` task delegates to the screening agent:

```
# /// script
# requires-python = ">=3.12"
# dependencies = [
#    "flyte>=2.5.4",
#    "litellm",
#    "rdkit",
#    "numpy",
#    "scikit-learn",
#    "pillow",
# ]
# main = "pipeline"
# params = ""
# ///
"""Virtual drug molecule screening — compute properties, apply Lipinski filters, rank candidates."""

import base64
import io
import json
import logging
import math
import os
import tempfile

import flyte
import flyte.io
import flyte.report
from flyte.ai.agents import Agent, tool

MODEL = os.getenv("DRUG_SCREENING_MODEL", "claude-haiku-4-5")

# {{docs-fragment env}}
main_img = flyte.Image.from_uv_script(__file__, name="drug-molecule-screening", pre=True).with_apt_packages(
    "libxrender1", "libxext6", "libexpat1",
)

env = flyte.TaskEnvironment(
    name="drug-molecule-screening",
    image=main_img,
    resources=flyte.Resources(cpu=2, memory="6Gi"),
    secrets=[
        flyte.Secret(key="internal-anthropic-api-key", as_env_var="ANTHROPIC_API_KEY"),
    ],
)
# {{/docs-fragment env}}

logging.basicConfig(level=logging.WARNING, format="%(message)s", force=True)
log = logging.getLogger(__name__)
log.setLevel(logging.INFO)

# ------------------------------------------------------------------
# Default molecule library — real SMILES for well-known drugs
# ------------------------------------------------------------------

DEFAULT_MOLECULES = {
    "Aspirin": "CC(=O)OC1=CC=CC=C1C(=O)O",
    "Ibuprofen": "CC(C)CC1=CC=C(C=C1)C(C)C(=O)O",
    "Caffeine": "CN1C=NC2=C1C(=O)N(C(=O)N2C)C",
    "Penicillin G": "CC1(C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C",
    "Metformin": "CN(C)C(=N)NC(=N)N",
    "Paracetamol": "CC(=O)NC1=CC=C(C=C1)O",
    "Diazepam": "ClC1=CC2=C(C=C1)N(C(=O)CN=C2C3=CC=CC=C3)C",
    "Omeprazole": "CC1=CN=C(C(=C1OC)C)CS(=O)C2=NC3=CC=CC=C3N2",
    "Atorvastatin": "CC(C)C1=C(C(=C(N1CCC(CC(CC(=O)O)O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4",
    "Methotrexate": "CN(CC1=CN=C2N=C(N=C(N)C2=N1)N)C3=CC=C(C=C3)C(=O)NC(CCC(=O)O)C(=O)O",
    "Doxorubicin": "CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)CO)O)N)O",
    "Tamoxifen": "CCC(=C(C1=CC=CC=C1)C2=CC=C(C=C2)OCCN(C)C)C3=CC=CC=C3",
    "Lopinavir": "CC1=C(C(=CC=C1)C)OCC(=O)NC(CC2=CC=CC=C2)C(CC(CC3=CC=CC=C3)NC(=O)C(C(C)C)N4CCCNC4=O)O",
    "Remdesivir": "CCC(CC)COC(=O)C(C)NP(=O)(OCC1C(C(C(O1)C2=CC=C3N2N=CN=C3N)O)O)OC4=CC=CC=C4",
    "Erlotinib": "COCCOC1=CC2=C(C=C1OCCOC)C(=NC=N2)NC3=CC=CC(=C3)C#C",
}

# ------------------------------------------------------------------
# Report styling — pharma blue/cyan theme
# ------------------------------------------------------------------

REPORT_CSS = """
<style>
  .report { font-family: system-ui, -apple-system, sans-serif; max-width: 960px; margin: 0 auto; color: #1a1a2e; }
  .report h2 { color: #0e4f6e; border-bottom: 2px solid #0891b2; padding-bottom: 8px; margin-top: 24px; }
  .report h3 { color: #155e75; margin-top: 20px; }
  .report .card { background: #ecfeff; border: 1px solid #a5f3fc; border-radius: 8px; padding: 16px; margin: 12px 0; }
  .report .stat-grid { display: grid; grid-template-columns: repeat(auto-fit, minmax(160px, 1fr)); gap: 12px; margin: 12px 0; }
  .report .stat { background: #fff; border: 1px solid #cffafe; border-radius: 6px; padding: 12px; text-align: center; }
  .report .stat .value { font-size: 1.5em; font-weight: 700; color: #0e4f6e; }
  .report .stat .label { font-size: 0.85em; color: #6c757d; margin-top: 4px; }
  .report table { border-collapse: collapse; width: 100%; margin: 12px 0; }
  .report th { background: #0e4f6e; color: #fff; padding: 10px 14px; text-align: left; font-weight: 600; }
  .report td { padding: 8px 14px; border-bottom: 1px solid #cffafe; }
  .report tr:nth-child(even) { background: #ecfeff; }
  .report .badge { display: inline-block; padding: 2px 8px; border-radius: 12px; font-size: 0.8em; font-weight: 600; }
  .report .badge-success { background: #d1fae5; color: #065f46; }
  .report .badge-danger { background: #fee2e2; color: #991b1b; }
  .report .badge-info { background: #cffafe; color: #155e75; }
  .report .chart-container { background: #fff; border: 1px solid #cffafe; border-radius: 8px; padding: 16px; margin: 16px 0; }
  .report .note { background: #ecfeff; border-left: 4px solid #0891b2; padding: 10px 14px; border-radius: 4px; margin: 12px 0; font-size: 0.9em; }
  .report .molecule-card { background: #fff; border: 1px solid #cffafe; border-radius: 8px; padding: 16px; margin: 12px 0; }
  .report .molecule-grid { display: grid; grid-template-columns: repeat(auto-fill, minmax(200px, 1fr)); gap: 12px; margin: 16px 0; }
  .report .funnel { text-align: center; margin: 24px 0; }
</style>
"""

def _wrap_report(html: str) -> str:
    """Wrap HTML content with report styling."""
    return f'{REPORT_CSS}<div class="report">{html}</div>'

# ------------------------------------------------------------------
# SVG chart helpers
# ------------------------------------------------------------------

def _mol_to_data_uri(mol, size: tuple[int, int] = (300, 300)) -> str:
    """Convert an RDKit molecule to a PNG base64 data URI."""
    from rdkit.Chem import Draw

    img = Draw.MolToImage(mol, size=size)
    buf = io.BytesIO()
    img.save(buf, format="PNG")
    b64 = base64.b64encode(buf.getvalue()).decode()
    return f"data:image/png;base64,{b64}"

def _make_bar_chart(
    labels: list[str],
    series: dict[str, list[float]],
    title: str = "",
    colors: list[str] | None = None,
    width: int = 700,
    height: int = 340,
    y_max_cap: float | None = None,
    horizontal: bool = False,
    value_fmt: str = ".1f",
) -> str:
    """Generate an SVG grouped bar chart.

    Args:
        labels: Category labels.
        series: Dict mapping series name to list of values.
        title: Chart title.
        colors: Colors for each series.
        width/height: SVG dimensions.
        y_max_cap: Cap the y-axis at this value.
        horizontal: If True, draw horizontal bars.
        value_fmt: Format string for value labels.

    Returns:
        SVG string.
    """
    if not labels:
        return ""

    default_colors = ["#0891b2", "#0e4f6e", "#06d6a0", "#a5f3fc", "#155e75"]
    colors = colors or default_colors

    if horizontal:
        return _make_horizontal_bar_chart(labels, series, title, colors, width, height, value_fmt)

    ml, mr, mt, mb = 60, 20, 40, 60
    cw = width - ml - mr
    ch = height - mt - mb

    all_vals = [v for vals in series.values() for v in vals]
    y_max = max(all_vals) if all_vals else 1
    y_max_plot = y_max * 1.15 or 1
    if y_max_cap is not None:
        y_max_plot = min(y_max_plot, y_max_cap) or y_max_cap

    n_groups = len(labels)
    n_series = len(series)
    group_width = cw / n_groups
    bar_width = group_width * 0.7 / max(n_series, 1)
    gap = group_width * 0.15

    def sy(v):
        return mt + ch - (v / y_max_plot) * ch

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    # Grid lines
    for i in range(6):
        y_tick = y_max_plot * i / 5
        py = sy(y_tick)
        svg.append(
            f'<line x1="{ml}" y1="{py:.1f}" x2="{ml + cw}" y2="{py:.1f}" '
            f'stroke="#e0f2fe" stroke-width="1"/>'
        )
        svg.append(
            f'<text x="{ml - 8}" y="{py + 4:.1f}" text-anchor="end" '
            f'font-size="11" fill="#6c757d">{y_tick:{value_fmt}}</text>'
        )

    # Axes
    svg.append(
        f'<line x1="{ml}" y1="{mt}" x2="{ml}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )
    svg.append(
        f'<line x1="{ml}" y1="{mt + ch}" x2="{ml + cw}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )

    # Bars
    for gi, label in enumerate(labels):
        gx = ml + gi * group_width + gap
        for si, (name, vals) in enumerate(series.items()):
            color = colors[si % len(colors)]
            bx = gx + si * bar_width
            val = vals[gi]
            by = sy(val)
            bh = mt + ch - by
            svg.append(
                f'<rect x="{bx:.1f}" y="{by:.1f}" width="{bar_width - 1:.1f}" '
                f'height="{bh:.1f}" fill="{color}" rx="2"/>'
            )
            svg.append(
                f'<text x="{bx + bar_width / 2:.1f}" y="{by - 4:.1f}" '
                f'text-anchor="middle" font-size="9" fill="#1a1a2e">'
                f'{val:{value_fmt}}</text>'
            )
        # Truncate long labels
        disp_label = label if len(label) <= 12 else label[:10] + ".."
        svg.append(
            f'<text x="{gx + n_series * bar_width / 2:.1f}" y="{mt + ch + 16}" '
            f'text-anchor="middle" font-size="10" fill="#6c757d" '
            f'transform="rotate(-35, {gx + n_series * bar_width / 2:.1f}, {mt + ch + 16})">'
            f'{disp_label}</text>'
        )

    # Title
    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    # Legend
    if n_series > 1:
        lx = ml + cw - len(series) * 100
        for si, name in enumerate(series):
            color = colors[si % len(colors)]
            svg.append(
                f'<rect x="{lx + si * 100}" y="{mt + ch + 40}" width="12" '
                f'height="12" rx="2" fill="{color}"/>'
            )
            svg.append(
                f'<text x="{lx + si * 100 + 16}" y="{mt + ch + 51}" font-size="11" '
                f'fill="#1a1a2e">{name}</text>'
            )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_horizontal_bar_chart(
    labels: list[str],
    series: dict[str, list[float]],
    title: str = "",
    colors: list[str] | None = None,
    width: int = 700,
    height: int = 400,
    value_fmt: str = ".1f",
) -> str:
    """Generate an SVG horizontal bar chart (sorted)."""
    default_colors = ["#0891b2", "#0e4f6e", "#06d6a0"]
    colors = colors or default_colors

    n = len(labels)
    row_height = max(22, min(35, (height - 80) // max(n, 1)))
    actual_height = max(height, 80 + n * row_height)
    ml, mr, mt, mb = 120, 60, 40, 20
    cw = width - ml - mr
    ch = actual_height - mt - mb

    # Use first series
    first_key = list(series.keys())[0]
    vals = series[first_key]
    x_max = max(vals) * 1.15 if vals else 1

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {actual_height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{actual_height}" fill="#fff" rx="6"/>',
    ]

    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    bar_h = row_height * 0.65
    for i, (label, val) in enumerate(zip(labels, vals)):
        y = mt + i * row_height
        bw = (val / x_max) * cw if x_max else 0
        color = colors[i % len(colors)]
        # Label
        disp = label if len(label) <= 14 else label[:12] + ".."
        svg.append(
            f'<text x="{ml - 8}" y="{y + bar_h / 2 + 4:.1f}" text-anchor="end" '
            f'font-size="11" fill="#1a1a2e">{disp}</text>'
        )
        # Bar
        svg.append(
            f'<rect x="{ml}" y="{y:.1f}" width="{bw:.1f}" height="{bar_h:.1f}" '
            f'fill="{color}" rx="3"/>'
        )
        # Value
        svg.append(
            f'<text x="{ml + bw + 6:.1f}" y="{y + bar_h / 2 + 4:.1f}" '
            f'font-size="11" fill="#0e4f6e" font-weight="600">{val:{value_fmt}}</text>'
        )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_heatmap(
    matrix: list[list[float]],
    row_labels: list[str],
    col_labels: list[str],
    title: str = "",
    color_scale: str = "cyan",
    width: int = 700,
    height: int = 500,
    value_fmt: str = ".2f",
) -> str:
    """Generate an SVG heatmap.

    Args:
        matrix: 2D list of values (rows x cols).
        row_labels: Labels for rows.
        col_labels: Labels for columns.
        title: Chart title.
        color_scale: Color scheme ("cyan", "red", "green").
        width/height: SVG dimensions.
        value_fmt: Format string for cell values.

    Returns:
        SVG string.
    """
    if not matrix or not matrix[0]:
        return ""

    n_rows = len(matrix)
    n_cols = len(matrix[0])

    ml, mr, mt, mb = 110, 20, 70, 20
    cw = width - ml - mr
    ch = height - mt - mb
    cell_w = cw / n_cols
    cell_h = ch / n_rows

    # Flatten to find range
    flat = [v for row in matrix for v in row]
    v_min = min(flat)
    v_max = max(flat)
    v_range = v_max - v_min or 1

    def color_for(v):
        t = (v - v_min) / v_range
        if color_scale == "cyan":
            # White to deep teal
            r = int(255 - t * (255 - 14))
            g = int(255 - t * (255 - 79))
            b = int(255 - t * (255 - 110))
        elif color_scale == "red":
            r = int(255 - t * 50)
            g = int(255 - t * 200)
            b = int(255 - t * 200)
        else:  # green
            r = int(255 - t * 200)
            g = int(255 - t * 50)
            b = int(255 - t * 200)
        return f"rgb({r},{g},{b})"

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    # Column labels (rotated)
    for ci, label in enumerate(col_labels):
        x = ml + ci * cell_w + cell_w / 2
        disp = label if len(label) <= 12 else label[:10] + ".."
        svg.append(
            f'<text x="{x:.1f}" y="{mt - 8}" text-anchor="end" font-size="10" '
            f'fill="#1a1a2e" transform="rotate(-45, {x:.1f}, {mt - 8})">{disp}</text>'
        )

    # Row labels + cells
    for ri, (row_label, row_vals) in enumerate(zip(row_labels, matrix)):
        y = mt + ri * cell_h
        disp = row_label if len(row_label) <= 14 else row_label[:12] + ".."
        svg.append(
            f'<text x="{ml - 8}" y="{y + cell_h / 2 + 4:.1f}" text-anchor="end" '
            f'font-size="10" fill="#1a1a2e">{disp}</text>'
        )
        for ci, val in enumerate(row_vals):
            x = ml + ci * cell_w
            fill = color_for(val)
            svg.append(
                f'<rect x="{x:.1f}" y="{y:.1f}" width="{cell_w:.1f}" '
                f'height="{cell_h:.1f}" fill="{fill}" stroke="#fff" stroke-width="1"/>'
            )
            # Text color: dark on light, light on dark
            t = (val - v_min) / v_range
            txt_color = "#fff" if t > 0.55 else "#1a1a2e"
            # Only show text if cells are large enough
            if cell_w > 30 and cell_h > 18:
                svg.append(
                    f'<text x="{x + cell_w / 2:.1f}" y="{y + cell_h / 2 + 4:.1f}" '
                    f'text-anchor="middle" font-size="9" fill="{txt_color}">'
                    f'{val:{value_fmt}}</text>'
                )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_scatter_plot(
    points: list[dict],
    x_label: str = "MW",
    y_label: str = "LogP",
    title: str = "",
    reference_lines: list[dict] | None = None,
    width: int = 700,
    height: int = 400,
) -> str:
    """Generate an SVG scatter plot.

    Args:
        points: List of dicts with "x", "y", "label" keys.
        x_label/y_label: Axis labels.
        title: Chart title.
        reference_lines: List of dicts with "axis" ("x"/"y"), "value", "label".
        width/height: SVG dimensions.

    Returns:
        SVG string.
    """
    if not points:
        return ""

    ml, mr, mt, mb = 60, 30, 40, 50
    cw = width - ml - mr
    ch = height - mt - mb

    x_vals = [p["x"] for p in points]
    y_vals = [p["y"] for p in points]
    x_min, x_max = min(x_vals) * 0.9, max(x_vals) * 1.1
    y_min, y_max = min(y_vals) - 1, max(y_vals) + 1

    # Extend ranges to include reference lines
    if reference_lines:
        for rl in reference_lines:
            if rl["axis"] == "x":
                x_max = max(x_max, rl["value"] * 1.1)
            else:
                y_max = max(y_max, rl["value"] * 1.1)

    x_range = x_max - x_min or 1
    y_range = y_max - y_min or 1

    def sx(v):
        return ml + (v - x_min) / x_range * cw

    def sy(v):
        return mt + ch - (v - y_min) / y_range * ch

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    # Grid
    for i in range(6):
        y_tick = y_min + y_range * i / 5
        py = sy(y_tick)
        svg.append(
            f'<line x1="{ml}" y1="{py:.1f}" x2="{ml + cw}" y2="{py:.1f}" '
            f'stroke="#e0f2fe" stroke-width="1"/>'
        )
        svg.append(
            f'<text x="{ml - 8}" y="{py + 4:.1f}" text-anchor="end" '
            f'font-size="11" fill="#6c757d">{y_tick:.1f}</text>'
        )

    for i in range(6):
        x_tick = x_min + x_range * i / 5
        px = sx(x_tick)
        svg.append(
            f'<text x="{px:.1f}" y="{mt + ch + 20}" text-anchor="middle" '
            f'font-size="11" fill="#6c757d">{x_tick:.0f}</text>'
        )

    # Axes
    svg.append(
        f'<line x1="{ml}" y1="{mt}" x2="{ml}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )
    svg.append(
        f'<line x1="{ml}" y1="{mt + ch}" x2="{ml + cw}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )

    # Reference lines (Lipinski boundaries)
    if reference_lines:
        for rl in reference_lines:
            if rl["axis"] == "x":
                px = sx(rl["value"])
                svg.append(
                    f'<line x1="{px:.1f}" y1="{mt}" x2="{px:.1f}" y2="{mt + ch}" '
                    f'stroke="#ef4444" stroke-width="1.5" stroke-dasharray="6,4"/>'
                )
                svg.append(
                    f'<text x="{px + 4:.1f}" y="{mt + 14}" font-size="10" '
                    f'fill="#ef4444" font-weight="600">{rl["label"]}</text>'
                )
            else:
                py = sy(rl["value"])
                svg.append(
                    f'<line x1="{ml}" y1="{py:.1f}" x2="{ml + cw}" y2="{py:.1f}" '
                    f'stroke="#ef4444" stroke-width="1.5" stroke-dasharray="6,4"/>'
                )
                svg.append(
                    f'<text x="{ml + cw - 4:.1f}" y="{py - 6:.1f}" text-anchor="end" '
                    f'font-size="10" fill="#ef4444" font-weight="600">{rl["label"]}</text>'
                )

    # Drug-like zone shading (MW<=500 and LogP<=5 quadrant)
    if reference_lines:
        mw_line = next((rl for rl in reference_lines if rl["axis"] == "x"), None)
        logp_line = next((rl for rl in reference_lines if rl["axis"] == "y"), None)
        if mw_line and logp_line:
            zx1 = sx(x_min)
            zx2 = sx(min(mw_line["value"], x_max))
            zy1 = sy(min(logp_line["value"], y_max))
            zy2 = sy(y_min)
            svg.append(
                f'<rect x="{zx1:.1f}" y="{zy1:.1f}" '
                f'width="{zx2 - zx1:.1f}" height="{zy2 - zy1:.1f}" '
                f'fill="#0891b2" opacity="0.06" rx="4"/>'
            )
            svg.append(
                f'<text x="{zx1 + 8:.1f}" y="{zy2 - 8:.1f}" font-size="11" '
                f'fill="#0891b2" font-weight="600" opacity="0.6">Drug-like Zone</text>'
            )

    # Points
    point_colors = ["#0891b2", "#0e4f6e", "#06d6a0", "#155e75", "#0284c7",
                    "#059669", "#0d9488", "#0369a1", "#047857", "#115e59",
                    "#0c4a6e", "#064e3b", "#1e3a5f", "#134e4a", "#075985"]
    for i, pt in enumerate(points):
        px, py = sx(pt["x"]), sy(pt["y"])
        color = point_colors[i % len(point_colors)]
        svg.append(
            f'<circle cx="{px:.1f}" cy="{py:.1f}" r="5" fill="{color}" '
            f'stroke="#fff" stroke-width="1.5" opacity="0.85"/>'
        )
        # Label offset to avoid overlap
        offset_x = 8
        offset_y = -8 if i % 2 == 0 else 14
        label = pt["label"] if len(pt["label"]) <= 12 else pt["label"][:10] + ".."
        svg.append(
            f'<text x="{px + offset_x:.1f}" y="{py + offset_y:.1f}" '
            f'font-size="9" fill="#1a1a2e">{label}</text>'
        )

    # Title
    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    # Axis labels
    if x_label:
        svg.append(
            f'<text x="{ml + cw / 2}" y="{height - 6}" text-anchor="middle" '
            f'font-size="12" fill="#6c757d">{x_label}</text>'
        )
    if y_label:
        svg.append(
            f'<text x="14" y="{mt + ch / 2}" text-anchor="middle" '
            f'font-size="12" fill="#6c757d" '
            f'transform="rotate(-90, 14, {mt + ch / 2})">{y_label}</text>'
        )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_funnel(
    stages: list[dict],
    title: str = "",
    width: int = 600,
    height: int = 400,
) -> str:
    """Generate an SVG funnel visualization.

    Args:
        stages: List of dicts with "label", "count", "total" keys.
        title: Chart title.
        width/height: SVG dimensions.

    Returns:
        SVG string.
    """
    if not stages:
        return ""

    n = len(stages)
    mt = 50
    mb = 20
    available_h = height - mt - mb
    stage_h = available_h / n
    cx = width / 2

    # Color gradient from light cyan to deep teal
    colors = []
    for i in range(n):
        t = i / max(n - 1, 1)
        r = int(207 - t * (207 - 14))
        g = int(250 - t * (250 - 79))
        b = int(254 - t * (254 - 110))
        colors.append(f"rgb({r},{g},{b})")

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    if title:
        svg.append(
            f'<text x="{cx}" y="28" text-anchor="middle" '
            f'font-size="16" font-weight="700" fill="#0e4f6e">{title}</text>'
        )

    max_count = stages[0]["count"] if stages else 1
    max_width = width * 0.75

    for i, stage in enumerate(stages):
        y_top = mt + i * stage_h
        y_bot = y_top + stage_h

        # Width proportional to count
        w_top = max_width * (stage["count"] / max_count) if i == 0 else prev_w_bot
        if i < n - 1:
            w_bot = max_width * (stages[i + 1]["count"] / max_count)
        else:
            w_bot = max_width * (stage["count"] / max_count) * 0.7

        prev_w_bot = w_bot

        # Trapezoid
        x1_top = cx - w_top / 2
        x2_top = cx + w_top / 2
        x1_bot = cx - w_bot / 2
        x2_bot = cx + w_bot / 2

        svg.append(
            f'<polygon points="{x1_top:.1f},{y_top:.1f} {x2_top:.1f},{y_top:.1f} '
            f'{x2_bot:.1f},{y_bot:.1f} {x1_bot:.1f},{y_bot:.1f}" '
            f'fill="{colors[i]}" stroke="#fff" stroke-width="2"/>'
        )

        # Text: dark on light, white on dark
        t = i / max(n - 1, 1)
        txt_color = "#0e4f6e" if t < 0.5 else "#fff"
        y_mid = (y_top + y_bot) / 2

        svg.append(
            f'<text x="{cx}" y="{y_mid - 4:.1f}" text-anchor="middle" '
            f'font-size="13" font-weight="600" fill="{txt_color}">{stage["label"]}</text>'
        )
        svg.append(
            f'<text x="{cx}" y="{y_mid + 14:.1f}" text-anchor="middle" '
            f'font-size="12" fill="{txt_color}" opacity="0.85">'
            f'{stage["count"]} / {stage["total"]}</text>'
        )

    svg.append("</svg>")
    return "\n".join(svg)

# ------------------------------------------------------------------
# Task 1: Load and validate molecules
# ------------------------------------------------------------------

@tool
@env.task(cache="auto")
async def load_molecules(
    molecules_json: str = "",
) -> flyte.io.Dir:
    """Parse SMILES strings, validate with RDKit, generate 2D depictions.

    Args:
        molecules_json: JSON string mapping molecule names to SMILES.
            Defaults to a curated library of ~15 well-known drugs.

    Returns:
        flyte.io.Dir containing molecule data (JSON + PNG depictions).
        Pass this directory to compute_properties and generate_report.
    """
    from rdkit import Chem
    from rdkit.Chem import Draw

    if molecules_json.strip():
        molecules = json.loads(molecules_json)
    else:
        molecules = DEFAULT_MOLECULES

    out_dir = tempfile.mkdtemp(prefix="mol_library_")
    results = []
    valid_count = 0
    invalid_count = 0

    log.info(f"Parsing {len(molecules)} molecules...")

    for name, smiles in molecules.items():
        mol = Chem.MolFromSmiles(smiles)
        if mol is None:
            log.warning(f"  [INVALID] {name}: {smiles}")
            invalid_count += 1
            continue

        valid_count += 1

        # Generate 2D depiction as PNG
        img = Draw.MolToImage(mol, size=(300, 300))
        img_path = os.path.join(out_dir, f"{name.replace(' ', '_')}.png")
        img.save(img_path)

        results.append({
            "name": name,
            "smiles": smiles,
            "valid": True,
            "image_file": os.path.basename(img_path),
        })

    # Save molecule manifest
    manifest = {
        "total": len(molecules),
        "valid": valid_count,
        "invalid": invalid_count,
        "molecules": results,
    }
    manifest_path = os.path.join(out_dir, "manifest.json")
    with open(manifest_path, "w") as f:
        json.dump(manifest, f, indent=2)

    log.info(f"Loaded {valid_count} valid molecules ({invalid_count} invalid)")

    return await flyte.io.Dir.from_local(out_dir)

# ------------------------------------------------------------------
# Task 2: Compute physicochemical properties
# ------------------------------------------------------------------

@tool
@env.task(report=True)
async def compute_properties(
    molecule_dir: flyte.io.Dir,
) -> str:
    """Compute drug-likeness properties for all molecules.

    Computes MW, LogP, HBD, HBA, TPSA, rotatable bonds, formal charge,
    ring count, QED, and Lipinski Rule of Five compliance.

    Args:
        molecule_dir: Directory from load_molecules.

    Returns:
        JSON string with all computed properties. Pass to screen_candidates
        and generate_report.
    """
    from rdkit import Chem
    from rdkit.Chem import Descriptors, Lipinski
    from rdkit.Chem.QED import qed

    # --- Loading report ---
    await flyte.report.replace.aio(
        _wrap_report("<h2>Computing Molecular Properties...</h2>"
                      "<p>Analyzing physicochemical descriptors for all molecules.</p>"),
        do_flush=True,
    )

    mol_dir = await molecule_dir.download()
    with open(os.path.join(mol_dir, "manifest.json")) as f:
        manifest = json.load(f)

    molecules_data = []
    lipinski_pass = 0

    for mol_info in manifest["molecules"]:
        mol = Chem.MolFromSmiles(mol_info["smiles"])
        if mol is None:
            continue

        mw = Descriptors.MolWt(mol)
        logp = Descriptors.MolLogP(mol)
        hbd = Lipinski.NumHDonors(mol)
        hba = Lipinski.NumHAcceptors(mol)
        tpsa = Descriptors.TPSA(mol)
        rotatable = Lipinski.NumRotatableBonds(mol)
        formal_charge = Chem.GetFormalCharge(mol)
        num_rings = Lipinski.RingCount(mol)
        qed_score = qed(mol)

        # Lipinski Rule of Five
        lipinski = {
            "mw_ok": mw <= 500,
            "logp_ok": logp <= 5,
            "hbd_ok": hbd <= 5,
            "hba_ok": hba <= 10,
        }
        lipinski_all = all(lipinski.values())
        if lipinski_all:
            lipinski_pass += 1

        # Read image for data URI
        img_path = os.path.join(mol_dir, mol_info["image_file"])
        data_uri = ""
        if os.path.exists(img_path):
            with open(img_path, "rb") as img_f:
                b64 = base64.b64encode(img_f.read()).decode()
                data_uri = f"data:image/png;base64,{b64}"

        molecules_data.append({
            "name": mol_info["name"],
            "smiles": mol_info["smiles"],
            "mw": round(mw, 2),
            "logp": round(logp, 2),
            "hbd": hbd,
            "hba": hba,
            "tpsa": round(tpsa, 2),
            "rotatable_bonds": rotatable,
            "formal_charge": formal_charge,
            "num_rings": num_rings,
            "qed": round(qed_score, 4),
            "lipinski": lipinski,
            "lipinski_pass": lipinski_all,
            "image_data_uri": data_uri,
        })

    total = len(molecules_data)
    avg_mw = sum(m["mw"] for m in molecules_data) / total if total else 0
    avg_logp = sum(m["logp"] for m in molecules_data) / total if total else 0
    lipinski_rate = lipinski_pass / total * 100 if total else 0

    # ---- Build report ----
    html_parts = []

    # Header
    html_parts.append("<h2>Molecular Properties Analysis</h2>")

    # Stat grid
    html_parts.append('<div class="stat-grid">')
    for val, label in [
        (str(total), "Total Molecules"),
        (f"{lipinski_rate:.0f}%", "Lipinski Pass Rate"),
        (f"{avg_mw:.1f}", "Avg. MW (Da)"),
        (f"{avg_logp:.2f}", "Avg. LogP"),
    ]:
        html_parts.append(
            f'<div class="stat"><div class="value">{val}</div>'
            f'<div class="label">{label}</div></div>'
        )
    html_parts.append("</div>")

    # Molecule gallery
    html_parts.append("<h3>Molecule Library</h3>")
    html_parts.append('<div class="molecule-grid">')
    for m in molecules_data:
        if m["image_data_uri"]:
            badge_class = "badge-success" if m["lipinski_pass"] else "badge-danger"
            badge_text = "Lipinski Pass" if m["lipinski_pass"] else "Lipinski Fail"
            html_parts.append(
                f'<div class="molecule-card" style="text-align:center;">'
                f'<img src="{m["image_data_uri"]}" style="width:160px;height:160px;object-fit:contain;"/>'
                f'<div style="font-weight:600;margin-top:6px;color:#0e4f6e;">{m["name"]}</div>'
                f'<div style="font-size:0.8em;color:#6c757d;">MW: {m["mw"]:.1f} | LogP: {m["logp"]:.2f}</div>'
                f'<div><span class="badge {badge_class}">{badge_text}</span></div>'
                f'</div>'
            )
    html_parts.append("</div>")

    # MW bar chart (horizontal, sorted)
    sorted_by_mw = sorted(molecules_data, key=lambda m: m["mw"], reverse=True)
    mw_labels = [m["name"] for m in sorted_by_mw]
    mw_vals = [m["mw"] for m in sorted_by_mw]
    mw_chart = _make_bar_chart(
        mw_labels, {"MW (Da)": mw_vals},
        title="Molecular Weight Distribution",
        horizontal=True,
        width=700, height=max(300, len(mw_labels) * 30 + 80),
        value_fmt=".1f",
    )
    html_parts.append("<h3>Molecular Weight</h3>")
    html_parts.append(f'<div class="chart-container">{mw_chart}</div>')

    # LogP vs MW scatter plot
    scatter_points = [
        {"x": m["mw"], "y": m["logp"], "label": m["name"]}
        for m in molecules_data
    ]
    scatter_chart = _make_scatter_plot(
        scatter_points,
        x_label="Molecular Weight (Da)",
        y_label="LogP",
        title="LogP vs. Molecular Weight (Lipinski Boundaries)",
        reference_lines=[
            {"axis": "x", "value": 500, "label": "MW = 500"},
            {"axis": "y", "value": 5, "label": "LogP = 5"},
        ],
        width=700,
        height=420,
    )
    html_parts.append("<h3>Lipinski Space</h3>")
    html_parts.append(f'<div class="chart-container">{scatter_chart}</div>')

    # Property heatmap (molecules x properties)
    prop_names = ["MW", "LogP", "HBD", "HBA", "TPSA", "Rot. Bonds"]
    # Normalize each property to 0-1 for heatmap
    raw_matrix = []
    for m in molecules_data:
        raw_matrix.append([m["mw"], m["logp"], m["hbd"], m["hba"], m["tpsa"], m["rotatable_bonds"]])

    # Normalize per column
    n_props = len(prop_names)
    col_min = [min(row[c] for row in raw_matrix) for c in range(n_props)]
    col_max = [max(row[c] for row in raw_matrix) for c in range(n_props)]
    norm_matrix = []
    for row in raw_matrix:
        norm_row = []
        for c in range(n_props):
            rng = col_max[c] - col_min[c]
            norm_row.append((row[c] - col_min[c]) / rng if rng else 0.5)
        norm_matrix.append(norm_row)

    heatmap_labels = [m["name"] for m in molecules_data]
    heatmap = _make_heatmap(
        norm_matrix, heatmap_labels, prop_names,
        title="Normalized Property Heatmap",
        color_scale="cyan",
        width=700,
        height=max(400, len(heatmap_labels) * 28 + 100),
    )
    html_parts.append("<h3>Property Heatmap</h3>")
    html_parts.append(f'<div class="chart-container">{heatmap}</div>')

    # Lipinski compliance table
    html_parts.append("<h3>Lipinski Rule of Five Compliance</h3>")
    html_parts.append("<table><tr><th>Molecule</th><th>MW &le; 500</th>"
                      "<th>LogP &le; 5</th><th>HBD &le; 5</th>"
                      "<th>HBA &le; 10</th><th>Overall</th></tr>")
    for m in molecules_data:
        lip = m["lipinski"]

        def _badge(ok):
            if ok:
                return '<span class="badge badge-success">Pass</span>'
            return '<span class="badge badge-danger">Fail</span>'

        overall_badge = _badge(m["lipinski_pass"])
        html_parts.append(
            f'<tr><td><strong>{m["name"]}</strong></td>'
            f'<td>{_badge(lip["mw_ok"])}</td>'
            f'<td>{_badge(lip["logp_ok"])}</td>'
            f'<td>{_badge(lip["hbd_ok"])}</td>'
            f'<td>{_badge(lip["hba_ok"])}</td>'
            f'<td>{overall_badge}</td></tr>'
        )
    html_parts.append("</table>")

    # QED bar chart
    sorted_by_qed = sorted(molecules_data, key=lambda m: m["qed"], reverse=True)
    qed_labels = [m["name"] for m in sorted_by_qed]
    qed_vals = [m["qed"] for m in sorted_by_qed]
    qed_chart = _make_bar_chart(
        qed_labels, {"QED Score": qed_vals},
        title="Drug-likeness (QED Score)",
        horizontal=True,
        width=700, height=max(300, len(qed_labels) * 30 + 80),
        value_fmt=".3f",
        colors=["#06d6a0"],
    )
    html_parts.append("<h3>Drug-likeness (QED)</h3>")
    html_parts.append(f'<div class="chart-container">{qed_chart}</div>')

    # Flush full report
    await flyte.report.replace.aio(
        _wrap_report("\n".join(html_parts)),
        do_flush=True,
    )

    # Return properties as JSON (strip image data URIs to reduce size)
    output = {
        "total": total,
        "lipinski_pass_count": lipinski_pass,
        "lipinski_pass_rate": round(lipinski_rate, 2),
        "avg_mw": round(avg_mw, 2),
        "avg_logp": round(avg_logp, 2),
        "molecules": [
            {k: v for k, v in m.items() if k != "image_data_uri"}
            for m in molecules_data
        ],
    }
    return json.dumps(output)

# ------------------------------------------------------------------
# Task 3: Screen candidates against target profile
# ------------------------------------------------------------------

@tool
@env.task(report=True)
async def screen_candidates(
    properties_json: str,
    target_profile: str = "",
) -> str:
    """Screen molecules against a target drug profile and rank candidates.

    Scores each molecule on how well it matches the target profile, computes
    pairwise Tanimoto similarity, and produces a ranked list.

    Args:
        properties_json: JSON from compute_properties.
        target_profile: JSON string with desired property ranges
            (e.g. {"mw": [150, 500], "logp": [-0.5, 5.0]}).

    Returns:
        JSON string with ranked_molecules, similarity_matrix, similarity_labels,
        funnel, and target_profile. Pass the full return value verbatim to
        generate_report along with molecule_dir and properties_json.
    """
    from rdkit import Chem, DataStructs
    from rdkit.Chem import AllChem

    await flyte.report.replace.aio(
        _wrap_report("<h2>Screening Candidates...</h2>"
                      "<p>Evaluating molecules against the target drug profile.</p>"),
        do_flush=True,
    )

    props = json.loads(properties_json)
    molecules = props["molecules"]

    # Default target profile
    if target_profile.strip():
        profile = json.loads(target_profile)
    else:
        profile = {
            "mw": [150, 500],
            "logp": [-0.5, 5.0],
            "hbd": [0, 5],
            "hba": [0, 10],
            "tpsa": [20, 140],
        }

    # --- Screening ---
    funnel_total = len(molecules)
    pass_mw = 0
    pass_logp = 0
    pass_lipinski = 0
    final_candidates = 0

    scored = []
    for m in molecules:
        score = 0
        max_score = 0
        criteria = {}

        # Check each profile criterion
        checks = [
            ("mw", m["mw"]),
            ("logp", m["logp"]),
            ("hbd", m["hbd"]),
            ("hba", m["hba"]),
            ("tpsa", m["tpsa"]),
        ]

        for key, val in checks:
            if key in profile:
                lo, hi = profile[key]
                max_score += 1
                in_range = lo <= val <= hi
                criteria[key] = in_range
                if in_range:
                    score += 1
                    # Bonus: closer to midpoint = higher score
                    mid = (lo + hi) / 2
                    rng = (hi - lo) / 2
                    dist = abs(val - mid) / rng if rng else 0
                    score += max(0, 0.5 * (1 - dist))

        # QED bonus
        score += m["qed"] * 2
        max_score += 2

        # Lipinski bonus
        if m["lipinski_pass"]:
            score += 1
        max_score += 1

        normalized_score = score / max_score if max_score else 0

        # Funnel tracking — cascading filter (each stage requires passing the previous)
        mw_ok = criteria.get("mw", True)
        logp_ok = criteria.get("logp", True)
        if mw_ok:
            pass_mw += 1
            if logp_ok:
                pass_logp += 1
                if m["lipinski_pass"]:
                    pass_lipinski += 1
                    if all(criteria.values()):
                        final_candidates += 1

        scored.append({
            **m,
            "screening_score": round(normalized_score, 4),
            "criteria_met": criteria,
            "all_criteria_met": all(criteria.values()),
        })

    # Sort by score descending
    scored.sort(key=lambda m: m["screening_score"], reverse=True)

    # --- Tanimoto similarity matrix ---
    fps = []
    valid_names = []
    for m in scored:
        mol = Chem.MolFromSmiles(m["smiles"])
        if mol:
            fp = AllChem.GetMorganFingerprintAsBitVect(mol, 2, nBits=2048)
            fps.append(fp)
            valid_names.append(m["name"])

    similarity_matrix = []
    for i in range(len(fps)):
        row = []
        for j in range(len(fps)):
            sim = DataStructs.TanimotoSimilarity(fps[i], fps[j])
            row.append(round(sim, 3))
        similarity_matrix.append(row)

    # ---- Build report ----
    html_parts = []
    html_parts.append("<h2>Candidate Screening Results</h2>")

    # Stat grid
    html_parts.append('<div class="stat-grid">')
    for val, label in [
        (str(funnel_total), "Total Screened"),
        (str(pass_lipinski), "Lipinski Passes"),
        (str(final_candidates), "All Criteria Met"),
        (f"{scored[0]['screening_score']:.3f}" if scored else "N/A", "Top Score"),
    ]:
        html_parts.append(
            f'<div class="stat"><div class="value">{val}</div>'
            f'<div class="label">{label}</div></div>'
        )
    html_parts.append("</div>")

    # Screening funnel
    funnel_stages = [
        {"label": "Total Molecules", "count": funnel_total, "total": funnel_total},
        {"label": "Pass MW Filter", "count": pass_mw, "total": funnel_total},
        {"label": "Pass LogP Filter", "count": pass_logp, "total": funnel_total},
        {"label": "Lipinski Compliant", "count": pass_lipinski, "total": funnel_total},
        {"label": "All Criteria Met", "count": final_candidates, "total": funnel_total},
    ]
    funnel_svg = _make_funnel(
        funnel_stages,
        title="Screening Funnel",
        width=600,
        height=380,
    )
    html_parts.append("<h3>Screening Funnel</h3>")
    html_parts.append(f'<div class="chart-container" style="text-align:center;">{funnel_svg}</div>')

    # Ranked candidates table
    html_parts.append("<h3>Ranked Candidates</h3>")
    html_parts.append(
        "<table><tr><th>Rank</th><th>Molecule</th><th>Score</th>"
        "<th>MW</th><th>LogP</th><th>QED</th><th>Lipinski</th><th>All Criteria</th></tr>"
    )
    for rank, m in enumerate(scored, 1):
        lip_badge = ('<span class="badge badge-success">Pass</span>'
                     if m["lipinski_pass"]
                     else '<span class="badge badge-danger">Fail</span>')
        crit_badge = ('<span class="badge badge-success">Pass</span>'
                      if m["all_criteria_met"]
                      else '<span class="badge badge-danger">Fail</span>')
        # Highlight top 3
        row_style = ' style="background:#ecfeff;font-weight:600;"' if rank <= 3 else ""
        html_parts.append(
            f"<tr{row_style}><td>{rank}</td><td>{m['name']}</td>"
            f"<td>{m['screening_score']:.3f}</td>"
            f"<td>{m['mw']:.1f}</td><td>{m['logp']:.2f}</td>"
            f"<td>{m['qed']:.3f}</td><td>{lip_badge}</td><td>{crit_badge}</td></tr>"
        )
    html_parts.append("</table>")

    # Top 5 candidate cards with structures
    html_parts.append("<h3>Top 5 Candidates</h3>")
    html_parts.append('<div class="molecule-grid">')
    for m in scored[:5]:
        mol = Chem.MolFromSmiles(m["smiles"])
        img_uri = _mol_to_data_uri(mol, size=(250, 250)) if mol else ""
        badge_class = "badge-success" if m["all_criteria_met"] else "badge-info"
        badge_text = "All Criteria Met" if m["all_criteria_met"] else "Partial Match"
        html_parts.append(
            f'<div class="molecule-card" style="text-align:center;">'
            f'<img src="{img_uri}" style="width:140px;height:140px;object-fit:contain;"/>'
            f'<div style="font-weight:700;margin-top:6px;color:#0e4f6e;font-size:1.05em;">{m["name"]}</div>'
            f'<div style="font-size:0.85em;color:#155e75;margin:4px 0;">Score: {m["screening_score"]:.3f}</div>'
            f'<div style="font-size:0.8em;color:#6c757d;">MW: {m["mw"]:.1f} | LogP: {m["logp"]:.2f} | QED: {m["qed"]:.3f}</div>'
            f'<div style="margin-top:4px;"><span class="badge {badge_class}">{badge_text}</span></div>'
            f'</div>'
        )
    html_parts.append("</div>")

    # Tanimoto similarity heatmap
    if similarity_matrix:
        sim_heatmap = _make_heatmap(
            similarity_matrix, valid_names, valid_names,
            title="Pairwise Tanimoto Similarity (Morgan Fingerprints)",
            color_scale="cyan",
            width=700,
            height=max(500, len(valid_names) * 32 + 100),
        )
        html_parts.append("<h3>Chemical Similarity</h3>")
        html_parts.append(f'<div class="chart-container">{sim_heatmap}</div>')

    await flyte.report.replace.aio(
        _wrap_report("\n".join(html_parts)),
        do_flush=True,
    )

    output = {
        "ranked_molecules": scored,
        "similarity_matrix": similarity_matrix,
        "similarity_labels": valid_names,
        "funnel": funnel_stages,
        "target_profile": profile,
    }
    return json.dumps(output)

def _parse_screening_json(screening_json: str) -> dict:
    """Parse screening JSON from screen_candidates, with safe defaults.

    The agent must pass the exact tool return value. Partial or hand-built JSON
    is tolerated for optional similarity fields only.
    """
    screening = json.loads(screening_json)
    if "ranked_molecules" not in screening:
        raise ValueError(
            "screening_json must be the exact JSON string returned by "
            "screen_candidates (missing 'ranked_molecules'). Do not construct, "
            "truncate, or summarize tool output."
        )
    screening.setdefault("similarity_matrix", [])
    screening.setdefault("similarity_labels", [])
    return screening

# ------------------------------------------------------------------
# Task 4: Generate final comprehensive report
# ------------------------------------------------------------------

@tool
@env.task(report=True)
async def generate_report(
    molecule_dir: flyte.io.Dir,
    properties_json: str,
    screening_json: str,
) -> str:
    """Generate a comprehensive drug screening report.

    Produces an executive summary, top candidate spotlight cards, property
    distributions, chemical diversity analysis, and final recommendation.

    Args:
        molecule_dir: Directory from load_molecules.
        properties_json: JSON from compute_properties.
        screening_json: Exact verbatim JSON string returned by screen_candidates
            (must include ranked_molecules, similarity_matrix, similarity_labels).
            Do not construct or summarize this payload yourself.

    Returns:
        JSON summary with total_screened, lipinski_passes, all_criteria_met,
        top_candidate, top_score, and top_3 ranked molecules.
    """
    from rdkit import Chem

    await flyte.report.replace.aio(
        _wrap_report("<h2>Generating Final Report...</h2>"),
        do_flush=True,
    )

    props = json.loads(properties_json)
    screening = _parse_screening_json(screening_json)
    ranked = screening["ranked_molecules"]
    sim_matrix = screening["similarity_matrix"]
    sim_labels = screening["similarity_labels"]

    total = props["total"]
    lipinski_pass = props["lipinski_pass_count"]
    all_criteria = sum(1 for m in ranked if m["all_criteria_met"])
    top = ranked[0] if ranked else None

    html_parts = []

    # --- Executive Summary ---
    html_parts.append("<h2>Drug Molecule Screening Report</h2>")
    top_name = top["name"] if top else "N/A"
    top_score = f'{top["screening_score"]:.3f}' if top else "N/A"
    html_parts.append(
        f'<div class="card">'
        f'<h3 style="margin-top:0;color:#0e4f6e;">Executive Summary</h3>'
        f'<p style="font-size:1.05em;">'
        f'<strong>{total}</strong> molecules were screened against the target drug profile. '
        f'<strong>{lipinski_pass}</strong> passed Lipinski\'s Rule of Five, and '
        f'<strong>{all_criteria}</strong> met all screening criteria. '
        f'The top candidate is <strong style="color:#0891b2;">{top_name}</strong> '
        f'with a screening score of <strong>{top_score}</strong>.</p>'
        f'</div>'
    )

    # Stat grid
    html_parts.append('<div class="stat-grid">')
    for val, label in [
        (str(total), "Molecules Screened"),
        (str(lipinski_pass), "Lipinski Passes"),
        (str(all_criteria), "All Criteria Met"),
        (top_score, "Top Score"),
        (f'{props["avg_mw"]:.0f} Da', "Avg. Molecular Weight"),
        (f'{props["avg_logp"]:.2f}', "Avg. LogP"),
    ]:
        html_parts.append(
            f'<div class="stat"><div class="value">{val}</div>'
            f'<div class="label">{label}</div></div>'
        )
    html_parts.append("</div>")

    # --- Top 3 Candidate Spotlights ---
    html_parts.append("<h2>Top Candidate Spotlights</h2>")

    for rank, m in enumerate(ranked[:3], 1):
        mol = Chem.MolFromSmiles(m["smiles"])
        img_uri = _mol_to_data_uri(mol, size=(300, 300)) if mol else ""

        medal = ["gold", "silver", "#cd7f32"][rank - 1]
        medal_emoji = ["1st", "2nd", "3rd"][rank - 1]

        lip_badges = ""
        for rule, key in [("MW", "mw_ok"), ("LogP", "logp_ok"),
                          ("HBD", "hbd_ok"), ("HBA", "hba_ok")]:
            ok = m["lipinski"].get(key, False)
            cls = "badge-success" if ok else "badge-danger"
            lip_badges += f'<span class="badge {cls}" style="margin:2px;">{rule}</span> '

        html_parts.append(
            f'<div class="molecule-card" style="display:flex;gap:20px;align-items:flex-start;flex-wrap:wrap;">'
            f'<div style="text-align:center;min-width:180px;">'
            f'<div style="font-size:1.6em;font-weight:800;color:{medal};">{medal_emoji}</div>'
            f'<img src="{img_uri}" style="width:200px;height:200px;object-fit:contain;border-radius:8px;'
            f'border:2px solid #a5f3fc;"/>'
            f'<div style="font-weight:700;font-size:1.1em;color:#0e4f6e;margin-top:8px;">{m["name"]}</div>'
            f'</div>'
            f'<div style="flex:1;min-width:280px;">'
            f'<table style="margin:0;">'
            f'<tr><td><strong>SMILES</strong></td><td style="font-family:monospace;font-size:0.8em;word-break:break-all;">{m["smiles"]}</td></tr>'
            f'<tr><td><strong>Screening Score</strong></td><td style="font-weight:700;color:#0891b2;font-size:1.1em;">{m["screening_score"]:.3f}</td></tr>'
            f'<tr><td><strong>Molecular Weight</strong></td><td>{m["mw"]:.1f} Da</td></tr>'
            f'<tr><td><strong>LogP</strong></td><td>{m["logp"]:.2f}</td></tr>'
            f'<tr><td><strong>H-Bond Donors</strong></td><td>{m["hbd"]}</td></tr>'
            f'<tr><td><strong>H-Bond Acceptors</strong></td><td>{m["hba"]}</td></tr>'
            f'<tr><td><strong>TPSA</strong></td><td>{m["tpsa"]:.1f} A&sup2;</td></tr>'
            f'<tr><td><strong>Rotatable Bonds</strong></td><td>{m["rotatable_bonds"]}</td></tr>'
            f'<tr><td><strong>QED</strong></td><td>{m["qed"]:.4f}</td></tr>'
            f'<tr><td><strong>Lipinski Compliance</strong></td><td>{lip_badges}</td></tr>'
            f'</table>'
            f'</div>'
            f'</div>'
        )

    # --- Property Distribution (box-plot style as bars with min/max/median) ---
    html_parts.append("<h2>Property Distributions</h2>")

    prop_keys = [("mw", "Molecular Weight (Da)"), ("logp", "LogP"),
                 ("tpsa", "TPSA"), ("qed", "QED Score")]
    for key, label in prop_keys:
        vals = sorted([m[key] for m in ranked])
        n = len(vals)
        if n == 0:
            continue
        v_min = vals[0]
        v_max = vals[-1]
        median = vals[n // 2] if n % 2 == 1 else (vals[n // 2 - 1] + vals[n // 2]) / 2
        q1 = vals[n // 4] if n >= 4 else v_min
        q3 = vals[3 * n // 4] if n >= 4 else v_max

        # Simple horizontal box-plot as SVG
        box_w = 500
        box_h = 50
        margin_l = 10
        v_range = v_max - v_min or 1

        def sx(v):
            return margin_l + ((v - v_min) / v_range) * (box_w - 2 * margin_l)

        box_svg = (
            f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {box_w} {box_h}" '
            f'style="width:100%;max-width:{box_w}px;height:auto;">'
            f'<rect width="{box_w}" height="{box_h}" fill="#fff" rx="4"/>'
            # Whisker line
            f'<line x1="{sx(v_min):.1f}" y1="25" x2="{sx(v_max):.1f}" y2="25" '
            f'stroke="#94a3b8" stroke-width="1.5"/>'
            # Min whisker
            f'<line x1="{sx(v_min):.1f}" y1="18" x2="{sx(v_min):.1f}" y2="32" '
            f'stroke="#94a3b8" stroke-width="1.5"/>'
            # Max whisker
            f'<line x1="{sx(v_max):.1f}" y1="18" x2="{sx(v_max):.1f}" y2="32" '
            f'stroke="#94a3b8" stroke-width="1.5"/>'
            # IQR box
            f'<rect x="{sx(q1):.1f}" y="14" width="{sx(q3) - sx(q1):.1f}" height="22" '
            f'fill="#a5f3fc" stroke="#0891b2" stroke-width="1.5" rx="3"/>'
            # Median line
            f'<line x1="{sx(median):.1f}" y1="12" x2="{sx(median):.1f}" y2="38" '
            f'stroke="#0e4f6e" stroke-width="2"/>'
            # Labels
            f'<text x="{sx(v_min):.1f}" y="46" text-anchor="middle" font-size="9" fill="#6c757d">{v_min:.1f}</text>'
            f'<text x="{sx(median):.1f}" y="10" text-anchor="middle" font-size="9" fill="#0e4f6e" font-weight="600">{median:.1f}</text>'
            f'<text x="{sx(v_max):.1f}" y="46" text-anchor="middle" font-size="9" fill="#6c757d">{v_max:.1f}</text>'
            f'</svg>'
        )
        html_parts.append(
            f'<div style="margin:8px 0;"><strong style="color:#155e75;">{label}</strong>'
            f'<div class="chart-container" style="padding:8px;">{box_svg}</div></div>'
        )

    # --- Chemical Diversity ---
    html_parts.append("<h2>Chemical Diversity Analysis</h2>")

    if sim_matrix and len(sim_matrix) > 1:
        # Compute average pairwise similarity (off-diagonal)
        n_mols = len(sim_matrix)
        off_diag = []
        for i in range(n_mols):
            for j in range(i + 1, n_mols):
                off_diag.append(sim_matrix[i][j])

        avg_sim = sum(off_diag) / len(off_diag) if off_diag else 0
        max_sim = max(off_diag) if off_diag else 0
        min_sim = min(off_diag) if off_diag else 0

        # Find most similar pair
        best_i, best_j = 0, 1
        best_val = 0
        for i in range(n_mols):
            for j in range(i + 1, n_mols):
                if sim_matrix[i][j] > best_val:
                    best_val = sim_matrix[i][j]
                    best_i, best_j = i, j

        html_parts.append('<div class="stat-grid">')
        html_parts.append(
            f'<div class="stat"><div class="value">{avg_sim:.3f}</div>'
            f'<div class="label">Avg. Pairwise Similarity</div></div>'
        )
        html_parts.append(
            f'<div class="stat"><div class="value">{min_sim:.3f}</div>'
            f'<div class="label">Min Similarity</div></div>'
        )
        html_parts.append(
            f'<div class="stat"><div class="value">{max_sim:.3f}</div>'
            f'<div class="label">Max Similarity</div></div>'
        )
        html_parts.append("</div>")

        diversity_text = "highly diverse" if avg_sim < 0.3 else "moderately diverse" if avg_sim < 0.5 else "relatively similar"
        html_parts.append(
            f'<div class="note">'
            f'The library is <strong>{diversity_text}</strong> (avg. Tanimoto = {avg_sim:.3f}). '
            f'The most similar pair is <strong>{sim_labels[best_i]}</strong> and '
            f'<strong>{sim_labels[best_j]}</strong> (similarity = {best_val:.3f}).</div>'
        )

    # --- Recommendation ---
    html_parts.append("<h2>Recommendation</h2>")
    if top:
        html_parts.append(
            f'<div class="card">'
            f'<h3 style="margin-top:0;color:#0891b2;">Top Candidate: {top["name"]}</h3>'
            f'<p>Based on the virtual screening analysis, <strong>{top["name"]}</strong> '
            f'achieved the highest composite screening score of <strong>{top["screening_score"]:.3f}</strong>. '
        )

        reasons = []
        if top["lipinski_pass"]:
            reasons.append("full Lipinski Rule of Five compliance")
        if top["qed"] > 0.5:
            reasons.append(f"high drug-likeness (QED = {top['qed']:.3f})")
        if top.get("all_criteria_met"):
            reasons.append("all target profile criteria met")
        if top["mw"] <= 500:
            reasons.append(f"favorable molecular weight ({top['mw']:.1f} Da)")

        if reasons:
            html_parts.append(
                f'This candidate stands out due to: {", ".join(reasons)}.</p>'
            )
        else:
            html_parts.append("</p>")

        # Runner-up mentions
        if len(ranked) >= 2:
            html_parts.append(
                f'<p style="font-size:0.9em;color:#6c757d;">Runner-up candidates: '
            )
            runners = []
            for m in ranked[1:4]:
                runners.append(f'{m["name"]} (score: {m["screening_score"]:.3f})')
            html_parts.append(", ".join(runners) + ".</p>")

        html_parts.append("</div>")

    # Final note
    html_parts.append(
        '<div class="note">'
        "This is a virtual screening analysis. All candidates should undergo "
        "further computational validation (molecular dynamics, docking) and "
        "experimental testing before advancing to clinical trials.</div>"
    )

    await flyte.report.replace.aio(
        _wrap_report("\n".join(html_parts)),
        do_flush=True,
    )

    # JSON summary
    summary = {
        "total_screened": total,
        "lipinski_passes": lipinski_pass,
        "all_criteria_met": all_criteria,
        "top_candidate": top["name"] if top else None,
        "top_score": top["screening_score"] if top else None,
        "top_3": [
            {"name": m["name"], "score": m["screening_score"]}
            for m in ranked[:3]
        ],
    }
    return json.dumps(summary)

# ------------------------------------------------------------------
# Agent
# ------------------------------------------------------------------

# {{docs-fragment agent}}
SCREENING_AGENT_INSTRUCTIONS = """\
You are a medicinal chemistry screening strategist. You orchestrate a virtual \
screening pipeline using durable Flyte tools. You NEVER invent molecular \
properties — only RDKit tools compute them.

Workflow:
1. If target_profile is not provided in the user message, derive a JSON \
target_profile from the therapeutic brief. Valid keys: mw, logp, hbd, hba, tpsa \
(each [min, max]). Ground choices in oral bioavailability / kinase / CNS rules \
as appropriate to the brief.
2. First pass (always): load_molecules → compute_properties → \
screen_candidates → generate_report. Pass tool outputs between steps exactly \
(molecule_dir from load_molecules into compute_properties and generate_report; \
properties_json from compute_properties into screen_candidates and \
generate_report; screening_json must be the complete, unmodified string \
returned by screen_candidates — never rebuild or summarize JSON yourself).
3. Read the JSON summary returned by generate_report. Reflect:
   - If all_criteria_met == 0: relax exactly ONE profile bound by ~10–20% \
and re-run screen_candidates then generate_report only, reusing the same \
molecule_dir and properties_json from the first pass.
   - If all molecules pass but diversity is a stated goal: note high similarity \
in your summary; do not re-run unless brief asks for stricter filters.
   - Maximum ONE rescreen iteration.
4. Finish with plain text: top candidate, rationale tied to computed metrics \
from the tool JSON, funnel interpretation, and suggested next steps (docking, \
ADMET lab tests).

If the user supplies an explicit target_profile JSON, use it as-is.

Do NOT ask the user for SMILES or molecule lists when molecules_json is empty — \
the default library is loaded automatically.
"""

screening_agent = Agent(
    name="drug-screening-agent",
    instructions=SCREENING_AGENT_INSTRUCTIONS,
    model=MODEL,
    tools=[
        load_molecules,
        compute_properties,
        screen_candidates,
        generate_report,
    ],
    max_turns=12,
)
# {{/docs-fragment agent}}

# ------------------------------------------------------------------
# Pipeline
# ------------------------------------------------------------------

# {{docs-fragment pipeline}}
@env.task(report=True)
async def pipeline(
    brief: str = "Screen the default drug library for orally bioavailable small molecules.",
    molecules_json: str = "",
    target_profile: str = "",
) -> str:
    """Agentic virtual drug molecule screening pipeline.

    A medicinal-chemistry agent interprets the screening brief, derives or
    applies a target profile, orchestrates the RDKit screening stages, and
    optionally re-screens when funnel results are too narrow.

    Args:
        brief: Natural-language therapeutic goal (e.g. oral kinase inhibitors,
            CNS-penetrant small molecules).
        molecules_json: JSON mapping molecule names to SMILES strings.
            Defaults to a curated library of ~15 well-known drugs.
        target_profile: Optional JSON with desired property ranges that
            overrides agent-derived criteria
            (e.g. {"mw": [150, 500], "logp": [-0.5, 5]}).

    Returns:
        Agent summary with screening rationale and key results.
    """
    prompt_parts = [
        f"Screening brief: {brief}",
        'Use molecules_json="" for the built-in default library unless provided below.',
        "Compose the four stage tools in order: load_molecules → compute_properties "
        "→ screen_candidates → generate_report. Pass each tool's full return value "
        "verbatim to the next step (especially screening_json). Re-run "
        "screen_candidates and generate_report at most once if the funnel is too narrow.",
    ]
    if molecules_json.strip():
        prompt_parts.append(f"molecules_json: {molecules_json}")
    if target_profile.strip():
        prompt_parts.append(f"Use this target_profile exactly: {target_profile}")

    result = await screening_agent.run.aio("\n".join(prompt_parts))
    return result.summary or result.error or ""

# {{/docs-fragment pipeline}}

# ------------------------------------------------------------------
# Rescreen demo — tight profile + explicit rescreen instructions
# ------------------------------------------------------------------

# Initial profile is deliberately strict (narrow MW + low LogP cap) so
# all_criteria_met is typically 0 on the default library; the brief then
# forces a single rescreen with a widened LogP window.
RESCREEN_DEMO_TARGET_PROFILE = (
    '{"mw": [150, 200], "logp": [-0.5, 1.0], "hbd": [0, 1], '
    '"hba": [0, 3], "tpsa": [20, 45]}'
)
RESCREEN_DEMO_TARGET_PROFILE_RESCREEN = (
    '{"mw": [150, 200], "logp": [-0.5, 3.5], "hbd": [0, 1], '
    '"hba": [0, 3], "tpsa": [20, 45]}'
)
RESCREEN_DEMO_BRIEF = f"""\
Two-round agentic screening demo on the default library.

**Round 1 (strict profile):** load_molecules → compute_properties → \
screen_candidates → generate_report using the initial target_profile exactly.

**Round 2 (required — do not skip):** call screen_candidates then generate_report \
again, reusing the same molecule_dir and properties_json from round 1, with this \
relaxed target_profile (wider LogP window only): \
{RESCREEN_DEMO_TARGET_PROFILE_RESCREEN}

Pass every tool return value verbatim to the next step. After both rounds, \
summarize how the funnel and top candidates changed between round 1 and round 2."""

# {{docs-fragment rescreen_demo}}
@env.task(report=True)
async def rescreen_demo() -> str:
    """Example run with a two-round execution graph (rescreen).

    Round 1 uses a strict CNS-like profile; round 2 always re-runs
    screen_candidates and generate_report with a widened LogP window,
    reusing cached molecule_dir and properties_json.
    """
    return await pipeline(
        brief=RESCREEN_DEMO_BRIEF,
        target_profile=RESCREEN_DEMO_TARGET_PROFILE,
    )

# {{/docs-fragment rescreen_demo}}

# {{docs-fragment main}}
if __name__ == "__main__":
    flyte.init_from_config()
    run = flyte.run(pipeline)
    print(run.url)
    run.wait()
# {{/docs-fragment main}}
```

*Source: https://github.com/unionai/unionai-examples/blob/main/v2/tutorials/drug_molecule_screening/drug_molecule_screening.py*

From the [example directory](https://github.com/unionai/unionai-examples/tree/main/v2/tutorials/drug_molecule_screening):

```
cd v2/tutorials/drug_molecule_screening
uv run --script drug_molecule_screening.py
```

Pass a natural-language brief (the agent derives the target profile):

```
flyte run drug_molecule_screening.py pipeline \
  --brief "Find oral kinase inhibitor candidates under 400 Da with moderate LogP"
```

Or pass an explicit target profile to skip agent-derived criteria:

```
flyte run drug_molecule_screening.py pipeline \
  --target_profile '{"mw": [100, 400], "logp": [-0.5, 4.0]}'
```

### Two-round rescreen demo (complex execution graph)

The `rescreen_demo` task always runs two screening rounds: a strict first pass (`load_molecules` → `compute_properties` → `screen_candidates` → `generate_report`), then a second `screen_candidates` → `generate_report` with a widened LogP window reusing the same `molecule_dir` and `properties_json`. The Flyte UI shows six stage tasks instead of four.

```
# /// script
# requires-python = ">=3.12"
# dependencies = [
#    "flyte>=2.5.4",
#    "litellm",
#    "rdkit",
#    "numpy",
#    "scikit-learn",
#    "pillow",
# ]
# main = "pipeline"
# params = ""
# ///
"""Virtual drug molecule screening — compute properties, apply Lipinski filters, rank candidates."""

import base64
import io
import json
import logging
import math
import os
import tempfile

import flyte
import flyte.io
import flyte.report
from flyte.ai.agents import Agent, tool

MODEL = os.getenv("DRUG_SCREENING_MODEL", "claude-haiku-4-5")

# {{docs-fragment env}}
main_img = flyte.Image.from_uv_script(__file__, name="drug-molecule-screening", pre=True).with_apt_packages(
    "libxrender1", "libxext6", "libexpat1",
)

env = flyte.TaskEnvironment(
    name="drug-molecule-screening",
    image=main_img,
    resources=flyte.Resources(cpu=2, memory="6Gi"),
    secrets=[
        flyte.Secret(key="internal-anthropic-api-key", as_env_var="ANTHROPIC_API_KEY"),
    ],
)
# {{/docs-fragment env}}

logging.basicConfig(level=logging.WARNING, format="%(message)s", force=True)
log = logging.getLogger(__name__)
log.setLevel(logging.INFO)

# ------------------------------------------------------------------
# Default molecule library — real SMILES for well-known drugs
# ------------------------------------------------------------------

DEFAULT_MOLECULES = {
    "Aspirin": "CC(=O)OC1=CC=CC=C1C(=O)O",
    "Ibuprofen": "CC(C)CC1=CC=C(C=C1)C(C)C(=O)O",
    "Caffeine": "CN1C=NC2=C1C(=O)N(C(=O)N2C)C",
    "Penicillin G": "CC1(C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C",
    "Metformin": "CN(C)C(=N)NC(=N)N",
    "Paracetamol": "CC(=O)NC1=CC=C(C=C1)O",
    "Diazepam": "ClC1=CC2=C(C=C1)N(C(=O)CN=C2C3=CC=CC=C3)C",
    "Omeprazole": "CC1=CN=C(C(=C1OC)C)CS(=O)C2=NC3=CC=CC=C3N2",
    "Atorvastatin": "CC(C)C1=C(C(=C(N1CCC(CC(CC(=O)O)O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4",
    "Methotrexate": "CN(CC1=CN=C2N=C(N=C(N)C2=N1)N)C3=CC=C(C=C3)C(=O)NC(CCC(=O)O)C(=O)O",
    "Doxorubicin": "CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)CO)O)N)O",
    "Tamoxifen": "CCC(=C(C1=CC=CC=C1)C2=CC=C(C=C2)OCCN(C)C)C3=CC=CC=C3",
    "Lopinavir": "CC1=C(C(=CC=C1)C)OCC(=O)NC(CC2=CC=CC=C2)C(CC(CC3=CC=CC=C3)NC(=O)C(C(C)C)N4CCCNC4=O)O",
    "Remdesivir": "CCC(CC)COC(=O)C(C)NP(=O)(OCC1C(C(C(O1)C2=CC=C3N2N=CN=C3N)O)O)OC4=CC=CC=C4",
    "Erlotinib": "COCCOC1=CC2=C(C=C1OCCOC)C(=NC=N2)NC3=CC=CC(=C3)C#C",
}

# ------------------------------------------------------------------
# Report styling — pharma blue/cyan theme
# ------------------------------------------------------------------

REPORT_CSS = """
<style>
  .report { font-family: system-ui, -apple-system, sans-serif; max-width: 960px; margin: 0 auto; color: #1a1a2e; }
  .report h2 { color: #0e4f6e; border-bottom: 2px solid #0891b2; padding-bottom: 8px; margin-top: 24px; }
  .report h3 { color: #155e75; margin-top: 20px; }
  .report .card { background: #ecfeff; border: 1px solid #a5f3fc; border-radius: 8px; padding: 16px; margin: 12px 0; }
  .report .stat-grid { display: grid; grid-template-columns: repeat(auto-fit, minmax(160px, 1fr)); gap: 12px; margin: 12px 0; }
  .report .stat { background: #fff; border: 1px solid #cffafe; border-radius: 6px; padding: 12px; text-align: center; }
  .report .stat .value { font-size: 1.5em; font-weight: 700; color: #0e4f6e; }
  .report .stat .label { font-size: 0.85em; color: #6c757d; margin-top: 4px; }
  .report table { border-collapse: collapse; width: 100%; margin: 12px 0; }
  .report th { background: #0e4f6e; color: #fff; padding: 10px 14px; text-align: left; font-weight: 600; }
  .report td { padding: 8px 14px; border-bottom: 1px solid #cffafe; }
  .report tr:nth-child(even) { background: #ecfeff; }
  .report .badge { display: inline-block; padding: 2px 8px; border-radius: 12px; font-size: 0.8em; font-weight: 600; }
  .report .badge-success { background: #d1fae5; color: #065f46; }
  .report .badge-danger { background: #fee2e2; color: #991b1b; }
  .report .badge-info { background: #cffafe; color: #155e75; }
  .report .chart-container { background: #fff; border: 1px solid #cffafe; border-radius: 8px; padding: 16px; margin: 16px 0; }
  .report .note { background: #ecfeff; border-left: 4px solid #0891b2; padding: 10px 14px; border-radius: 4px; margin: 12px 0; font-size: 0.9em; }
  .report .molecule-card { background: #fff; border: 1px solid #cffafe; border-radius: 8px; padding: 16px; margin: 12px 0; }
  .report .molecule-grid { display: grid; grid-template-columns: repeat(auto-fill, minmax(200px, 1fr)); gap: 12px; margin: 16px 0; }
  .report .funnel { text-align: center; margin: 24px 0; }
</style>
"""

def _wrap_report(html: str) -> str:
    """Wrap HTML content with report styling."""
    return f'{REPORT_CSS}<div class="report">{html}</div>'

# ------------------------------------------------------------------
# SVG chart helpers
# ------------------------------------------------------------------

def _mol_to_data_uri(mol, size: tuple[int, int] = (300, 300)) -> str:
    """Convert an RDKit molecule to a PNG base64 data URI."""
    from rdkit.Chem import Draw

    img = Draw.MolToImage(mol, size=size)
    buf = io.BytesIO()
    img.save(buf, format="PNG")
    b64 = base64.b64encode(buf.getvalue()).decode()
    return f"data:image/png;base64,{b64}"

def _make_bar_chart(
    labels: list[str],
    series: dict[str, list[float]],
    title: str = "",
    colors: list[str] | None = None,
    width: int = 700,
    height: int = 340,
    y_max_cap: float | None = None,
    horizontal: bool = False,
    value_fmt: str = ".1f",
) -> str:
    """Generate an SVG grouped bar chart.

    Args:
        labels: Category labels.
        series: Dict mapping series name to list of values.
        title: Chart title.
        colors: Colors for each series.
        width/height: SVG dimensions.
        y_max_cap: Cap the y-axis at this value.
        horizontal: If True, draw horizontal bars.
        value_fmt: Format string for value labels.

    Returns:
        SVG string.
    """
    if not labels:
        return ""

    default_colors = ["#0891b2", "#0e4f6e", "#06d6a0", "#a5f3fc", "#155e75"]
    colors = colors or default_colors

    if horizontal:
        return _make_horizontal_bar_chart(labels, series, title, colors, width, height, value_fmt)

    ml, mr, mt, mb = 60, 20, 40, 60
    cw = width - ml - mr
    ch = height - mt - mb

    all_vals = [v for vals in series.values() for v in vals]
    y_max = max(all_vals) if all_vals else 1
    y_max_plot = y_max * 1.15 or 1
    if y_max_cap is not None:
        y_max_plot = min(y_max_plot, y_max_cap) or y_max_cap

    n_groups = len(labels)
    n_series = len(series)
    group_width = cw / n_groups
    bar_width = group_width * 0.7 / max(n_series, 1)
    gap = group_width * 0.15

    def sy(v):
        return mt + ch - (v / y_max_plot) * ch

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    # Grid lines
    for i in range(6):
        y_tick = y_max_plot * i / 5
        py = sy(y_tick)
        svg.append(
            f'<line x1="{ml}" y1="{py:.1f}" x2="{ml + cw}" y2="{py:.1f}" '
            f'stroke="#e0f2fe" stroke-width="1"/>'
        )
        svg.append(
            f'<text x="{ml - 8}" y="{py + 4:.1f}" text-anchor="end" '
            f'font-size="11" fill="#6c757d">{y_tick:{value_fmt}}</text>'
        )

    # Axes
    svg.append(
        f'<line x1="{ml}" y1="{mt}" x2="{ml}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )
    svg.append(
        f'<line x1="{ml}" y1="{mt + ch}" x2="{ml + cw}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )

    # Bars
    for gi, label in enumerate(labels):
        gx = ml + gi * group_width + gap
        for si, (name, vals) in enumerate(series.items()):
            color = colors[si % len(colors)]
            bx = gx + si * bar_width
            val = vals[gi]
            by = sy(val)
            bh = mt + ch - by
            svg.append(
                f'<rect x="{bx:.1f}" y="{by:.1f}" width="{bar_width - 1:.1f}" '
                f'height="{bh:.1f}" fill="{color}" rx="2"/>'
            )
            svg.append(
                f'<text x="{bx + bar_width / 2:.1f}" y="{by - 4:.1f}" '
                f'text-anchor="middle" font-size="9" fill="#1a1a2e">'
                f'{val:{value_fmt}}</text>'
            )
        # Truncate long labels
        disp_label = label if len(label) <= 12 else label[:10] + ".."
        svg.append(
            f'<text x="{gx + n_series * bar_width / 2:.1f}" y="{mt + ch + 16}" '
            f'text-anchor="middle" font-size="10" fill="#6c757d" '
            f'transform="rotate(-35, {gx + n_series * bar_width / 2:.1f}, {mt + ch + 16})">'
            f'{disp_label}</text>'
        )

    # Title
    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    # Legend
    if n_series > 1:
        lx = ml + cw - len(series) * 100
        for si, name in enumerate(series):
            color = colors[si % len(colors)]
            svg.append(
                f'<rect x="{lx + si * 100}" y="{mt + ch + 40}" width="12" '
                f'height="12" rx="2" fill="{color}"/>'
            )
            svg.append(
                f'<text x="{lx + si * 100 + 16}" y="{mt + ch + 51}" font-size="11" '
                f'fill="#1a1a2e">{name}</text>'
            )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_horizontal_bar_chart(
    labels: list[str],
    series: dict[str, list[float]],
    title: str = "",
    colors: list[str] | None = None,
    width: int = 700,
    height: int = 400,
    value_fmt: str = ".1f",
) -> str:
    """Generate an SVG horizontal bar chart (sorted)."""
    default_colors = ["#0891b2", "#0e4f6e", "#06d6a0"]
    colors = colors or default_colors

    n = len(labels)
    row_height = max(22, min(35, (height - 80) // max(n, 1)))
    actual_height = max(height, 80 + n * row_height)
    ml, mr, mt, mb = 120, 60, 40, 20
    cw = width - ml - mr
    ch = actual_height - mt - mb

    # Use first series
    first_key = list(series.keys())[0]
    vals = series[first_key]
    x_max = max(vals) * 1.15 if vals else 1

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {actual_height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{actual_height}" fill="#fff" rx="6"/>',
    ]

    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    bar_h = row_height * 0.65
    for i, (label, val) in enumerate(zip(labels, vals)):
        y = mt + i * row_height
        bw = (val / x_max) * cw if x_max else 0
        color = colors[i % len(colors)]
        # Label
        disp = label if len(label) <= 14 else label[:12] + ".."
        svg.append(
            f'<text x="{ml - 8}" y="{y + bar_h / 2 + 4:.1f}" text-anchor="end" '
            f'font-size="11" fill="#1a1a2e">{disp}</text>'
        )
        # Bar
        svg.append(
            f'<rect x="{ml}" y="{y:.1f}" width="{bw:.1f}" height="{bar_h:.1f}" '
            f'fill="{color}" rx="3"/>'
        )
        # Value
        svg.append(
            f'<text x="{ml + bw + 6:.1f}" y="{y + bar_h / 2 + 4:.1f}" '
            f'font-size="11" fill="#0e4f6e" font-weight="600">{val:{value_fmt}}</text>'
        )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_heatmap(
    matrix: list[list[float]],
    row_labels: list[str],
    col_labels: list[str],
    title: str = "",
    color_scale: str = "cyan",
    width: int = 700,
    height: int = 500,
    value_fmt: str = ".2f",
) -> str:
    """Generate an SVG heatmap.

    Args:
        matrix: 2D list of values (rows x cols).
        row_labels: Labels for rows.
        col_labels: Labels for columns.
        title: Chart title.
        color_scale: Color scheme ("cyan", "red", "green").
        width/height: SVG dimensions.
        value_fmt: Format string for cell values.

    Returns:
        SVG string.
    """
    if not matrix or not matrix[0]:
        return ""

    n_rows = len(matrix)
    n_cols = len(matrix[0])

    ml, mr, mt, mb = 110, 20, 70, 20
    cw = width - ml - mr
    ch = height - mt - mb
    cell_w = cw / n_cols
    cell_h = ch / n_rows

    # Flatten to find range
    flat = [v for row in matrix for v in row]
    v_min = min(flat)
    v_max = max(flat)
    v_range = v_max - v_min or 1

    def color_for(v):
        t = (v - v_min) / v_range
        if color_scale == "cyan":
            # White to deep teal
            r = int(255 - t * (255 - 14))
            g = int(255 - t * (255 - 79))
            b = int(255 - t * (255 - 110))
        elif color_scale == "red":
            r = int(255 - t * 50)
            g = int(255 - t * 200)
            b = int(255 - t * 200)
        else:  # green
            r = int(255 - t * 200)
            g = int(255 - t * 50)
            b = int(255 - t * 200)
        return f"rgb({r},{g},{b})"

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    # Column labels (rotated)
    for ci, label in enumerate(col_labels):
        x = ml + ci * cell_w + cell_w / 2
        disp = label if len(label) <= 12 else label[:10] + ".."
        svg.append(
            f'<text x="{x:.1f}" y="{mt - 8}" text-anchor="end" font-size="10" '
            f'fill="#1a1a2e" transform="rotate(-45, {x:.1f}, {mt - 8})">{disp}</text>'
        )

    # Row labels + cells
    for ri, (row_label, row_vals) in enumerate(zip(row_labels, matrix)):
        y = mt + ri * cell_h
        disp = row_label if len(row_label) <= 14 else row_label[:12] + ".."
        svg.append(
            f'<text x="{ml - 8}" y="{y + cell_h / 2 + 4:.1f}" text-anchor="end" '
            f'font-size="10" fill="#1a1a2e">{disp}</text>'
        )
        for ci, val in enumerate(row_vals):
            x = ml + ci * cell_w
            fill = color_for(val)
            svg.append(
                f'<rect x="{x:.1f}" y="{y:.1f}" width="{cell_w:.1f}" '
                f'height="{cell_h:.1f}" fill="{fill}" stroke="#fff" stroke-width="1"/>'
            )
            # Text color: dark on light, light on dark
            t = (val - v_min) / v_range
            txt_color = "#fff" if t > 0.55 else "#1a1a2e"
            # Only show text if cells are large enough
            if cell_w > 30 and cell_h > 18:
                svg.append(
                    f'<text x="{x + cell_w / 2:.1f}" y="{y + cell_h / 2 + 4:.1f}" '
                    f'text-anchor="middle" font-size="9" fill="{txt_color}">'
                    f'{val:{value_fmt}}</text>'
                )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_scatter_plot(
    points: list[dict],
    x_label: str = "MW",
    y_label: str = "LogP",
    title: str = "",
    reference_lines: list[dict] | None = None,
    width: int = 700,
    height: int = 400,
) -> str:
    """Generate an SVG scatter plot.

    Args:
        points: List of dicts with "x", "y", "label" keys.
        x_label/y_label: Axis labels.
        title: Chart title.
        reference_lines: List of dicts with "axis" ("x"/"y"), "value", "label".
        width/height: SVG dimensions.

    Returns:
        SVG string.
    """
    if not points:
        return ""

    ml, mr, mt, mb = 60, 30, 40, 50
    cw = width - ml - mr
    ch = height - mt - mb

    x_vals = [p["x"] for p in points]
    y_vals = [p["y"] for p in points]
    x_min, x_max = min(x_vals) * 0.9, max(x_vals) * 1.1
    y_min, y_max = min(y_vals) - 1, max(y_vals) + 1

    # Extend ranges to include reference lines
    if reference_lines:
        for rl in reference_lines:
            if rl["axis"] == "x":
                x_max = max(x_max, rl["value"] * 1.1)
            else:
                y_max = max(y_max, rl["value"] * 1.1)

    x_range = x_max - x_min or 1
    y_range = y_max - y_min or 1

    def sx(v):
        return ml + (v - x_min) / x_range * cw

    def sy(v):
        return mt + ch - (v - y_min) / y_range * ch

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    # Grid
    for i in range(6):
        y_tick = y_min + y_range * i / 5
        py = sy(y_tick)
        svg.append(
            f'<line x1="{ml}" y1="{py:.1f}" x2="{ml + cw}" y2="{py:.1f}" '
            f'stroke="#e0f2fe" stroke-width="1"/>'
        )
        svg.append(
            f'<text x="{ml - 8}" y="{py + 4:.1f}" text-anchor="end" '
            f'font-size="11" fill="#6c757d">{y_tick:.1f}</text>'
        )

    for i in range(6):
        x_tick = x_min + x_range * i / 5
        px = sx(x_tick)
        svg.append(
            f'<text x="{px:.1f}" y="{mt + ch + 20}" text-anchor="middle" '
            f'font-size="11" fill="#6c757d">{x_tick:.0f}</text>'
        )

    # Axes
    svg.append(
        f'<line x1="{ml}" y1="{mt}" x2="{ml}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )
    svg.append(
        f'<line x1="{ml}" y1="{mt + ch}" x2="{ml + cw}" y2="{mt + ch}" '
        f'stroke="#94a3b8" stroke-width="1.5"/>'
    )

    # Reference lines (Lipinski boundaries)
    if reference_lines:
        for rl in reference_lines:
            if rl["axis"] == "x":
                px = sx(rl["value"])
                svg.append(
                    f'<line x1="{px:.1f}" y1="{mt}" x2="{px:.1f}" y2="{mt + ch}" '
                    f'stroke="#ef4444" stroke-width="1.5" stroke-dasharray="6,4"/>'
                )
                svg.append(
                    f'<text x="{px + 4:.1f}" y="{mt + 14}" font-size="10" '
                    f'fill="#ef4444" font-weight="600">{rl["label"]}</text>'
                )
            else:
                py = sy(rl["value"])
                svg.append(
                    f'<line x1="{ml}" y1="{py:.1f}" x2="{ml + cw}" y2="{py:.1f}" '
                    f'stroke="#ef4444" stroke-width="1.5" stroke-dasharray="6,4"/>'
                )
                svg.append(
                    f'<text x="{ml + cw - 4:.1f}" y="{py - 6:.1f}" text-anchor="end" '
                    f'font-size="10" fill="#ef4444" font-weight="600">{rl["label"]}</text>'
                )

    # Drug-like zone shading (MW<=500 and LogP<=5 quadrant)
    if reference_lines:
        mw_line = next((rl for rl in reference_lines if rl["axis"] == "x"), None)
        logp_line = next((rl for rl in reference_lines if rl["axis"] == "y"), None)
        if mw_line and logp_line:
            zx1 = sx(x_min)
            zx2 = sx(min(mw_line["value"], x_max))
            zy1 = sy(min(logp_line["value"], y_max))
            zy2 = sy(y_min)
            svg.append(
                f'<rect x="{zx1:.1f}" y="{zy1:.1f}" '
                f'width="{zx2 - zx1:.1f}" height="{zy2 - zy1:.1f}" '
                f'fill="#0891b2" opacity="0.06" rx="4"/>'
            )
            svg.append(
                f'<text x="{zx1 + 8:.1f}" y="{zy2 - 8:.1f}" font-size="11" '
                f'fill="#0891b2" font-weight="600" opacity="0.6">Drug-like Zone</text>'
            )

    # Points
    point_colors = ["#0891b2", "#0e4f6e", "#06d6a0", "#155e75", "#0284c7",
                    "#059669", "#0d9488", "#0369a1", "#047857", "#115e59",
                    "#0c4a6e", "#064e3b", "#1e3a5f", "#134e4a", "#075985"]
    for i, pt in enumerate(points):
        px, py = sx(pt["x"]), sy(pt["y"])
        color = point_colors[i % len(point_colors)]
        svg.append(
            f'<circle cx="{px:.1f}" cy="{py:.1f}" r="5" fill="{color}" '
            f'stroke="#fff" stroke-width="1.5" opacity="0.85"/>'
        )
        # Label offset to avoid overlap
        offset_x = 8
        offset_y = -8 if i % 2 == 0 else 14
        label = pt["label"] if len(pt["label"]) <= 12 else pt["label"][:10] + ".."
        svg.append(
            f'<text x="{px + offset_x:.1f}" y="{py + offset_y:.1f}" '
            f'font-size="9" fill="#1a1a2e">{label}</text>'
        )

    # Title
    if title:
        svg.append(
            f'<text x="{width / 2}" y="22" text-anchor="middle" '
            f'font-size="14" font-weight="600" fill="#0e4f6e">{title}</text>'
        )

    # Axis labels
    if x_label:
        svg.append(
            f'<text x="{ml + cw / 2}" y="{height - 6}" text-anchor="middle" '
            f'font-size="12" fill="#6c757d">{x_label}</text>'
        )
    if y_label:
        svg.append(
            f'<text x="14" y="{mt + ch / 2}" text-anchor="middle" '
            f'font-size="12" fill="#6c757d" '
            f'transform="rotate(-90, 14, {mt + ch / 2})">{y_label}</text>'
        )

    svg.append("</svg>")
    return "\n".join(svg)

def _make_funnel(
    stages: list[dict],
    title: str = "",
    width: int = 600,
    height: int = 400,
) -> str:
    """Generate an SVG funnel visualization.

    Args:
        stages: List of dicts with "label", "count", "total" keys.
        title: Chart title.
        width/height: SVG dimensions.

    Returns:
        SVG string.
    """
    if not stages:
        return ""

    n = len(stages)
    mt = 50
    mb = 20
    available_h = height - mt - mb
    stage_h = available_h / n
    cx = width / 2

    # Color gradient from light cyan to deep teal
    colors = []
    for i in range(n):
        t = i / max(n - 1, 1)
        r = int(207 - t * (207 - 14))
        g = int(250 - t * (250 - 79))
        b = int(254 - t * (254 - 110))
        colors.append(f"rgb({r},{g},{b})")

    svg = [
        f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {width} {height}" '
        f'style="width:100%;max-width:{width}px;height:auto;">',
        f'<rect width="{width}" height="{height}" fill="#fff" rx="6"/>',
    ]

    if title:
        svg.append(
            f'<text x="{cx}" y="28" text-anchor="middle" '
            f'font-size="16" font-weight="700" fill="#0e4f6e">{title}</text>'
        )

    max_count = stages[0]["count"] if stages else 1
    max_width = width * 0.75

    for i, stage in enumerate(stages):
        y_top = mt + i * stage_h
        y_bot = y_top + stage_h

        # Width proportional to count
        w_top = max_width * (stage["count"] / max_count) if i == 0 else prev_w_bot
        if i < n - 1:
            w_bot = max_width * (stages[i + 1]["count"] / max_count)
        else:
            w_bot = max_width * (stage["count"] / max_count) * 0.7

        prev_w_bot = w_bot

        # Trapezoid
        x1_top = cx - w_top / 2
        x2_top = cx + w_top / 2
        x1_bot = cx - w_bot / 2
        x2_bot = cx + w_bot / 2

        svg.append(
            f'<polygon points="{x1_top:.1f},{y_top:.1f} {x2_top:.1f},{y_top:.1f} '
            f'{x2_bot:.1f},{y_bot:.1f} {x1_bot:.1f},{y_bot:.1f}" '
            f'fill="{colors[i]}" stroke="#fff" stroke-width="2"/>'
        )

        # Text: dark on light, white on dark
        t = i / max(n - 1, 1)
        txt_color = "#0e4f6e" if t < 0.5 else "#fff"
        y_mid = (y_top + y_bot) / 2

        svg.append(
            f'<text x="{cx}" y="{y_mid - 4:.1f}" text-anchor="middle" '
            f'font-size="13" font-weight="600" fill="{txt_color}">{stage["label"]}</text>'
        )
        svg.append(
            f'<text x="{cx}" y="{y_mid + 14:.1f}" text-anchor="middle" '
            f'font-size="12" fill="{txt_color}" opacity="0.85">'
            f'{stage["count"]} / {stage["total"]}</text>'
        )

    svg.append("</svg>")
    return "\n".join(svg)

# ------------------------------------------------------------------
# Task 1: Load and validate molecules
# ------------------------------------------------------------------

@tool
@env.task(cache="auto")
async def load_molecules(
    molecules_json: str = "",
) -> flyte.io.Dir:
    """Parse SMILES strings, validate with RDKit, generate 2D depictions.

    Args:
        molecules_json: JSON string mapping molecule names to SMILES.
            Defaults to a curated library of ~15 well-known drugs.

    Returns:
        flyte.io.Dir containing molecule data (JSON + PNG depictions).
        Pass this directory to compute_properties and generate_report.
    """
    from rdkit import Chem
    from rdkit.Chem import Draw

    if molecules_json.strip():
        molecules = json.loads(molecules_json)
    else:
        molecules = DEFAULT_MOLECULES

    out_dir = tempfile.mkdtemp(prefix="mol_library_")
    results = []
    valid_count = 0
    invalid_count = 0

    log.info(f"Parsing {len(molecules)} molecules...")

    for name, smiles in molecules.items():
        mol = Chem.MolFromSmiles(smiles)
        if mol is None:
            log.warning(f"  [INVALID] {name}: {smiles}")
            invalid_count += 1
            continue

        valid_count += 1

        # Generate 2D depiction as PNG
        img = Draw.MolToImage(mol, size=(300, 300))
        img_path = os.path.join(out_dir, f"{name.replace(' ', '_')}.png")
        img.save(img_path)

        results.append({
            "name": name,
            "smiles": smiles,
            "valid": True,
            "image_file": os.path.basename(img_path),
        })

    # Save molecule manifest
    manifest = {
        "total": len(molecules),
        "valid": valid_count,
        "invalid": invalid_count,
        "molecules": results,
    }
    manifest_path = os.path.join(out_dir, "manifest.json")
    with open(manifest_path, "w") as f:
        json.dump(manifest, f, indent=2)

    log.info(f"Loaded {valid_count} valid molecules ({invalid_count} invalid)")

    return await flyte.io.Dir.from_local(out_dir)

# ------------------------------------------------------------------
# Task 2: Compute physicochemical properties
# ------------------------------------------------------------------

@tool
@env.task(report=True)
async def compute_properties(
    molecule_dir: flyte.io.Dir,
) -> str:
    """Compute drug-likeness properties for all molecules.

    Computes MW, LogP, HBD, HBA, TPSA, rotatable bonds, formal charge,
    ring count, QED, and Lipinski Rule of Five compliance.

    Args:
        molecule_dir: Directory from load_molecules.

    Returns:
        JSON string with all computed properties. Pass to screen_candidates
        and generate_report.
    """
    from rdkit import Chem
    from rdkit.Chem import Descriptors, Lipinski
    from rdkit.Chem.QED import qed

    # --- Loading report ---
    await flyte.report.replace.aio(
        _wrap_report("<h2>Computing Molecular Properties...</h2>"
                      "<p>Analyzing physicochemical descriptors for all molecules.</p>"),
        do_flush=True,
    )

    mol_dir = await molecule_dir.download()
    with open(os.path.join(mol_dir, "manifest.json")) as f:
        manifest = json.load(f)

    molecules_data = []
    lipinski_pass = 0

    for mol_info in manifest["molecules"]:
        mol = Chem.MolFromSmiles(mol_info["smiles"])
        if mol is None:
            continue

        mw = Descriptors.MolWt(mol)
        logp = Descriptors.MolLogP(mol)
        hbd = Lipinski.NumHDonors(mol)
        hba = Lipinski.NumHAcceptors(mol)
        tpsa = Descriptors.TPSA(mol)
        rotatable = Lipinski.NumRotatableBonds(mol)
        formal_charge = Chem.GetFormalCharge(mol)
        num_rings = Lipinski.RingCount(mol)
        qed_score = qed(mol)

        # Lipinski Rule of Five
        lipinski = {
            "mw_ok": mw <= 500,
            "logp_ok": logp <= 5,
            "hbd_ok": hbd <= 5,
            "hba_ok": hba <= 10,
        }
        lipinski_all = all(lipinski.values())
        if lipinski_all:
            lipinski_pass += 1

        # Read image for data URI
        img_path = os.path.join(mol_dir, mol_info["image_file"])
        data_uri = ""
        if os.path.exists(img_path):
            with open(img_path, "rb") as img_f:
                b64 = base64.b64encode(img_f.read()).decode()
                data_uri = f"data:image/png;base64,{b64}"

        molecules_data.append({
            "name": mol_info["name"],
            "smiles": mol_info["smiles"],
            "mw": round(mw, 2),
            "logp": round(logp, 2),
            "hbd": hbd,
            "hba": hba,
            "tpsa": round(tpsa, 2),
            "rotatable_bonds": rotatable,
            "formal_charge": formal_charge,
            "num_rings": num_rings,
            "qed": round(qed_score, 4),
            "lipinski": lipinski,
            "lipinski_pass": lipinski_all,
            "image_data_uri": data_uri,
        })

    total = len(molecules_data)
    avg_mw = sum(m["mw"] for m in molecules_data) / total if total else 0
    avg_logp = sum(m["logp"] for m in molecules_data) / total if total else 0
    lipinski_rate = lipinski_pass / total * 100 if total else 0

    # ---- Build report ----
    html_parts = []

    # Header
    html_parts.append("<h2>Molecular Properties Analysis</h2>")

    # Stat grid
    html_parts.append('<div class="stat-grid">')
    for val, label in [
        (str(total), "Total Molecules"),
        (f"{lipinski_rate:.0f}%", "Lipinski Pass Rate"),
        (f"{avg_mw:.1f}", "Avg. MW (Da)"),
        (f"{avg_logp:.2f}", "Avg. LogP"),
    ]:
        html_parts.append(
            f'<div class="stat"><div class="value">{val}</div>'
            f'<div class="label">{label}</div></div>'
        )
    html_parts.append("</div>")

    # Molecule gallery
    html_parts.append("<h3>Molecule Library</h3>")
    html_parts.append('<div class="molecule-grid">')
    for m in molecules_data:
        if m["image_data_uri"]:
            badge_class = "badge-success" if m["lipinski_pass"] else "badge-danger"
            badge_text = "Lipinski Pass" if m["lipinski_pass"] else "Lipinski Fail"
            html_parts.append(
                f'<div class="molecule-card" style="text-align:center;">'
                f'<img src="{m["image_data_uri"]}" style="width:160px;height:160px;object-fit:contain;"/>'
                f'<div style="font-weight:600;margin-top:6px;color:#0e4f6e;">{m["name"]}</div>'
                f'<div style="font-size:0.8em;color:#6c757d;">MW: {m["mw"]:.1f} | LogP: {m["logp"]:.2f}</div>'
                f'<div><span class="badge {badge_class}">{badge_text}</span></div>'
                f'</div>'
            )
    html_parts.append("</div>")

    # MW bar chart (horizontal, sorted)
    sorted_by_mw = sorted(molecules_data, key=lambda m: m["mw"], reverse=True)
    mw_labels = [m["name"] for m in sorted_by_mw]
    mw_vals = [m["mw"] for m in sorted_by_mw]
    mw_chart = _make_bar_chart(
        mw_labels, {"MW (Da)": mw_vals},
        title="Molecular Weight Distribution",
        horizontal=True,
        width=700, height=max(300, len(mw_labels) * 30 + 80),
        value_fmt=".1f",
    )
    html_parts.append("<h3>Molecular Weight</h3>")
    html_parts.append(f'<div class="chart-container">{mw_chart}</div>')

    # LogP vs MW scatter plot
    scatter_points = [
        {"x": m["mw"], "y": m["logp"], "label": m["name"]}
        for m in molecules_data
    ]
    scatter_chart = _make_scatter_plot(
        scatter_points,
        x_label="Molecular Weight (Da)",
        y_label="LogP",
        title="LogP vs. Molecular Weight (Lipinski Boundaries)",
        reference_lines=[
            {"axis": "x", "value": 500, "label": "MW = 500"},
            {"axis": "y", "value": 5, "label": "LogP = 5"},
        ],
        width=700,
        height=420,
    )
    html_parts.append("<h3>Lipinski Space</h3>")
    html_parts.append(f'<div class="chart-container">{scatter_chart}</div>')

    # Property heatmap (molecules x properties)
    prop_names = ["MW", "LogP", "HBD", "HBA", "TPSA", "Rot. Bonds"]
    # Normalize each property to 0-1 for heatmap
    raw_matrix = []
    for m in molecules_data:
        raw_matrix.append([m["mw"], m["logp"], m["hbd"], m["hba"], m["tpsa"], m["rotatable_bonds"]])

    # Normalize per column
    n_props = len(prop_names)
    col_min = [min(row[c] for row in raw_matrix) for c in range(n_props)]
    col_max = [max(row[c] for row in raw_matrix) for c in range(n_props)]
    norm_matrix = []
    for row in raw_matrix:
        norm_row = []
        for c in range(n_props):
            rng = col_max[c] - col_min[c]
            norm_row.append((row[c] - col_min[c]) / rng if rng else 0.5)
        norm_matrix.append(norm_row)

    heatmap_labels = [m["name"] for m in molecules_data]
    heatmap = _make_heatmap(
        norm_matrix, heatmap_labels, prop_names,
        title="Normalized Property Heatmap",
        color_scale="cyan",
        width=700,
        height=max(400, len(heatmap_labels) * 28 + 100),
    )
    html_parts.append("<h3>Property Heatmap</h3>")
    html_parts.append(f'<div class="chart-container">{heatmap}</div>')

    # Lipinski compliance table
    html_parts.append("<h3>Lipinski Rule of Five Compliance</h3>")
    html_parts.append("<table><tr><th>Molecule</th><th>MW &le; 500</th>"
                      "<th>LogP &le; 5</th><th>HBD &le; 5</th>"
                      "<th>HBA &le; 10</th><th>Overall</th></tr>")
    for m in molecules_data:
        lip = m["lipinski"]

        def _badge(ok):
            if ok:
                return '<span class="badge badge-success">Pass</span>'
            return '<span class="badge badge-danger">Fail</span>'

        overall_badge = _badge(m["lipinski_pass"])
        html_parts.append(
            f'<tr><td><strong>{m["name"]}</strong></td>'
            f'<td>{_badge(lip["mw_ok"])}</td>'
            f'<td>{_badge(lip["logp_ok"])}</td>'
            f'<td>{_badge(lip["hbd_ok"])}</td>'
            f'<td>{_badge(lip["hba_ok"])}</td>'
            f'<td>{overall_badge}</td></tr>'
        )
    html_parts.append("</table>")

    # QED bar chart
    sorted_by_qed = sorted(molecules_data, key=lambda m: m["qed"], reverse=True)
    qed_labels = [m["name"] for m in sorted_by_qed]
    qed_vals = [m["qed"] for m in sorted_by_qed]
    qed_chart = _make_bar_chart(
        qed_labels, {"QED Score": qed_vals},
        title="Drug-likeness (QED Score)",
        horizontal=True,
        width=700, height=max(300, len(qed_labels) * 30 + 80),
        value_fmt=".3f",
        colors=["#06d6a0"],
    )
    html_parts.append("<h3>Drug-likeness (QED)</h3>")
    html_parts.append(f'<div class="chart-container">{qed_chart}</div>')

    # Flush full report
    await flyte.report.replace.aio(
        _wrap_report("\n".join(html_parts)),
        do_flush=True,
    )

    # Return properties as JSON (strip image data URIs to reduce size)
    output = {
        "total": total,
        "lipinski_pass_count": lipinski_pass,
        "lipinski_pass_rate": round(lipinski_rate, 2),
        "avg_mw": round(avg_mw, 2),
        "avg_logp": round(avg_logp, 2),
        "molecules": [
            {k: v for k, v in m.items() if k != "image_data_uri"}
            for m in molecules_data
        ],
    }
    return json.dumps(output)

# ------------------------------------------------------------------
# Task 3: Screen candidates against target profile
# ------------------------------------------------------------------

@tool
@env.task(report=True)
async def screen_candidates(
    properties_json: str,
    target_profile: str = "",
) -> str:
    """Screen molecules against a target drug profile and rank candidates.

    Scores each molecule on how well it matches the target profile, computes
    pairwise Tanimoto similarity, and produces a ranked list.

    Args:
        properties_json: JSON from compute_properties.
        target_profile: JSON string with desired property ranges
            (e.g. {"mw": [150, 500], "logp": [-0.5, 5.0]}).

    Returns:
        JSON string with ranked_molecules, similarity_matrix, similarity_labels,
        funnel, and target_profile. Pass the full return value verbatim to
        generate_report along with molecule_dir and properties_json.
    """
    from rdkit import Chem, DataStructs
    from rdkit.Chem import AllChem

    await flyte.report.replace.aio(
        _wrap_report("<h2>Screening Candidates...</h2>"
                      "<p>Evaluating molecules against the target drug profile.</p>"),
        do_flush=True,
    )

    props = json.loads(properties_json)
    molecules = props["molecules"]

    # Default target profile
    if target_profile.strip():
        profile = json.loads(target_profile)
    else:
        profile = {
            "mw": [150, 500],
            "logp": [-0.5, 5.0],
            "hbd": [0, 5],
            "hba": [0, 10],
            "tpsa": [20, 140],
        }

    # --- Screening ---
    funnel_total = len(molecules)
    pass_mw = 0
    pass_logp = 0
    pass_lipinski = 0
    final_candidates = 0

    scored = []
    for m in molecules:
        score = 0
        max_score = 0
        criteria = {}

        # Check each profile criterion
        checks = [
            ("mw", m["mw"]),
            ("logp", m["logp"]),
            ("hbd", m["hbd"]),
            ("hba", m["hba"]),
            ("tpsa", m["tpsa"]),
        ]

        for key, val in checks:
            if key in profile:
                lo, hi = profile[key]
                max_score += 1
                in_range = lo <= val <= hi
                criteria[key] = in_range
                if in_range:
                    score += 1
                    # Bonus: closer to midpoint = higher score
                    mid = (lo + hi) / 2
                    rng = (hi - lo) / 2
                    dist = abs(val - mid) / rng if rng else 0
                    score += max(0, 0.5 * (1 - dist))

        # QED bonus
        score += m["qed"] * 2
        max_score += 2

        # Lipinski bonus
        if m["lipinski_pass"]:
            score += 1
        max_score += 1

        normalized_score = score / max_score if max_score else 0

        # Funnel tracking — cascading filter (each stage requires passing the previous)
        mw_ok = criteria.get("mw", True)
        logp_ok = criteria.get("logp", True)
        if mw_ok:
            pass_mw += 1
            if logp_ok:
                pass_logp += 1
                if m["lipinski_pass"]:
                    pass_lipinski += 1
                    if all(criteria.values()):
                        final_candidates += 1

        scored.append({
            **m,
            "screening_score": round(normalized_score, 4),
            "criteria_met": criteria,
            "all_criteria_met": all(criteria.values()),
        })

    # Sort by score descending
    scored.sort(key=lambda m: m["screening_score"], reverse=True)

    # --- Tanimoto similarity matrix ---
    fps = []
    valid_names = []
    for m in scored:
        mol = Chem.MolFromSmiles(m["smiles"])
        if mol:
            fp = AllChem.GetMorganFingerprintAsBitVect(mol, 2, nBits=2048)
            fps.append(fp)
            valid_names.append(m["name"])

    similarity_matrix = []
    for i in range(len(fps)):
        row = []
        for j in range(len(fps)):
            sim = DataStructs.TanimotoSimilarity(fps[i], fps[j])
            row.append(round(sim, 3))
        similarity_matrix.append(row)

    # ---- Build report ----
    html_parts = []
    html_parts.append("<h2>Candidate Screening Results</h2>")

    # Stat grid
    html_parts.append('<div class="stat-grid">')
    for val, label in [
        (str(funnel_total), "Total Screened"),
        (str(pass_lipinski), "Lipinski Passes"),
        (str(final_candidates), "All Criteria Met"),
        (f"{scored[0]['screening_score']:.3f}" if scored else "N/A", "Top Score"),
    ]:
        html_parts.append(
            f'<div class="stat"><div class="value">{val}</div>'
            f'<div class="label">{label}</div></div>'
        )
    html_parts.append("</div>")

    # Screening funnel
    funnel_stages = [
        {"label": "Total Molecules", "count": funnel_total, "total": funnel_total},
        {"label": "Pass MW Filter", "count": pass_mw, "total": funnel_total},
        {"label": "Pass LogP Filter", "count": pass_logp, "total": funnel_total},
        {"label": "Lipinski Compliant", "count": pass_lipinski, "total": funnel_total},
        {"label": "All Criteria Met", "count": final_candidates, "total": funnel_total},
    ]
    funnel_svg = _make_funnel(
        funnel_stages,
        title="Screening Funnel",
        width=600,
        height=380,
    )
    html_parts.append("<h3>Screening Funnel</h3>")
    html_parts.append(f'<div class="chart-container" style="text-align:center;">{funnel_svg}</div>')

    # Ranked candidates table
    html_parts.append("<h3>Ranked Candidates</h3>")
    html_parts.append(
        "<table><tr><th>Rank</th><th>Molecule</th><th>Score</th>"
        "<th>MW</th><th>LogP</th><th>QED</th><th>Lipinski</th><th>All Criteria</th></tr>"
    )
    for rank, m in enumerate(scored, 1):
        lip_badge = ('<span class="badge badge-success">Pass</span>'
                     if m["lipinski_pass"]
                     else '<span class="badge badge-danger">Fail</span>')
        crit_badge = ('<span class="badge badge-success">Pass</span>'
                      if m["all_criteria_met"]
                      else '<span class="badge badge-danger">Fail</span>')
        # Highlight top 3
        row_style = ' style="background:#ecfeff;font-weight:600;"' if rank <= 3 else ""
        html_parts.append(
            f"<tr{row_style}><td>{rank}</td><td>{m['name']}</td>"
            f"<td>{m['screening_score']:.3f}</td>"
            f"<td>{m['mw']:.1f}</td><td>{m['logp']:.2f}</td>"
            f"<td>{m['qed']:.3f}</td><td>{lip_badge}</td><td>{crit_badge}</td></tr>"
        )
    html_parts.append("</table>")

    # Top 5 candidate cards with structures
    html_parts.append("<h3>Top 5 Candidates</h3>")
    html_parts.append('<div class="molecule-grid">')
    for m in scored[:5]:
        mol = Chem.MolFromSmiles(m["smiles"])
        img_uri = _mol_to_data_uri(mol, size=(250, 250)) if mol else ""
        badge_class = "badge-success" if m["all_criteria_met"] else "badge-info"
        badge_text = "All Criteria Met" if m["all_criteria_met"] else "Partial Match"
        html_parts.append(
            f'<div class="molecule-card" style="text-align:center;">'
            f'<img src="{img_uri}" style="width:140px;height:140px;object-fit:contain;"/>'
            f'<div style="font-weight:700;margin-top:6px;color:#0e4f6e;font-size:1.05em;">{m["name"]}</div>'
            f'<div style="font-size:0.85em;color:#155e75;margin:4px 0;">Score: {m["screening_score"]:.3f}</div>'
            f'<div style="font-size:0.8em;color:#6c757d;">MW: {m["mw"]:.1f} | LogP: {m["logp"]:.2f} | QED: {m["qed"]:.3f}</div>'
            f'<div style="margin-top:4px;"><span class="badge {badge_class}">{badge_text}</span></div>'
            f'</div>'
        )
    html_parts.append("</div>")

    # Tanimoto similarity heatmap
    if similarity_matrix:
        sim_heatmap = _make_heatmap(
            similarity_matrix, valid_names, valid_names,
            title="Pairwise Tanimoto Similarity (Morgan Fingerprints)",
            color_scale="cyan",
            width=700,
            height=max(500, len(valid_names) * 32 + 100),
        )
        html_parts.append("<h3>Chemical Similarity</h3>")
        html_parts.append(f'<div class="chart-container">{sim_heatmap}</div>')

    await flyte.report.replace.aio(
        _wrap_report("\n".join(html_parts)),
        do_flush=True,
    )

    output = {
        "ranked_molecules": scored,
        "similarity_matrix": similarity_matrix,
        "similarity_labels": valid_names,
        "funnel": funnel_stages,
        "target_profile": profile,
    }
    return json.dumps(output)

def _parse_screening_json(screening_json: str) -> dict:
    """Parse screening JSON from screen_candidates, with safe defaults.

    The agent must pass the exact tool return value. Partial or hand-built JSON
    is tolerated for optional similarity fields only.
    """
    screening = json.loads(screening_json)
    if "ranked_molecules" not in screening:
        raise ValueError(
            "screening_json must be the exact JSON string returned by "
            "screen_candidates (missing 'ranked_molecules'). Do not construct, "
            "truncate, or summarize tool output."
        )
    screening.setdefault("similarity_matrix", [])
    screening.setdefault("similarity_labels", [])
    return screening

# ------------------------------------------------------------------
# Task 4: Generate final comprehensive report
# ------------------------------------------------------------------

@tool
@env.task(report=True)
async def generate_report(
    molecule_dir: flyte.io.Dir,
    properties_json: str,
    screening_json: str,
) -> str:
    """Generate a comprehensive drug screening report.

    Produces an executive summary, top candidate spotlight cards, property
    distributions, chemical diversity analysis, and final recommendation.

    Args:
        molecule_dir: Directory from load_molecules.
        properties_json: JSON from compute_properties.
        screening_json: Exact verbatim JSON string returned by screen_candidates
            (must include ranked_molecules, similarity_matrix, similarity_labels).
            Do not construct or summarize this payload yourself.

    Returns:
        JSON summary with total_screened, lipinski_passes, all_criteria_met,
        top_candidate, top_score, and top_3 ranked molecules.
    """
    from rdkit import Chem

    await flyte.report.replace.aio(
        _wrap_report("<h2>Generating Final Report...</h2>"),
        do_flush=True,
    )

    props = json.loads(properties_json)
    screening = _parse_screening_json(screening_json)
    ranked = screening["ranked_molecules"]
    sim_matrix = screening["similarity_matrix"]
    sim_labels = screening["similarity_labels"]

    total = props["total"]
    lipinski_pass = props["lipinski_pass_count"]
    all_criteria = sum(1 for m in ranked if m["all_criteria_met"])
    top = ranked[0] if ranked else None

    html_parts = []

    # --- Executive Summary ---
    html_parts.append("<h2>Drug Molecule Screening Report</h2>")
    top_name = top["name"] if top else "N/A"
    top_score = f'{top["screening_score"]:.3f}' if top else "N/A"
    html_parts.append(
        f'<div class="card">'
        f'<h3 style="margin-top:0;color:#0e4f6e;">Executive Summary</h3>'
        f'<p style="font-size:1.05em;">'
        f'<strong>{total}</strong> molecules were screened against the target drug profile. '
        f'<strong>{lipinski_pass}</strong> passed Lipinski\'s Rule of Five, and '
        f'<strong>{all_criteria}</strong> met all screening criteria. '
        f'The top candidate is <strong style="color:#0891b2;">{top_name}</strong> '
        f'with a screening score of <strong>{top_score}</strong>.</p>'
        f'</div>'
    )

    # Stat grid
    html_parts.append('<div class="stat-grid">')
    for val, label in [
        (str(total), "Molecules Screened"),
        (str(lipinski_pass), "Lipinski Passes"),
        (str(all_criteria), "All Criteria Met"),
        (top_score, "Top Score"),
        (f'{props["avg_mw"]:.0f} Da', "Avg. Molecular Weight"),
        (f'{props["avg_logp"]:.2f}', "Avg. LogP"),
    ]:
        html_parts.append(
            f'<div class="stat"><div class="value">{val}</div>'
            f'<div class="label">{label}</div></div>'
        )
    html_parts.append("</div>")

    # --- Top 3 Candidate Spotlights ---
    html_parts.append("<h2>Top Candidate Spotlights</h2>")

    for rank, m in enumerate(ranked[:3], 1):
        mol = Chem.MolFromSmiles(m["smiles"])
        img_uri = _mol_to_data_uri(mol, size=(300, 300)) if mol else ""

        medal = ["gold", "silver", "#cd7f32"][rank - 1]
        medal_emoji = ["1st", "2nd", "3rd"][rank - 1]

        lip_badges = ""
        for rule, key in [("MW", "mw_ok"), ("LogP", "logp_ok"),
                          ("HBD", "hbd_ok"), ("HBA", "hba_ok")]:
            ok = m["lipinski"].get(key, False)
            cls = "badge-success" if ok else "badge-danger"
            lip_badges += f'<span class="badge {cls}" style="margin:2px;">{rule}</span> '

        html_parts.append(
            f'<div class="molecule-card" style="display:flex;gap:20px;align-items:flex-start;flex-wrap:wrap;">'
            f'<div style="text-align:center;min-width:180px;">'
            f'<div style="font-size:1.6em;font-weight:800;color:{medal};">{medal_emoji}</div>'
            f'<img src="{img_uri}" style="width:200px;height:200px;object-fit:contain;border-radius:8px;'
            f'border:2px solid #a5f3fc;"/>'
            f'<div style="font-weight:700;font-size:1.1em;color:#0e4f6e;margin-top:8px;">{m["name"]}</div>'
            f'</div>'
            f'<div style="flex:1;min-width:280px;">'
            f'<table style="margin:0;">'
            f'<tr><td><strong>SMILES</strong></td><td style="font-family:monospace;font-size:0.8em;word-break:break-all;">{m["smiles"]}</td></tr>'
            f'<tr><td><strong>Screening Score</strong></td><td style="font-weight:700;color:#0891b2;font-size:1.1em;">{m["screening_score"]:.3f}</td></tr>'
            f'<tr><td><strong>Molecular Weight</strong></td><td>{m["mw"]:.1f} Da</td></tr>'
            f'<tr><td><strong>LogP</strong></td><td>{m["logp"]:.2f}</td></tr>'
            f'<tr><td><strong>H-Bond Donors</strong></td><td>{m["hbd"]}</td></tr>'
            f'<tr><td><strong>H-Bond Acceptors</strong></td><td>{m["hba"]}</td></tr>'
            f'<tr><td><strong>TPSA</strong></td><td>{m["tpsa"]:.1f} A&sup2;</td></tr>'
            f'<tr><td><strong>Rotatable Bonds</strong></td><td>{m["rotatable_bonds"]}</td></tr>'
            f'<tr><td><strong>QED</strong></td><td>{m["qed"]:.4f}</td></tr>'
            f'<tr><td><strong>Lipinski Compliance</strong></td><td>{lip_badges}</td></tr>'
            f'</table>'
            f'</div>'
            f'</div>'
        )

    # --- Property Distribution (box-plot style as bars with min/max/median) ---
    html_parts.append("<h2>Property Distributions</h2>")

    prop_keys = [("mw", "Molecular Weight (Da)"), ("logp", "LogP"),
                 ("tpsa", "TPSA"), ("qed", "QED Score")]
    for key, label in prop_keys:
        vals = sorted([m[key] for m in ranked])
        n = len(vals)
        if n == 0:
            continue
        v_min = vals[0]
        v_max = vals[-1]
        median = vals[n // 2] if n % 2 == 1 else (vals[n // 2 - 1] + vals[n // 2]) / 2
        q1 = vals[n // 4] if n >= 4 else v_min
        q3 = vals[3 * n // 4] if n >= 4 else v_max

        # Simple horizontal box-plot as SVG
        box_w = 500
        box_h = 50
        margin_l = 10
        v_range = v_max - v_min or 1

        def sx(v):
            return margin_l + ((v - v_min) / v_range) * (box_w - 2 * margin_l)

        box_svg = (
            f'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 {box_w} {box_h}" '
            f'style="width:100%;max-width:{box_w}px;height:auto;">'
            f'<rect width="{box_w}" height="{box_h}" fill="#fff" rx="4"/>'
            # Whisker line
            f'<line x1="{sx(v_min):.1f}" y1="25" x2="{sx(v_max):.1f}" y2="25" '
            f'stroke="#94a3b8" stroke-width="1.5"/>'
            # Min whisker
            f'<line x1="{sx(v_min):.1f}" y1="18" x2="{sx(v_min):.1f}" y2="32" '
            f'stroke="#94a3b8" stroke-width="1.5"/>'
            # Max whisker
            f'<line x1="{sx(v_max):.1f}" y1="18" x2="{sx(v_max):.1f}" y2="32" '
            f'stroke="#94a3b8" stroke-width="1.5"/>'
            # IQR box
            f'<rect x="{sx(q1):.1f}" y="14" width="{sx(q3) - sx(q1):.1f}" height="22" '
            f'fill="#a5f3fc" stroke="#0891b2" stroke-width="1.5" rx="3"/>'
            # Median line
            f'<line x1="{sx(median):.1f}" y1="12" x2="{sx(median):.1f}" y2="38" '
            f'stroke="#0e4f6e" stroke-width="2"/>'
            # Labels
            f'<text x="{sx(v_min):.1f}" y="46" text-anchor="middle" font-size="9" fill="#6c757d">{v_min:.1f}</text>'
            f'<text x="{sx(median):.1f}" y="10" text-anchor="middle" font-size="9" fill="#0e4f6e" font-weight="600">{median:.1f}</text>'
            f'<text x="{sx(v_max):.1f}" y="46" text-anchor="middle" font-size="9" fill="#6c757d">{v_max:.1f}</text>'
            f'</svg>'
        )
        html_parts.append(
            f'<div style="margin:8px 0;"><strong style="color:#155e75;">{label}</strong>'
            f'<div class="chart-container" style="padding:8px;">{box_svg}</div></div>'
        )

    # --- Chemical Diversity ---
    html_parts.append("<h2>Chemical Diversity Analysis</h2>")

    if sim_matrix and len(sim_matrix) > 1:
        # Compute average pairwise similarity (off-diagonal)
        n_mols = len(sim_matrix)
        off_diag = []
        for i in range(n_mols):
            for j in range(i + 1, n_mols):
                off_diag.append(sim_matrix[i][j])

        avg_sim = sum(off_diag) / len(off_diag) if off_diag else 0
        max_sim = max(off_diag) if off_diag else 0
        min_sim = min(off_diag) if off_diag else 0

        # Find most similar pair
        best_i, best_j = 0, 1
        best_val = 0
        for i in range(n_mols):
            for j in range(i + 1, n_mols):
                if sim_matrix[i][j] > best_val:
                    best_val = sim_matrix[i][j]
                    best_i, best_j = i, j

        html_parts.append('<div class="stat-grid">')
        html_parts.append(
            f'<div class="stat"><div class="value">{avg_sim:.3f}</div>'
            f'<div class="label">Avg. Pairwise Similarity</div></div>'
        )
        html_parts.append(
            f'<div class="stat"><div class="value">{min_sim:.3f}</div>'
            f'<div class="label">Min Similarity</div></div>'
        )
        html_parts.append(
            f'<div class="stat"><div class="value">{max_sim:.3f}</div>'
            f'<div class="label">Max Similarity</div></div>'
        )
        html_parts.append("</div>")

        diversity_text = "highly diverse" if avg_sim < 0.3 else "moderately diverse" if avg_sim < 0.5 else "relatively similar"
        html_parts.append(
            f'<div class="note">'
            f'The library is <strong>{diversity_text}</strong> (avg. Tanimoto = {avg_sim:.3f}). '
            f'The most similar pair is <strong>{sim_labels[best_i]}</strong> and '
            f'<strong>{sim_labels[best_j]}</strong> (similarity = {best_val:.3f}).</div>'
        )

    # --- Recommendation ---
    html_parts.append("<h2>Recommendation</h2>")
    if top:
        html_parts.append(
            f'<div class="card">'
            f'<h3 style="margin-top:0;color:#0891b2;">Top Candidate: {top["name"]}</h3>'
            f'<p>Based on the virtual screening analysis, <strong>{top["name"]}</strong> '
            f'achieved the highest composite screening score of <strong>{top["screening_score"]:.3f}</strong>. '
        )

        reasons = []
        if top["lipinski_pass"]:
            reasons.append("full Lipinski Rule of Five compliance")
        if top["qed"] > 0.5:
            reasons.append(f"high drug-likeness (QED = {top['qed']:.3f})")
        if top.get("all_criteria_met"):
            reasons.append("all target profile criteria met")
        if top["mw"] <= 500:
            reasons.append(f"favorable molecular weight ({top['mw']:.1f} Da)")

        if reasons:
            html_parts.append(
                f'This candidate stands out due to: {", ".join(reasons)}.</p>'
            )
        else:
            html_parts.append("</p>")

        # Runner-up mentions
        if len(ranked) >= 2:
            html_parts.append(
                f'<p style="font-size:0.9em;color:#6c757d;">Runner-up candidates: '
            )
            runners = []
            for m in ranked[1:4]:
                runners.append(f'{m["name"]} (score: {m["screening_score"]:.3f})')
            html_parts.append(", ".join(runners) + ".</p>")

        html_parts.append("</div>")

    # Final note
    html_parts.append(
        '<div class="note">'
        "This is a virtual screening analysis. All candidates should undergo "
        "further computational validation (molecular dynamics, docking) and "
        "experimental testing before advancing to clinical trials.</div>"
    )

    await flyte.report.replace.aio(
        _wrap_report("\n".join(html_parts)),
        do_flush=True,
    )

    # JSON summary
    summary = {
        "total_screened": total,
        "lipinski_passes": lipinski_pass,
        "all_criteria_met": all_criteria,
        "top_candidate": top["name"] if top else None,
        "top_score": top["screening_score"] if top else None,
        "top_3": [
            {"name": m["name"], "score": m["screening_score"]}
            for m in ranked[:3]
        ],
    }
    return json.dumps(summary)

# ------------------------------------------------------------------
# Agent
# ------------------------------------------------------------------

# {{docs-fragment agent}}
SCREENING_AGENT_INSTRUCTIONS = """\
You are a medicinal chemistry screening strategist. You orchestrate a virtual \
screening pipeline using durable Flyte tools. You NEVER invent molecular \
properties — only RDKit tools compute them.

Workflow:
1. If target_profile is not provided in the user message, derive a JSON \
target_profile from the therapeutic brief. Valid keys: mw, logp, hbd, hba, tpsa \
(each [min, max]). Ground choices in oral bioavailability / kinase / CNS rules \
as appropriate to the brief.
2. First pass (always): load_molecules → compute_properties → \
screen_candidates → generate_report. Pass tool outputs between steps exactly \
(molecule_dir from load_molecules into compute_properties and generate_report; \
properties_json from compute_properties into screen_candidates and \
generate_report; screening_json must be the complete, unmodified string \
returned by screen_candidates — never rebuild or summarize JSON yourself).
3. Read the JSON summary returned by generate_report. Reflect:
   - If all_criteria_met == 0: relax exactly ONE profile bound by ~10–20% \
and re-run screen_candidates then generate_report only, reusing the same \
molecule_dir and properties_json from the first pass.
   - If all molecules pass but diversity is a stated goal: note high similarity \
in your summary; do not re-run unless brief asks for stricter filters.
   - Maximum ONE rescreen iteration.
4. Finish with plain text: top candidate, rationale tied to computed metrics \
from the tool JSON, funnel interpretation, and suggested next steps (docking, \
ADMET lab tests).

If the user supplies an explicit target_profile JSON, use it as-is.

Do NOT ask the user for SMILES or molecule lists when molecules_json is empty — \
the default library is loaded automatically.
"""

screening_agent = Agent(
    name="drug-screening-agent",
    instructions=SCREENING_AGENT_INSTRUCTIONS,
    model=MODEL,
    tools=[
        load_molecules,
        compute_properties,
        screen_candidates,
        generate_report,
    ],
    max_turns=12,
)
# {{/docs-fragment agent}}

# ------------------------------------------------------------------
# Pipeline
# ------------------------------------------------------------------

# {{docs-fragment pipeline}}
@env.task(report=True)
async def pipeline(
    brief: str = "Screen the default drug library for orally bioavailable small molecules.",
    molecules_json: str = "",
    target_profile: str = "",
) -> str:
    """Agentic virtual drug molecule screening pipeline.

    A medicinal-chemistry agent interprets the screening brief, derives or
    applies a target profile, orchestrates the RDKit screening stages, and
    optionally re-screens when funnel results are too narrow.

    Args:
        brief: Natural-language therapeutic goal (e.g. oral kinase inhibitors,
            CNS-penetrant small molecules).
        molecules_json: JSON mapping molecule names to SMILES strings.
            Defaults to a curated library of ~15 well-known drugs.
        target_profile: Optional JSON with desired property ranges that
            overrides agent-derived criteria
            (e.g. {"mw": [150, 500], "logp": [-0.5, 5]}).

    Returns:
        Agent summary with screening rationale and key results.
    """
    prompt_parts = [
        f"Screening brief: {brief}",
        'Use molecules_json="" for the built-in default library unless provided below.',
        "Compose the four stage tools in order: load_molecules → compute_properties "
        "→ screen_candidates → generate_report. Pass each tool's full return value "
        "verbatim to the next step (especially screening_json). Re-run "
        "screen_candidates and generate_report at most once if the funnel is too narrow.",
    ]
    if molecules_json.strip():
        prompt_parts.append(f"molecules_json: {molecules_json}")
    if target_profile.strip():
        prompt_parts.append(f"Use this target_profile exactly: {target_profile}")

    result = await screening_agent.run.aio("\n".join(prompt_parts))
    return result.summary or result.error or ""

# {{/docs-fragment pipeline}}

# ------------------------------------------------------------------
# Rescreen demo — tight profile + explicit rescreen instructions
# ------------------------------------------------------------------

# Initial profile is deliberately strict (narrow MW + low LogP cap) so
# all_criteria_met is typically 0 on the default library; the brief then
# forces a single rescreen with a widened LogP window.
RESCREEN_DEMO_TARGET_PROFILE = (
    '{"mw": [150, 200], "logp": [-0.5, 1.0], "hbd": [0, 1], '
    '"hba": [0, 3], "tpsa": [20, 45]}'
)
RESCREEN_DEMO_TARGET_PROFILE_RESCREEN = (
    '{"mw": [150, 200], "logp": [-0.5, 3.5], "hbd": [0, 1], '
    '"hba": [0, 3], "tpsa": [20, 45]}'
)
RESCREEN_DEMO_BRIEF = f"""\
Two-round agentic screening demo on the default library.

**Round 1 (strict profile):** load_molecules → compute_properties → \
screen_candidates → generate_report using the initial target_profile exactly.

**Round 2 (required — do not skip):** call screen_candidates then generate_report \
again, reusing the same molecule_dir and properties_json from round 1, with this \
relaxed target_profile (wider LogP window only): \
{RESCREEN_DEMO_TARGET_PROFILE_RESCREEN}

Pass every tool return value verbatim to the next step. After both rounds, \
summarize how the funnel and top candidates changed between round 1 and round 2."""

# {{docs-fragment rescreen_demo}}
@env.task(report=True)
async def rescreen_demo() -> str:
    """Example run with a two-round execution graph (rescreen).

    Round 1 uses a strict CNS-like profile; round 2 always re-runs
    screen_candidates and generate_report with a widened LogP window,
    reusing cached molecule_dir and properties_json.
    """
    return await pipeline(
        brief=RESCREEN_DEMO_BRIEF,
        target_profile=RESCREEN_DEMO_TARGET_PROFILE,
    )

# {{/docs-fragment rescreen_demo}}

# {{docs-fragment main}}
if __name__ == "__main__":
    flyte.init_from_config()
    run = flyte.run(pipeline)
    print(run.url)
    run.wait()
# {{/docs-fragment main}}
```

*Source: https://github.com/unionai/unionai-examples/blob/main/v2/tutorials/drug_molecule_screening/drug_molecule_screening.py*

```
flyte run drug_molecule_screening.py rescreen_demo
```

Or pass the same inputs to `pipeline` directly:

```
flyte run drug_molecule_screening.py pipeline \
  --brief "Screen the default library. If all_criteria_met is 0 after generate_report, re-run screen_candidates and generate_report with target_profile {\"mw\": [150, 200], \"logp\": [-0.5, 3.5], \"hbd\": [0, 1], \"hba\": [0, 3], \"tpsa\": [20, 45]}." \
  --target_profile '{"mw": [150, 200], "logp": [-0.5, 1.0], "hbd": [0, 1], "hba": [0, 3], "tpsa": [20, 45]}'
```

Open the run URL and follow the report panel for funnel charts, property distributions, top-candidate spotlights, and the agent's final screening summary. A successful rescreen demo shows two rounds of `screen_candidates` and `generate_report` in the action tree.

---
**Source**: https://github.com/unionai/unionai-docs/blob/main/content/tutorials/biotech-healthcare/drug-molecule-screening/_index.md
**HTML**: https://www.union.ai/docs/v2/union/tutorials/biotech-healthcare/drug-molecule-screening/
